summaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
-rw-r--r--.clang-format4
-rw-r--r--core/input/input.cpp19
-rw-r--r--core/input/input_event.cpp8
-rw-r--r--core/input/input_map.h4
-rw-r--r--core/io/image.h2
-rw-r--r--core/io/marshalls.h6
-rw-r--r--core/math/a_star.cpp2
-rw-r--r--core/math/aabb.h2
-rw-r--r--core/math/basis.cpp19
-rw-r--r--core/math/basis.h4
-rw-r--r--core/math/bvh_logic.inc50
-rw-r--r--core/math/camera_matrix.cpp22
-rw-r--r--core/math/convex_hull.cpp18
-rw-r--r--core/math/face3.h14
-rw-r--r--core/math/math_defs.h8
-rw-r--r--core/math/math_funcs.h8
-rw-r--r--core/math/plane.cpp2
-rw-r--r--core/math/rect2.h10
-rw-r--r--core/math/transform_2d.cpp4
-rw-r--r--core/math/transform_2d.h2
-rw-r--r--core/math/transform_3d.cpp6
-rw-r--r--core/math/triangulate.cpp11
-rw-r--r--core/math/vector2.cpp9
-rw-r--r--core/math/vector3.cpp9
-rw-r--r--core/object/object.cpp2
-rw-r--r--core/string/translation.cpp4
-rw-r--r--core/string/ustring.cpp114
-rw-r--r--core/templates/hash_map.h6
-rw-r--r--core/templates/list.h16
-rw-r--r--core/templates/vector.h2
-rw-r--r--core/variant/type_info.h2
-rw-r--r--core/variant/variant.cpp4
-rw-r--r--drivers/vulkan/rendering_device_vulkan.cpp64
-rw-r--r--drivers/vulkan/vulkan_context.cpp30
-rw-r--r--editor/action_map_editor.cpp14
-rw-r--r--editor/editor_about.cpp2
-rw-r--r--editor/editor_node.cpp6
-rw-r--r--editor/editor_properties.cpp24
-rw-r--r--editor/filesystem_dock.cpp2
-rw-r--r--editor/import/collada.cpp28
-rw-r--r--editor/import/editor_import_collada.cpp3
-rw-r--r--editor/import/resource_importer_scene.cpp15
-rw-r--r--editor/import/resource_importer_wav.cpp14
-rw-r--r--editor/plugins/canvas_item_editor_plugin.cpp14
-rw-r--r--editor/plugins/curve_editor_plugin.cpp6
-rw-r--r--editor/plugins/node_3d_editor_gizmos.cpp18
-rw-r--r--editor/plugins/node_3d_editor_plugin.cpp4
-rw-r--r--editor/plugins/path_3d_editor_plugin.cpp9
-rw-r--r--editor/plugins/script_editor_plugin.cpp5
-rw-r--r--editor/plugins/script_text_editor.cpp11
-rw-r--r--editor/plugins/visual_shader_editor_plugin.cpp5
-rw-r--r--editor/property_editor.cpp10
-rw-r--r--editor/rename_dialog.cpp2
-rw-r--r--main/main.cpp12
-rw-r--r--modules/bmp/image_loader_bmp.cpp6
-rw-r--r--modules/csg/csg.cpp4
-rw-r--r--modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp46
-rw-r--r--modules/fbx/fbx_parser/FBXCommon.h4
-rw-r--r--modules/fbx/fbx_parser/FBXDocument.h26
-rw-r--r--modules/fbx/fbx_parser/FBXDocumentUtil.h4
-rw-r--r--modules/fbx/fbx_parser/FBXImportSettings.h68
-rw-r--r--modules/fbx/fbx_parser/FBXMeshGeometry.h6
-rw-r--r--modules/fbx/fbx_parser/FBXParser.cpp7
-rw-r--r--modules/fbx/fbx_parser/FBXParser.h2
-rw-r--r--modules/fbx/fbx_parser/FBXProperties.cpp12
-rw-r--r--modules/fbx/fbx_parser/FBXUtil.cpp8
-rw-r--r--modules/fbx/fbx_parser/FBXUtil.h34
-rw-r--r--modules/fbx/tools/import_utils.h20
-rw-r--r--modules/gdnative/pluginscript/pluginscript_script.cpp7
-rw-r--r--modules/gdscript/gdscript.cpp18
-rw-r--r--modules/gdscript/gdscript_parser.cpp6
-rw-r--r--modules/gdscript/gdscript_vm.cpp12
-rw-r--r--modules/gdscript/language_server/lsp.hpp86
-rw-r--r--modules/gltf/gltf_document.cpp5
-rw-r--r--modules/lightmapper_rd/lightmapper_rd.h14
-rw-r--r--modules/mono/csharp_script.cpp43
-rw-r--r--modules/mono/editor/bindings_generator.cpp43
-rw-r--r--modules/mono/mono_gd/gd_mono.cpp60
-rw-r--r--modules/mono/mono_gd/gd_mono.h4
-rw-r--r--modules/mono/mono_gd/gd_mono_class.cpp4
-rw-r--r--modules/mono/mono_gd/gd_mono_marshal.cpp58
-rw-r--r--modules/mono/mono_gd/gd_mono_marshal.h56
-rw-r--r--modules/mono/mono_gd/gd_mono_wasm_m2n.h2
-rw-r--r--modules/mono/utils/string_utils.cpp36
-rw-r--r--modules/pvr/texture_loader_pvr.cpp6
-rw-r--r--modules/upnp/upnp.cpp8
-rw-r--r--modules/visual_script/visual_script.cpp16
-rw-r--r--modules/visual_script/visual_script_editor.cpp2
-rw-r--r--platform/android/android_keys_utils.h44
-rw-r--r--platform/android/export/export_plugin.cpp21
-rw-r--r--platform/android/export/godot_plugin_config.cpp7
-rw-r--r--platform/android/export/gradle_export_util.cpp2
-rw-r--r--platform/android/java/lib/src/org/godotengine/godot/Godot.java3
-rw-r--r--platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java22
-rw-r--r--platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java16
-rw-r--r--platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java4
-rw-r--r--platform/iphone/export/export_plugin.cpp6
-rw-r--r--platform/javascript/export/export_plugin.cpp2
-rw-r--r--platform/linuxbsd/display_server_x11.cpp60
-rw-r--r--platform/osx/export/export_plugin.cpp10
-rw-r--r--platform/osx/joypad_osx.cpp8
-rw-r--r--platform/uwp/app_uwp.cpp3
-rw-r--r--platform/uwp/export/export_plugin.h14
-rw-r--r--platform/windows/key_mapping_windows.cpp18
-rw-r--r--scene/2d/line_builder.cpp6
-rw-r--r--scene/2d/tile_map.cpp72
-rw-r--r--scene/3d/cpu_particles_3d.cpp3
-rw-r--r--scene/3d/gpu_particles_collision_3d.cpp15
-rw-r--r--scene/3d/node_3d.cpp16
-rw-r--r--scene/3d/vehicle_body_3d.cpp6
-rw-r--r--scene/gui/control.cpp4
-rw-r--r--scene/gui/file_dialog.cpp2
-rw-r--r--scene/gui/rich_text_label.h4
-rw-r--r--scene/main/viewport.cpp8
-rw-r--r--scene/resources/animation.cpp9
-rw-r--r--servers/audio/audio_filter_sw.cpp14
-rw-r--r--servers/physics_3d/godot_body_pair_3d.cpp6
-rw-r--r--servers/physics_3d/godot_soft_body_3d.cpp8
-rw-r--r--servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp31
-rw-r--r--servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp35
-rw-r--r--servers/physics_3d/joints/godot_generic_6dof_joint_3d.h20
-rw-r--r--servers/physics_3d/joints/godot_hinge_joint_3d.cpp72
-rw-r--r--servers/physics_3d/joints/godot_pin_joint_3d.cpp22
-rw-r--r--servers/physics_3d/joints/godot_slider_joint_3d.cpp36
-rw-r--r--servers/rendering/renderer_canvas_cull.cpp3
-rw-r--r--servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp4
-rw-r--r--servers/rendering/renderer_rd/shaders/canvas.glsl45
-rw-r--r--servers/rendering/renderer_rd/shaders/particles.glsl10
-rw-r--r--servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl5
-rw-r--r--servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl22
-rw-r--r--servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl10
-rw-r--r--servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl18
-rw-r--r--servers/rendering/renderer_rd/shaders/tonemap.glsl6
-rw-r--r--servers/rendering/shader_language.cpp40
-rw-r--r--tests/test_class_db.h20
135 files changed, 1052 insertions, 1184 deletions
diff --git a/.clang-format b/.clang-format
index 9ddb19e57c..e011f060b7 100644
--- a/.clang-format
+++ b/.clang-format
@@ -12,7 +12,7 @@ AlignAfterOpenBracket: DontAlign
# AlignConsecutiveBitFields: None
# AlignConsecutiveDeclarations: None
# AlignEscapedNewlines: Right
-# AlignOperands: Align
+AlignOperands: DontAlign
AlignTrailingComments: false
# AllowAllArgumentsOnNextLine: true
# AllowAllConstructorInitializersOnNextLine: true
@@ -56,7 +56,7 @@ AllowShortFunctionsOnASingleLine: Inline
# BreakBeforeBraces: Attach
# BreakBeforeInheritanceComma: false
# BreakInheritanceList: BeforeColon
-BreakBeforeTernaryOperators: false
+# BreakBeforeTernaryOperators: true
# BreakConstructorInitializersBeforeComma: false
BreakConstructorInitializers: AfterColon
# BreakStringLiterals: true
diff --git a/core/input/input.cpp b/core/input/input.cpp
index c3b43a4274..12028efc56 100644
--- a/core/input/input.cpp
+++ b/core/input/input.cpp
@@ -164,10 +164,11 @@ void Input::_bind_methods() {
void Input::get_argument_options(const StringName &p_function, int p_idx, List<String> *r_options) const {
String pf = p_function;
- if (p_idx == 0 && (pf == "is_action_pressed" || pf == "action_press" || pf == "action_release" ||
- pf == "is_action_just_pressed" || pf == "is_action_just_released" ||
- pf == "get_action_strength" || pf == "get_action_raw_strength" ||
- pf == "get_axis" || pf == "get_vector")) {
+ if (p_idx == 0 &&
+ (pf == "is_action_pressed" || pf == "action_press" || pf == "action_release" ||
+ pf == "is_action_just_pressed" || pf == "is_action_just_released" ||
+ pf == "get_action_strength" || pf == "get_action_raw_strength" ||
+ pf == "get_axis" || pf == "get_vector")) {
List<PropertyInfo> pinfo;
ProjectSettings::get_singleton()->get_property_list(&pinfo);
@@ -315,11 +316,11 @@ Vector2 Input::get_vector(const StringName &p_negative_x, const StringName &p_po
if (p_deadzone < 0.0f) {
// If the deadzone isn't specified, get it from the average of the actions.
- p_deadzone = (InputMap::get_singleton()->action_get_deadzone(p_positive_x) +
- InputMap::get_singleton()->action_get_deadzone(p_negative_x) +
- InputMap::get_singleton()->action_get_deadzone(p_positive_y) +
- InputMap::get_singleton()->action_get_deadzone(p_negative_y)) /
- 4;
+ p_deadzone = 0.25 *
+ (InputMap::get_singleton()->action_get_deadzone(p_positive_x) +
+ InputMap::get_singleton()->action_get_deadzone(p_negative_x) +
+ InputMap::get_singleton()->action_get_deadzone(p_positive_y) +
+ InputMap::get_singleton()->action_get_deadzone(p_negative_y));
}
// Circular length limiting and deadzone.
diff --git a/core/input/input_event.cpp b/core/input/input_event.cpp
index c6448b1e44..af3190bb17 100644
--- a/core/input/input_event.cpp
+++ b/core/input/input_event.cpp
@@ -454,10 +454,10 @@ bool InputEventKey::is_match(const Ref<InputEvent> &p_event, bool p_exact_match)
if (keycode == 0) {
return physical_keycode == key->physical_keycode &&
- (!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
+ (!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
} else {
return keycode == key->keycode &&
- (!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
+ (!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
}
}
@@ -616,7 +616,7 @@ bool InputEventMouseButton::is_match(const Ref<InputEvent> &p_event, bool p_exac
}
return button_index == mb->button_index &&
- (!p_exact_match || get_modifiers_mask() == mb->get_modifiers_mask());
+ (!p_exact_match || get_modifiers_mask() == mb->get_modifiers_mask());
}
static const char *_mouse_button_descriptions[9] = {
@@ -935,7 +935,7 @@ bool InputEventJoypadMotion::is_match(const Ref<InputEvent> &p_event, bool p_exa
}
return axis == jm->axis &&
- (!p_exact_match || ((axis_value < 0) == (jm->axis_value < 0)));
+ (!p_exact_match || ((axis_value < 0) == (jm->axis_value < 0)));
}
static const char *_joy_axis_descriptions[JOY_AXIS_MAX] = {
diff --git a/core/input/input_map.h b/core/input/input_map.h
index 8bef722089..0bf572ddca 100644
--- a/core/input/input_map.h
+++ b/core/input/input_map.h
@@ -41,8 +41,8 @@ class InputMap : public Object {
public:
/**
- * A special value used to signify that a given Action can be triggered by any device
- */
+ * A special value used to signify that a given Action can be triggered by any device
+ */
static int ALL_DEVICES;
struct Action {
diff --git a/core/io/image.h b/core/io/image.h
index 8f1b251ac3..d31a065aa7 100644
--- a/core/io/image.h
+++ b/core/io/image.h
@@ -41,7 +41,7 @@
* Image storage class. This is used to store an image in user memory, as well as
* providing some basic methods for image manipulation.
* Images can be loaded from a file, or registered into the Render object as textures.
-*/
+ */
class Image;
diff --git a/core/io/marshalls.h b/core/io/marshalls.h
index 05804d5a46..9ea060e48c 100644
--- a/core/io/marshalls.h
+++ b/core/io/marshalls.h
@@ -44,9 +44,9 @@ typedef uint32_t uintr_t;
#endif
/**
- * Miscellaneous helpers for marshalling data types, and encoding
- * in an endian independent way
- */
+ * Miscellaneous helpers for marshalling data types, and encoding
+ * in an endian independent way
+ */
union MarshallFloat {
uint32_t i; ///< int
diff --git a/core/math/a_star.cpp b/core/math/a_star.cpp
index d59dbf1ba8..1079da75ef 100644
--- a/core/math/a_star.cpp
+++ b/core/math/a_star.cpp
@@ -239,7 +239,7 @@ bool AStar::are_points_connected(int p_id, int p_with_id, bool bidirectional) co
const Set<Segment>::Element *element = segments.find(s);
return element != nullptr &&
- (bidirectional || (element->get().direction & s.direction) == s.direction);
+ (bidirectional || (element->get().direction & s.direction) == s.direction);
}
void AStar::clear() {
diff --git a/core/math/aabb.h b/core/math/aabb.h
index 97d92fbe37..c458e61475 100644
--- a/core/math/aabb.h
+++ b/core/math/aabb.h
@@ -200,7 +200,7 @@ Vector3 AABB::get_support(const Vector3 &p_normal) const {
(p_normal.x > 0) ? half_extents.x : -half_extents.x,
(p_normal.y > 0) ? half_extents.y : -half_extents.y,
(p_normal.z > 0) ? half_extents.z : -half_extents.z) +
- ofs;
+ ofs;
}
Vector3 AABB::get_endpoint(int p_point) const {
diff --git a/core/math/basis.cpp b/core/math/basis.cpp
index 0030cb1144..3d893afb4d 100644
--- a/core/math/basis.cpp
+++ b/core/math/basis.cpp
@@ -58,8 +58,8 @@ void Basis::invert() {
cofac(1, 1, 2, 2), cofac(1, 2, 2, 0), cofac(1, 0, 2, 1)
};
real_t det = elements[0][0] * co[0] +
- elements[0][1] * co[1] +
- elements[0][2] * co[2];
+ elements[0][1] * co[1] +
+ elements[0][2] * co[2];
#ifdef MATH_CHECKS
ERR_FAIL_COND(det == 0);
#endif
@@ -288,10 +288,7 @@ Vector3 Basis::get_scale() const {
//
// The rotation part of this decomposition is returned by get_rotation* functions.
real_t det_sign = SGN(determinant());
- return det_sign * Vector3(
- Vector3(elements[0][0], elements[1][0], elements[2][0]).length(),
- Vector3(elements[0][1], elements[1][1], elements[2][1]).length(),
- Vector3(elements[0][2], elements[1][2], elements[2][2]).length());
+ return det_sign * get_scale_abs();
}
// Decomposes a Basis into a rotation-reflection matrix (an element of the group O(3)) and a positive scaling matrix as B = O.S.
@@ -682,8 +679,8 @@ bool Basis::operator!=(const Basis &p_matrix) const {
Basis::operator String() const {
return "[X: " + get_axis(0).operator String() +
- ", Y: " + get_axis(1).operator String() +
- ", Z: " + get_axis(2).operator String() + "]";
+ ", Y: " + get_axis(1).operator String() +
+ ", Z: " + get_axis(2).operator String() + "]";
}
Quaternion Basis::get_quaternion() const {
@@ -704,9 +701,9 @@ Quaternion Basis::get_quaternion() const {
temp[1] = ((m.elements[0][2] - m.elements[2][0]) * s);
temp[2] = ((m.elements[1][0] - m.elements[0][1]) * s);
} else {
- int i = m.elements[0][0] < m.elements[1][1] ?
- (m.elements[1][1] < m.elements[2][2] ? 2 : 1) :
- (m.elements[0][0] < m.elements[2][2] ? 2 : 0);
+ int i = m.elements[0][0] < m.elements[1][1]
+ ? (m.elements[1][1] < m.elements[2][2] ? 2 : 1)
+ : (m.elements[0][0] < m.elements[2][2] ? 2 : 0);
int j = (i + 1) % 3;
int k = (i + 2) % 3;
diff --git a/core/math/basis.h b/core/math/basis.h
index 617d005f19..e2fdb95685 100644
--- a/core/math/basis.h
+++ b/core/math/basis.h
@@ -324,7 +324,7 @@ Vector3 Basis::xform_inv(const Vector3 &p_vector) const {
real_t Basis::determinant() const {
return elements[0][0] * (elements[1][1] * elements[2][2] - elements[2][1] * elements[1][2]) -
- elements[1][0] * (elements[0][1] * elements[2][2] - elements[2][1] * elements[0][2]) +
- elements[2][0] * (elements[0][1] * elements[1][2] - elements[1][1] * elements[0][2]);
+ elements[1][0] * (elements[0][1] * elements[2][2] - elements[2][1] * elements[0][2]) +
+ elements[2][0] * (elements[0][1] * elements[1][2] - elements[1][1] * elements[0][2]);
}
#endif // BASIS_H
diff --git a/core/math/bvh_logic.inc b/core/math/bvh_logic.inc
index afab08f151..c65002a9fd 100644
--- a/core/math/bvh_logic.inc
+++ b/core/math/bvh_logic.inc
@@ -42,24 +42,24 @@ BVHABB_CLASS _logic_abb_merge(const BVHABB_CLASS &a, const BVHABB_CLASS &b) {
//--------------------------------------------------------------------------------------------------
/**
-@file q3DynamicAABBTree.h
-@author Randy Gaul
-@date 10/10/2014
- Copyright (c) 2014 Randy Gaul http://www.randygaul.net
- This software is provided 'as-is', without any express or implied
- warranty. In no event will the authors be held liable for any damages
- arising from the use of this software.
- Permission is granted to anyone to use this software for any purpose,
- including commercial applications, and to alter it and redistribute it
- freely, subject to the following restrictions:
- 1. The origin of this software must not be misrepresented; you must not
- claim that you wrote the original software. If you use this software
- in a product, an acknowledgment in the product documentation would be
- appreciated but is not required.
- 2. Altered source versions must be plainly marked as such, and must not
- be misrepresented as being the original software.
- 3. This notice may not be removed or altered from any source distribution.
-*/
+ * @file q3DynamicAABBTree.h
+ * @author Randy Gaul
+ * @date 10/10/2014
+ * Copyright (c) 2014 Randy Gaul http://www.randygaul.net
+ * This software is provided 'as-is', without any express or implied
+ * warranty. In no event will the authors be held liable for any damages
+ * arising from the use of this software.
+ * Permission is granted to anyone to use this software for any purpose,
+ * including commercial applications, and to alter it and redistribute it
+ * freely, subject to the following restrictions:
+ * 1. The origin of this software must not be misrepresented; you must not
+ * claim that you wrote the original software. If you use this software
+ * in a product, an acknowledgment in the product documentation would be
+ * appreciated but is not required.
+ * 2. Altered source versions must be plainly marked as such, and must not
+ * be misrepresented as being the original software.
+ * 3. This notice may not be removed or altered from any source distribution.
+ */
//--------------------------------------------------------------------------------------------------
// This function is based on the 'Balance' function from Randy Gaul's qu3e
@@ -67,7 +67,7 @@ BVHABB_CLASS _logic_abb_merge(const BVHABB_CLASS &a, const BVHABB_CLASS &b) {
// It is MODIFIED from qu3e version.
// This is the only function used (and _logic_abb_merge helper function).
int32_t _logic_balance(int32_t iA, uint32_t p_tree_id) {
- // return iA; // uncomment this to bypass balance
+ //return iA; // uncomment this to bypass balance
TNode *A = &_nodes[iA];
@@ -75,12 +75,12 @@ int32_t _logic_balance(int32_t iA, uint32_t p_tree_id) {
return iA;
}
- /* A
- / \
- B C
- / \ / \
- D E F G
- */
+ /* A
+ * / \
+ * B C
+ * / \ / \
+ * D E F G
+ */
CRASH_COND(A->num_children != 2);
int32_t iB = A->children[0];
diff --git a/core/math/camera_matrix.cpp b/core/math/camera_matrix.cpp
index 8066a59281..48984c4d5b 100644
--- a/core/math/camera_matrix.cpp
+++ b/core/math/camera_matrix.cpp
@@ -35,17 +35,17 @@
float CameraMatrix::determinant() const {
return matrix[0][3] * matrix[1][2] * matrix[2][1] * matrix[3][0] - matrix[0][2] * matrix[1][3] * matrix[2][1] * matrix[3][0] -
- matrix[0][3] * matrix[1][1] * matrix[2][2] * matrix[3][0] + matrix[0][1] * matrix[1][3] * matrix[2][2] * matrix[3][0] +
- matrix[0][2] * matrix[1][1] * matrix[2][3] * matrix[3][0] - matrix[0][1] * matrix[1][2] * matrix[2][3] * matrix[3][0] -
- matrix[0][3] * matrix[1][2] * matrix[2][0] * matrix[3][1] + matrix[0][2] * matrix[1][3] * matrix[2][0] * matrix[3][1] +
- matrix[0][3] * matrix[1][0] * matrix[2][2] * matrix[3][1] - matrix[0][0] * matrix[1][3] * matrix[2][2] * matrix[3][1] -
- matrix[0][2] * matrix[1][0] * matrix[2][3] * matrix[3][1] + matrix[0][0] * matrix[1][2] * matrix[2][3] * matrix[3][1] +
- matrix[0][3] * matrix[1][1] * matrix[2][0] * matrix[3][2] - matrix[0][1] * matrix[1][3] * matrix[2][0] * matrix[3][2] -
- matrix[0][3] * matrix[1][0] * matrix[2][1] * matrix[3][2] + matrix[0][0] * matrix[1][3] * matrix[2][1] * matrix[3][2] +
- matrix[0][1] * matrix[1][0] * matrix[2][3] * matrix[3][2] - matrix[0][0] * matrix[1][1] * matrix[2][3] * matrix[3][2] -
- matrix[0][2] * matrix[1][1] * matrix[2][0] * matrix[3][3] + matrix[0][1] * matrix[1][2] * matrix[2][0] * matrix[3][3] +
- matrix[0][2] * matrix[1][0] * matrix[2][1] * matrix[3][3] - matrix[0][0] * matrix[1][2] * matrix[2][1] * matrix[3][3] -
- matrix[0][1] * matrix[1][0] * matrix[2][2] * matrix[3][3] + matrix[0][0] * matrix[1][1] * matrix[2][2] * matrix[3][3];
+ matrix[0][3] * matrix[1][1] * matrix[2][2] * matrix[3][0] + matrix[0][1] * matrix[1][3] * matrix[2][2] * matrix[3][0] +
+ matrix[0][2] * matrix[1][1] * matrix[2][3] * matrix[3][0] - matrix[0][1] * matrix[1][2] * matrix[2][3] * matrix[3][0] -
+ matrix[0][3] * matrix[1][2] * matrix[2][0] * matrix[3][1] + matrix[0][2] * matrix[1][3] * matrix[2][0] * matrix[3][1] +
+ matrix[0][3] * matrix[1][0] * matrix[2][2] * matrix[3][1] - matrix[0][0] * matrix[1][3] * matrix[2][2] * matrix[3][1] -
+ matrix[0][2] * matrix[1][0] * matrix[2][3] * matrix[3][1] + matrix[0][0] * matrix[1][2] * matrix[2][3] * matrix[3][1] +
+ matrix[0][3] * matrix[1][1] * matrix[2][0] * matrix[3][2] - matrix[0][1] * matrix[1][3] * matrix[2][0] * matrix[3][2] -
+ matrix[0][3] * matrix[1][0] * matrix[2][1] * matrix[3][2] + matrix[0][0] * matrix[1][3] * matrix[2][1] * matrix[3][2] +
+ matrix[0][1] * matrix[1][0] * matrix[2][3] * matrix[3][2] - matrix[0][0] * matrix[1][1] * matrix[2][3] * matrix[3][2] -
+ matrix[0][2] * matrix[1][1] * matrix[2][0] * matrix[3][3] + matrix[0][1] * matrix[1][2] * matrix[2][0] * matrix[3][3] +
+ matrix[0][2] * matrix[1][0] * matrix[2][1] * matrix[3][3] - matrix[0][0] * matrix[1][2] * matrix[2][1] * matrix[3][3] -
+ matrix[0][1] * matrix[1][0] * matrix[2][2] * matrix[3][3] + matrix[0][0] * matrix[1][1] * matrix[2][2] * matrix[3][3];
}
void CameraMatrix::set_identity() {
diff --git a/core/math/convex_hull.cpp b/core/math/convex_hull.cpp
index 684814b1ae..f6560f1bea 100644
--- a/core/math/convex_hull.cpp
+++ b/core/math/convex_hull.cpp
@@ -265,8 +265,7 @@ public:
}
int32_t get_sign() const {
- return ((int64_t)high < 0) ? -1 : (high || low) ? 1 :
- 0;
+ return ((int64_t)high < 0) ? -1 : ((high || low) ? 1 : 0);
}
bool operator<(const Int128 &b) const {
@@ -735,8 +734,6 @@ int32_t ConvexHullInternal::Rational64::compare(const Rational64 &b) const {
return 0;
}
- // return (numerator * b.denominator > b.numerator * denominator) ? sign : (numerator * b.denominator < b.numerator * denominator) ? -sign : 0;
-
#ifdef USE_X86_64_ASM
int32_t result;
@@ -757,10 +754,9 @@ int32_t ConvexHullInternal::Rational64::compare(const Rational64 &b) const {
: "=&b"(result), [tmp] "=&r"(tmp), "=a"(dummy)
: "a"(denominator), [bn] "g"(b.numerator), [tn] "g"(numerator), [bd] "g"(b.denominator)
: "%rdx", "cc");
- return result ? result ^ sign // if sign is +1, only bit 0 of result is inverted, which does not change the sign of result (and cannot result in zero)
- // if sign is -1, all bits of result are inverted, which changes the sign of result (and again cannot result in zero)
- :
- 0;
+ // if sign is +1, only bit 0 of result is inverted, which does not change the sign of result (and cannot result in zero)
+ // if sign is -1, all bits of result are inverted, which changes the sign of result (and again cannot result in zero)
+ return result ? result ^ sign : 0;
#else
@@ -793,8 +789,7 @@ int32_t ConvexHullInternal::Rational128::compare(const Rational128 &b) const {
int32_t ConvexHullInternal::Rational128::compare(int64_t b) const {
if (is_int_64) {
int64_t a = sign * (int64_t)numerator.low;
- return (a > b) ? 1 : (a < b) ? -1 :
- 0;
+ return (a > b) ? 1 : ((a < b) ? -1 : 0);
}
if (b > 0) {
if (sign <= 0) {
@@ -1446,8 +1441,7 @@ void ConvexHullInternal::merge(IntermediateHull &p_h0, IntermediateHull &p_h1) {
c1->edges = e;
return;
} else {
- int32_t cmp = !min0 ? 1 : !min1 ? -1 :
- min_cot0.compare(min_cot1);
+ int32_t cmp = !min0 ? 1 : (!min1 ? -1 : min_cot0.compare(min_cot1));
#ifdef DEBUG_CONVEX_HULL
printf(" -> Result %d\n", cmp);
#endif
diff --git a/core/math/face3.h b/core/math/face3.h
index 9e9026e54e..0a8c1c6041 100644
--- a/core/math/face3.h
+++ b/core/math/face3.h
@@ -48,13 +48,13 @@ public:
Vector3 vertex[3];
/**
- *
- * @param p_plane plane used to split the face
- * @param p_res array of at least 3 faces, amount used in function return
- * @param p_is_point_over array of at least 3 booleans, determining which face is over the plane, amount used in function return
- * @param _epsilon constant used for numerical error rounding, to add "thickness" to the plane (so coplanar points can happen)
- * @return amount of faces generated by the split, either 0 (means no split possible), 2 or 3
- */
+ *
+ * @param p_plane plane used to split the face
+ * @param p_res array of at least 3 faces, amount used in function return
+ * @param p_is_point_over array of at least 3 booleans, determining which face is over the plane, amount used in function return
+ * @param _epsilon constant used for numerical error rounding, to add "thickness" to the plane (so coplanar points can happen)
+ * @return amount of faces generated by the split, either 0 (means no split possible), 2 or 3
+ */
int split_by_plane(const Plane &p_plane, Face3 *p_res, bool *p_is_point_over) const;
diff --git a/core/math/math_defs.h b/core/math/math_defs.h
index c3a8f910c0..900e90a598 100644
--- a/core/math/math_defs.h
+++ b/core/math/math_defs.h
@@ -116,10 +116,10 @@ enum Corner {
};
/**
- * The "Real" type is an abstract type used for real numbers, such as 1.5,
- * in contrast to integer numbers. Precision can be controlled with the
- * presence or absence of the REAL_T_IS_DOUBLE define.
- */
+ * The "Real" type is an abstract type used for real numbers, such as 1.5,
+ * in contrast to integer numbers. Precision can be controlled with the
+ * presence or absence of the REAL_T_IS_DOUBLE define.
+ */
#ifdef REAL_T_IS_DOUBLE
typedef double real_t;
#else
diff --git a/core/math/math_funcs.h b/core/math/math_funcs.h
index 4e4f566517..baff10af98 100644
--- a/core/math/math_funcs.h
+++ b/core/math/math_funcs.h
@@ -159,7 +159,7 @@ public:
} ieee754;
ieee754.f = p_val;
return ((unsigned)(ieee754.u >> 32) & 0x7fffffff) == 0x7ff00000 &&
- ((unsigned)ieee754.u == 0);
+ ((unsigned)ieee754.u == 0);
#else
return isinf(p_val);
#endif
@@ -461,7 +461,7 @@ public:
mantissa = 0;
}
hf = (((uint16_t)sign) << 15) | (uint16_t)((0x1F << 10)) |
- (uint16_t)(mantissa >> 13);
+ (uint16_t)(mantissa >> 13);
}
// check if exponent is <= -15
else if (exp <= 0x38000000) {
@@ -474,8 +474,8 @@ public:
hf = 0; //denormals do not work for 3D, convert to zero
} else {
hf = (((uint16_t)sign) << 15) |
- (uint16_t)((exp - 0x38000000) >> 13) |
- (uint16_t)(mantissa >> 13);
+ (uint16_t)((exp - 0x38000000) >> 13) |
+ (uint16_t)(mantissa >> 13);
}
return hf;
diff --git a/core/math/plane.cpp b/core/math/plane.cpp
index 3c78b55b90..59f7918258 100644
--- a/core/math/plane.cpp
+++ b/core/math/plane.cpp
@@ -88,7 +88,7 @@ bool Plane::intersect_3(const Plane &p_plane1, const Plane &p_plane2, Vector3 *r
*r_result = ((vec3_cross(normal1, normal2) * p_plane0.d) +
(vec3_cross(normal2, normal0) * p_plane1.d) +
(vec3_cross(normal0, normal1) * p_plane2.d)) /
- denom;
+ denom;
}
return true;
diff --git a/core/math/rect2.h b/core/math/rect2.h
index 2557959fa2..26e202589d 100644
--- a/core/math/rect2.h
+++ b/core/math/rect2.h
@@ -118,8 +118,8 @@ struct Rect2 {
inline bool encloses(const Rect2 &p_rect) const {
return (p_rect.position.x >= position.x) && (p_rect.position.y >= position.y) &&
- ((p_rect.position.x + p_rect.size.x) <= (position.x + size.x)) &&
- ((p_rect.position.y + p_rect.size.y) <= (position.y + size.y));
+ ((p_rect.position.x + p_rect.size.x) <= (position.x + size.x)) &&
+ ((p_rect.position.y + p_rect.size.y) <= (position.y + size.y));
}
_FORCE_INLINE_ bool has_no_area() const {
@@ -257,7 +257,7 @@ struct Rect2 {
return Vector2(
(p_normal.x > 0) ? -half_extents.x : half_extents.x,
(p_normal.y > 0) ? -half_extents.y : half_extents.y) +
- ofs;
+ ofs;
}
_FORCE_INLINE_ bool intersects_filled_polygon(const Vector2 *p_points, int p_point_count) const {
@@ -367,8 +367,8 @@ struct Rect2i {
inline bool encloses(const Rect2i &p_rect) const {
return (p_rect.position.x >= position.x) && (p_rect.position.y >= position.y) &&
- ((p_rect.position.x + p_rect.size.x) < (position.x + size.x)) &&
- ((p_rect.position.y + p_rect.size.y) < (position.y + size.y));
+ ((p_rect.position.x + p_rect.size.x) < (position.x + size.x)) &&
+ ((p_rect.position.y + p_rect.size.y) < (position.y + size.y));
}
_FORCE_INLINE_ bool has_no_area() const {
diff --git a/core/math/transform_2d.cpp b/core/math/transform_2d.cpp
index 496a557844..df43c605f9 100644
--- a/core/math/transform_2d.cpp
+++ b/core/math/transform_2d.cpp
@@ -298,6 +298,6 @@ Transform2D Transform2D::operator*(const real_t p_val) const {
Transform2D::operator String() const {
return "[X: " + elements[0].operator String() +
- ", Y: " + elements[1].operator String() +
- ", O: " + elements[2].operator String() + "]";
+ ", Y: " + elements[1].operator String() +
+ ", O: " + elements[2].operator String() + "]";
}
diff --git a/core/math/transform_2d.h b/core/math/transform_2d.h
index 6ed3af2ba7..8a0e876d96 100644
--- a/core/math/transform_2d.h
+++ b/core/math/transform_2d.h
@@ -164,7 +164,7 @@ Vector2 Transform2D::xform(const Vector2 &p_vec) const {
return Vector2(
tdotx(p_vec),
tdoty(p_vec)) +
- elements[2];
+ elements[2];
}
Vector2 Transform2D::xform_inv(const Vector2 &p_vec) const {
diff --git a/core/math/transform_3d.cpp b/core/math/transform_3d.cpp
index 4f4943c8ef..78ef117443 100644
--- a/core/math/transform_3d.cpp
+++ b/core/math/transform_3d.cpp
@@ -175,9 +175,9 @@ Transform3D Transform3D::operator*(const real_t p_val) const {
Transform3D::operator String() const {
return "[X: " + basis.get_axis(0).operator String() +
- ", Y: " + basis.get_axis(1).operator String() +
- ", Z: " + basis.get_axis(2).operator String() +
- ", O: " + origin.operator String() + "]";
+ ", Y: " + basis.get_axis(1).operator String() +
+ ", Z: " + basis.get_axis(2).operator String() +
+ ", O: " + origin.operator String() + "]";
}
Transform3D::Transform3D(const Basis &p_basis, const Vector3 &p_origin) :
diff --git a/core/math/triangulate.cpp b/core/math/triangulate.cpp
index fa1588dbc5..28f1d96b14 100644
--- a/core/math/triangulate.cpp
+++ b/core/math/triangulate.cpp
@@ -42,18 +42,13 @@ real_t Triangulate::get_area(const Vector<Vector2> &contour) {
return A * 0.5;
}
-/*
- is_inside_triangle decides if a point P is Inside of the triangle
- defined by A, B, C.
- */
-
+/* `is_inside_triangle` decides if a point P is inside the triangle
+ * defined by A, B, C. */
bool Triangulate::is_inside_triangle(real_t Ax, real_t Ay,
real_t Bx, real_t By,
real_t Cx, real_t Cy,
real_t Px, real_t Py,
- bool include_edges)
-
-{
+ bool include_edges) {
real_t ax, ay, bx, by, cx, cy, apx, apy, bpx, bpy, cpx, cpy;
real_t cCROSSap, bCROSScp, aCROSSbp;
diff --git a/core/math/vector2.cpp b/core/math/vector2.cpp
index 16e43d7d06..6259bdead0 100644
--- a/core/math/vector2.cpp
+++ b/core/math/vector2.cpp
@@ -160,10 +160,11 @@ Vector2 Vector2::cubic_interpolate(const Vector2 &p_b, const Vector2 &p_pre_a, c
real_t t3 = t2 * t;
Vector2 out;
- out = 0.5 * ((p1 * 2.0) +
- (-p0 + p2) * t +
- (2.0 * p0 - 5.0 * p1 + 4 * p2 - p3) * t2 +
- (-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
+ out = 0.5 *
+ ((p1 * 2.0) +
+ (-p0 + p2) * t +
+ (2.0 * p0 - 5.0 * p1 + 4 * p2 - p3) * t2 +
+ (-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
return out;
}
diff --git a/core/math/vector3.cpp b/core/math/vector3.cpp
index fa212c178a..42e3da0b27 100644
--- a/core/math/vector3.cpp
+++ b/core/math/vector3.cpp
@@ -93,10 +93,11 @@ Vector3 Vector3::cubic_interpolate(const Vector3 &p_b, const Vector3 &p_pre_a, c
real_t t3 = t2 * t;
Vector3 out;
- out = 0.5 * ((p1 * 2.0) +
- (-p0 + p2) * t +
- (2.0 * p0 - 5.0 * p1 + 4.0 * p2 - p3) * t2 +
- (-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
+ out = 0.5 *
+ ((p1 * 2.0) +
+ (-p0 + p2) * t +
+ (2.0 * p0 - 5.0 * p1 + 4.0 * p2 - p3) * t2 +
+ (-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
return out;
}
diff --git a/core/object/object.cpp b/core/object/object.cpp
index b5797a4633..e7d8b0e543 100644
--- a/core/object/object.cpp
+++ b/core/object/object.cpp
@@ -1398,7 +1398,7 @@ void Object::_disconnect(const StringName &p_signal, const Callable &p_callable,
SignalData *s = signal_map.getptr(p_signal);
if (!s) {
bool signal_is_valid = ClassDB::has_signal(get_class_name(), p_signal) ||
- (!script.is_null() && Ref<Script>(script)->has_script_signal(p_signal));
+ (!script.is_null() && Ref<Script>(script)->has_script_signal(p_signal));
ERR_FAIL_COND_MSG(signal_is_valid, "Attempt to disconnect a nonexistent connection from '" + to_string() + "'. Signal: '" + p_signal + "', callable: '" + p_callable + "'.");
}
ERR_FAIL_COND_MSG(!s, vformat("Disconnecting nonexistent signal '%s' in %s.", p_signal, to_string()));
diff --git a/core/string/translation.cpp b/core/string/translation.cpp
index cf61467d08..6ff31a4a02 100644
--- a/core/string/translation.cpp
+++ b/core/string/translation.cpp
@@ -1563,8 +1563,8 @@ const char32_t *TranslationServer::get_accented_version(char32_t p_character) co
bool TranslationServer::is_placeholder(String &p_message, int p_index) const {
return p_message[p_index] == '%' && p_index < p_message.size() - 1 &&
- (p_message[p_index + 1] == 's' || p_message[p_index + 1] == 'c' || p_message[p_index + 1] == 'd' ||
- p_message[p_index + 1] == 'o' || p_message[p_index + 1] == 'x' || p_message[p_index + 1] == 'X' || p_message[p_index + 1] == 'f');
+ (p_message[p_index + 1] == 's' || p_message[p_index + 1] == 'c' || p_message[p_index + 1] == 'd' ||
+ p_message[p_index + 1] == 'o' || p_message[p_index + 1] == 'x' || p_message[p_index + 1] == 'X' || p_message[p_index + 1] == 'f');
}
void TranslationServer::_bind_methods() {
diff --git a/core/string/ustring.cpp b/core/string/ustring.cpp
index 397743fb6e..8d6da31cf3 100644
--- a/core/string/ustring.cpp
+++ b/core/string/ustring.cpp
@@ -2317,28 +2317,33 @@ bool String::is_numeric() const {
}
template <class C>
-static double built_in_strtod(const C *string, /* A decimal ASCII floating-point number,
- * optionally preceded by white space. Must
- * have form "-I.FE-X", where I is the integer
- * part of the mantissa, F is the fractional
- * part of the mantissa, and X is the
- * exponent. Either of the signs may be "+",
- * "-", or omitted. Either I or F may be
- * omitted, or both. The decimal point isn't
- * necessary unless F is present. The "E" may
- * actually be an "e". E and X may both be
- * omitted (but not just one). */
- C **endPtr = nullptr) /* If non-nullptr, store terminating Cacter's
- * address here. */
-{
- static const int maxExponent = 511; /* Largest possible base 10 exponent. Any
- * exponent larger than this will already
- * produce underflow or overflow, so there's
- * no need to worry about additional digits.
- */
- static const double powersOf10[] = { /* Table giving binary powers of 10. Entry */
- 10., /* is 10^2^i. Used to convert decimal */
- 100., /* exponents into floating-point numbers. */
+static double built_in_strtod(
+ /* A decimal ASCII floating-point number,
+ * optionally preceded by white space. Must
+ * have form "-I.FE-X", where I is the integer
+ * part of the mantissa, F is the fractional
+ * part of the mantissa, and X is the
+ * exponent. Either of the signs may be "+",
+ * "-", or omitted. Either I or F may be
+ * omitted, or both. The decimal point isn't
+ * necessary unless F is present. The "E" may
+ * actually be an "e". E and X may both be
+ * omitted (but not just one). */
+ const C *string,
+ /* If non-nullptr, store terminating Cacter's
+ * address here. */
+ C **endPtr = nullptr) {
+ /* Largest possible base 10 exponent. Any
+ * exponent larger than this will already
+ * produce underflow or overflow, so there's
+ * no need to worry about additional digits. */
+ static const int maxExponent = 511;
+ /* Table giving binary powers of 10. Entry
+ * is 10^2^i. Used to convert decimal
+ * exponents into floating-point numbers. */
+ static const double powersOf10[] = {
+ 10.,
+ 100.,
1.0e4,
1.0e8,
1.0e16,
@@ -2353,25 +2358,28 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
const double *d;
const C *p;
int c;
- int exp = 0; /* Exponent read from "EX" field. */
- int fracExp = 0; /* Exponent that derives from the fractional
- * part. Under normal circumstances, it is
- * the negative of the number of digits in F.
- * However, if I is very long, the last digits
- * of I get dropped (otherwise a long I with a
- * large negative exponent could cause an
- * unnecessary overflow on I alone). In this
- * case, fracExp is incremented one for each
- * dropped digit. */
- int mantSize; /* Number of digits in mantissa. */
- int decPt; /* Number of mantissa digits BEFORE decimal
- * point. */
- const C *pExp; /* Temporarily holds location of exponent in
- * string. */
+ /* Exponent read from "EX" field. */
+ int exp = 0;
+ /* Exponent that derives from the fractional
+ * part. Under normal circumstances, it is
+ * the negative of the number of digits in F.
+ * However, if I is very long, the last digits
+ * of I get dropped (otherwise a long I with a
+ * large negative exponent could cause an
+ * unnecessary overflow on I alone). In this
+ * case, fracExp is incremented one for each
+ * dropped digit. */
+ int fracExp = 0;
+ /* Number of digits in mantissa. */
+ int mantSize;
+ /* Number of mantissa digits BEFORE decimal point. */
+ int decPt;
+ /* Temporarily holds location of exponent in string. */
+ const C *pExp;
/*
- * Strip off leading blanks and check for a sign.
- */
+ * Strip off leading blanks and check for a sign.
+ */
p = string;
while (*p == ' ' || *p == '\t' || *p == '\n') {
@@ -2388,9 +2396,9 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
}
/*
- * Count the number of digits in the mantissa (including the decimal
- * point), and also locate the decimal point.
- */
+ * Count the number of digits in the mantissa (including the decimal
+ * point), and also locate the decimal point.
+ */
decPt = -1;
for (mantSize = 0;; mantSize += 1) {
@@ -2405,11 +2413,11 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
}
/*
- * Now suck up the digits in the mantissa. Use two integers to collect 9
- * digits each (this is faster than using floating-point). If the mantissa
- * has more than 18 digits, ignore the extras, since they can't affect the
- * value anyway.
- */
+ * Now suck up the digits in the mantissa. Use two integers to collect 9
+ * digits each (this is faster than using floating-point). If the mantissa
+ * has more than 18 digits, ignore the extras, since they can't affect the
+ * value anyway.
+ */
pExp = p;
p -= mantSize;
@@ -2455,8 +2463,8 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
}
/*
- * Skim off the exponent.
- */
+ * Skim off the exponent.
+ */
p = pExp;
if ((*p == 'E') || (*p == 'e')) {
@@ -2486,10 +2494,10 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
}
/*
- * Generate a floating-point number that represents the exponent. Do this
- * by processing the exponent one bit at a time to combine many powers of
- * 2 of 10. Then combine the exponent with the fraction.
- */
+ * Generate a floating-point number that represents the exponent. Do this
+ * by processing the exponent one bit at a time to combine many powers of
+ * 2 of 10. Then combine the exponent with the fraction.
+ */
if (exp < 0) {
expSign = true;
diff --git a/core/templates/hash_map.h b/core/templates/hash_map.h
index 1634219c23..45e0cc2427 100644
--- a/core/templates/hash_map.h
+++ b/core/templates/hash_map.h
@@ -53,7 +53,7 @@
* @param RELATIONSHIP Relationship at which the hash table is resized. if amount of elements is RELATIONSHIP
* times bigger than the hash table, table is resized to solve this condition. if RELATIONSHIP is zero, table is always MIN_HASH_TABLE_POWER.
*
-*/
+ */
template <class TKey, class TData, class Hasher = HashMapHasherDefault, class Comparator = HashMapComparatorDefault<TKey>, uint8_t MIN_HASH_TABLE_POWER = 3, uint8_t RELATIONSHIP = 8>
class HashMap {
@@ -458,8 +458,8 @@ public:
*
* print( *k );
* }
- *
- */
+ *
+ */
const TKey *next(const TKey *p_key) const {
if (unlikely(!hash_table)) {
return nullptr;
diff --git a/core/templates/list.h b/core/templates/list.h
index c2e17a2f6f..afbed998c2 100644
--- a/core/templates/list.h
+++ b/core/templates/list.h
@@ -249,29 +249,29 @@ private:
public:
/**
- * return a const iterator to the beginning of the list.
- */
+ * return a const iterator to the beginning of the list.
+ */
_FORCE_INLINE_ const Element *front() const {
return _data ? _data->first : nullptr;
}
/**
- * return an iterator to the beginning of the list.
- */
+ * return an iterator to the beginning of the list.
+ */
_FORCE_INLINE_ Element *front() {
return _data ? _data->first : nullptr;
}
/**
- * return a const iterator to the last member of the list.
- */
+ * return a const iterator to the last member of the list.
+ */
_FORCE_INLINE_ const Element *back() const {
return _data ? _data->last : nullptr;
}
/**
- * return an iterator to the last member of the list.
- */
+ * return an iterator to the last member of the list.
+ */
_FORCE_INLINE_ Element *back() {
return _data ? _data->last : nullptr;
}
diff --git a/core/templates/vector.h b/core/templates/vector.h
index 4b008a45a4..98982c80d3 100644
--- a/core/templates/vector.h
+++ b/core/templates/vector.h
@@ -35,7 +35,7 @@
* @class Vector
* @author Juan Linietsky
* Vector container. Regular Vector Container. Use with care and for smaller arrays when possible. Use Vector for large arrays.
-*/
+ */
#include "core/error/error_macros.h"
#include "core/os/memory.h"
diff --git a/core/variant/type_info.h b/core/variant/type_info.h
index b70d29bbac..2c6b82d25f 100644
--- a/core/variant/type_info.h
+++ b/core/variant/type_info.h
@@ -60,7 +60,7 @@ struct TypeInherits {
static char (&test(...))[2];
static bool const value = sizeof(test(get_d())) == sizeof(char) &&
- !TypesAreSame<B volatile const, void volatile const>::value;
+ !TypesAreSame<B volatile const, void volatile const>::value;
};
namespace GodotTypeInfo {
diff --git a/core/variant/variant.cpp b/core/variant/variant.cpp
index 81428caca1..1d70d4c506 100644
--- a/core/variant/variant.cpp
+++ b/core/variant/variant.cpp
@@ -3118,7 +3118,7 @@ bool Variant::hash_compare(const Variant &p_variant) const {
const Rect2 *r = reinterpret_cast<const Rect2 *>(p_variant._data._mem);
return (hash_compare_vector2(l->position, r->position)) &&
- (hash_compare_vector2(l->size, r->size));
+ (hash_compare_vector2(l->size, r->size));
} break;
case RECT2I: {
const Rect2i *l = reinterpret_cast<const Rect2i *>(_data._mem);
@@ -3158,7 +3158,7 @@ bool Variant::hash_compare(const Variant &p_variant) const {
const Plane *r = reinterpret_cast<const Plane *>(p_variant._data._mem);
return (hash_compare_vector3(l->normal, r->normal)) &&
- (hash_compare_scalar(l->d, r->d));
+ (hash_compare_scalar(l->d, r->d));
} break;
case AABB: {
diff --git a/drivers/vulkan/rendering_device_vulkan.cpp b/drivers/vulkan/rendering_device_vulkan.cpp
index e7ac447426..0d9dc7c5d1 100644
--- a/drivers/vulkan/rendering_device_vulkan.cpp
+++ b/drivers/vulkan/rendering_device_vulkan.cpp
@@ -3273,10 +3273,10 @@ bool RenderingDeviceVulkan::texture_is_format_supported_for_usage(DataFormat p_f
VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentFormat> &p_attachments, const Vector<FramebufferPass> &p_passes, InitialAction p_initial_action, FinalAction p_final_action, InitialAction p_initial_depth_action, FinalAction p_final_depth_action, uint32_t p_view_count, Vector<TextureSamples> *r_samples) {
// Set up dependencies from/to external equivalent to the default (implicit) one, and then amend them
const VkPipelineStageFlags default_access_mask = VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
- VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
- VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
- VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
- VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT; // From Section 7.1 of Vulkan API Spec v1.1.148
+ VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
+ VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
+ VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
+ VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT; // From Section 7.1 of Vulkan API Spec v1.1.148
VkPipelineStageFlags reading_stages = VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_TRANSFER_BIT;
VkSubpassDependency dependencies[2] = { { VK_SUBPASS_EXTERNAL, 0, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_ALL_GRAPHICS_BIT, 0, default_access_mask, 0 },
@@ -8980,35 +8980,35 @@ void RenderingDeviceVulkan::capture_timestamp(const String &p_name) {
memoryBarrier.sType = VK_STRUCTURE_TYPE_MEMORY_BARRIER;
memoryBarrier.pNext = nullptr;
memoryBarrier.srcAccessMask = VK_ACCESS_INDIRECT_COMMAND_READ_BIT |
- VK_ACCESS_INDEX_READ_BIT |
- VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
- VK_ACCESS_UNIFORM_READ_BIT |
- VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
- VK_ACCESS_SHADER_READ_BIT |
- VK_ACCESS_SHADER_WRITE_BIT |
- VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
- VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
- VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
- VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
- VK_ACCESS_TRANSFER_READ_BIT |
- VK_ACCESS_TRANSFER_WRITE_BIT |
- VK_ACCESS_HOST_READ_BIT |
- VK_ACCESS_HOST_WRITE_BIT;
+ VK_ACCESS_INDEX_READ_BIT |
+ VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
+ VK_ACCESS_UNIFORM_READ_BIT |
+ VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
+ VK_ACCESS_SHADER_READ_BIT |
+ VK_ACCESS_SHADER_WRITE_BIT |
+ VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
+ VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
+ VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
+ VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
+ VK_ACCESS_TRANSFER_READ_BIT |
+ VK_ACCESS_TRANSFER_WRITE_BIT |
+ VK_ACCESS_HOST_READ_BIT |
+ VK_ACCESS_HOST_WRITE_BIT;
memoryBarrier.dstAccessMask = VK_ACCESS_INDIRECT_COMMAND_READ_BIT |
- VK_ACCESS_INDEX_READ_BIT |
- VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
- VK_ACCESS_UNIFORM_READ_BIT |
- VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
- VK_ACCESS_SHADER_READ_BIT |
- VK_ACCESS_SHADER_WRITE_BIT |
- VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
- VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
- VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
- VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
- VK_ACCESS_TRANSFER_READ_BIT |
- VK_ACCESS_TRANSFER_WRITE_BIT |
- VK_ACCESS_HOST_READ_BIT |
- VK_ACCESS_HOST_WRITE_BIT;
+ VK_ACCESS_INDEX_READ_BIT |
+ VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
+ VK_ACCESS_UNIFORM_READ_BIT |
+ VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
+ VK_ACCESS_SHADER_READ_BIT |
+ VK_ACCESS_SHADER_WRITE_BIT |
+ VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
+ VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
+ VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
+ VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
+ VK_ACCESS_TRANSFER_READ_BIT |
+ VK_ACCESS_TRANSFER_WRITE_BIT |
+ VK_ACCESS_HOST_READ_BIT |
+ VK_ACCESS_HOST_WRITE_BIT;
vkCmdPipelineBarrier(frames[frame].draw_command_buffer, VK_PIPELINE_STAGE_ALL_COMMANDS_BIT, VK_PIPELINE_STAGE_ALL_COMMANDS_BIT, 0, 1, &memoryBarrier, 0, nullptr, 0, nullptr);
}
diff --git a/drivers/vulkan/vulkan_context.cpp b/drivers/vulkan/vulkan_context.cpp
index 44fed02f41..c178a68236 100644
--- a/drivers/vulkan/vulkan_context.cpp
+++ b/drivers/vulkan/vulkan_context.cpp
@@ -137,10 +137,10 @@ VKAPI_ATTR VkBool32 VKAPI_CALL VulkanContext::_debug_messenger_callback(
}
String error_message(type_string +
- " - Message Id Number: " + String::num_int64(pCallbackData->messageIdNumber) +
- " | Message Id Name: " + pCallbackData->pMessageIdName +
- "\n\t" + pCallbackData->pMessage +
- objects_string + labels_string);
+ " - Message Id Number: " + String::num_int64(pCallbackData->messageIdNumber) +
+ " | Message Id Name: " + pCallbackData->pMessageIdName +
+ "\n\t" + pCallbackData->pMessage +
+ objects_string + labels_string);
// Convert VK severity to our own log macros.
switch (messageSeverity) {
@@ -175,7 +175,7 @@ VKAPI_ATTR VkBool32 VKAPI_CALL VulkanContext::_debug_report_callback(
const char *pMessage,
void *pUserData) {
String debugMessage = String("Vulkan Debug Report: object - ") +
- String::num_int64(object) + "\n" + pMessage;
+ String::num_int64(object) + "\n" + pMessage;
switch (flags) {
case VK_DEBUG_REPORT_DEBUG_BIT_EXT:
@@ -631,10 +631,10 @@ Error VulkanContext::_create_physical_device() {
}
/*
- * This is info for a temp callback to use during CreateInstance.
- * After the instance is created, we use the instance-based
- * function to register the final callback.
- */
+ * This is info for a temp callback to use during CreateInstance.
+ * After the instance is created, we use the instance-based
+ * function to register the final callback.
+ */
VkDebugUtilsMessengerCreateInfoEXT dbg_messenger_create_info;
VkDebugReportCallbackCreateInfoEXT dbg_report_callback_create_info{};
if (enabled_debug_utils) {
@@ -645,18 +645,18 @@ Error VulkanContext::_create_physical_device() {
dbg_messenger_create_info.messageSeverity =
VK_DEBUG_UTILS_MESSAGE_SEVERITY_WARNING_BIT_EXT | VK_DEBUG_UTILS_MESSAGE_SEVERITY_ERROR_BIT_EXT;
dbg_messenger_create_info.messageType = VK_DEBUG_UTILS_MESSAGE_TYPE_GENERAL_BIT_EXT |
- VK_DEBUG_UTILS_MESSAGE_TYPE_VALIDATION_BIT_EXT |
- VK_DEBUG_UTILS_MESSAGE_TYPE_PERFORMANCE_BIT_EXT;
+ VK_DEBUG_UTILS_MESSAGE_TYPE_VALIDATION_BIT_EXT |
+ VK_DEBUG_UTILS_MESSAGE_TYPE_PERFORMANCE_BIT_EXT;
dbg_messenger_create_info.pfnUserCallback = _debug_messenger_callback;
dbg_messenger_create_info.pUserData = this;
inst_info.pNext = &dbg_messenger_create_info;
} else if (enabled_debug_report) {
dbg_report_callback_create_info.sType = VK_STRUCTURE_TYPE_DEBUG_REPORT_CALLBACK_CREATE_INFO_EXT;
dbg_report_callback_create_info.flags = VK_DEBUG_REPORT_INFORMATION_BIT_EXT |
- VK_DEBUG_REPORT_WARNING_BIT_EXT |
- VK_DEBUG_REPORT_PERFORMANCE_WARNING_BIT_EXT |
- VK_DEBUG_REPORT_ERROR_BIT_EXT |
- VK_DEBUG_REPORT_DEBUG_BIT_EXT;
+ VK_DEBUG_REPORT_WARNING_BIT_EXT |
+ VK_DEBUG_REPORT_PERFORMANCE_WARNING_BIT_EXT |
+ VK_DEBUG_REPORT_ERROR_BIT_EXT |
+ VK_DEBUG_REPORT_DEBUG_BIT_EXT;
dbg_report_callback_create_info.pfnCallback = _debug_report_callback;
dbg_report_callback_create_info.pUserData = this;
inst_info.pNext = &dbg_report_callback_create_info;
diff --git a/editor/action_map_editor.cpp b/editor/action_map_editor.cpp
index fc7e7389d5..519dd654ef 100644
--- a/editor/action_map_editor.cpp
+++ b/editor/action_map_editor.cpp
@@ -238,10 +238,16 @@ void InputEventConfigurationDialog::_listen_window_input(const Ref<InputEvent> &
Ref<InputEventJoypadButton> joyb = p_event;
Ref<InputEventJoypadMotion> joym = p_event;
- int type = k.is_valid() ? INPUT_KEY : joyb.is_valid() ? INPUT_JOY_BUTTON :
- joym.is_valid() ? INPUT_JOY_MOTION :
- mb.is_valid() ? INPUT_MOUSE_BUTTON :
- 0;
+ int type = 0;
+ if (k.is_valid()) {
+ type = INPUT_KEY;
+ } else if (joyb.is_valid()) {
+ type = INPUT_JOY_BUTTON;
+ } else if (joym.is_valid()) {
+ type = INPUT_JOY_MOTION;
+ } else if (mb.is_valid()) {
+ type = INPUT_MOUSE_BUTTON;
+ }
if (!(allowed_input_types & type)) {
return;
diff --git a/editor/editor_about.cpp b/editor/editor_about.cpp
index c895e2c158..414264e697 100644
--- a/editor/editor_about.cpp
+++ b/editor/editor_about.cpp
@@ -155,7 +155,7 @@ EditorAbout::EditorAbout() {
Label *about_text = memnew(Label);
about_text->set_v_size_flags(Control::SIZE_SHRINK_CENTER);
about_text->set_text(String::utf8("\xc2\xa9 2007-2021 Juan Linietsky, Ariel Manzur.\n\xc2\xa9 2014-2021 ") +
- TTR("Godot Engine contributors") + "\n");
+ TTR("Godot Engine contributors") + "\n");
version_info_vbc->add_child(about_text);
hbc->add_child(version_info_vbc);
diff --git a/editor/editor_node.cpp b/editor/editor_node.cpp
index 1904ac58b0..372cf14dc1 100644
--- a/editor/editor_node.cpp
+++ b/editor/editor_node.cpp
@@ -4964,9 +4964,9 @@ void EditorNode::_scene_tab_closed(int p_tab, int option) {
return;
}
- bool unsaved = (p_tab == editor_data.get_edited_scene()) ?
- saved_version != editor_data.get_undo_redo().get_version() :
- editor_data.get_scene_version(p_tab) != 0;
+ bool unsaved = (p_tab == editor_data.get_edited_scene())
+ ? saved_version != editor_data.get_undo_redo().get_version()
+ : editor_data.get_scene_version(p_tab) != 0;
if (unsaved) {
save_confirmation->get_ok_button()->set_text(TTR("Save & Close"));
save_confirmation->set_text(vformat(TTR("Save changes to '%s' before closing?"), scene->get_scene_file_path() != "" ? scene->get_scene_file_path() : "unsaved scene"));
diff --git a/editor/editor_properties.cpp b/editor/editor_properties.cpp
index 6a36304ba4..e679222567 100644
--- a/editor/editor_properties.cpp
+++ b/editor/editor_properties.cpp
@@ -3237,11 +3237,11 @@ EditorProperty *EditorInspectorDefaultPlugin::get_editor_for_property(Object *p_
return editor;
} else if (p_hint == PROPERTY_HINT_LAYERS_2D_PHYSICS ||
- p_hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
- p_hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
- p_hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
- p_hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
- p_hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
+ p_hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
+ p_hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
+ p_hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
+ p_hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
+ p_hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
EditorPropertyLayers::LayerType lt = EditorPropertyLayers::LAYER_RENDER_2D;
switch (p_hint) {
case PROPERTY_HINT_LAYERS_2D_RENDER:
@@ -3336,13 +3336,13 @@ EditorProperty *EditorInspectorDefaultPlugin::get_editor_for_property(Object *p_
}
return editor;
} else if (p_hint == PROPERTY_HINT_METHOD_OF_VARIANT_TYPE ||
- p_hint == PROPERTY_HINT_METHOD_OF_BASE_TYPE ||
- p_hint == PROPERTY_HINT_METHOD_OF_INSTANCE ||
- p_hint == PROPERTY_HINT_METHOD_OF_SCRIPT ||
- p_hint == PROPERTY_HINT_PROPERTY_OF_VARIANT_TYPE ||
- p_hint == PROPERTY_HINT_PROPERTY_OF_BASE_TYPE ||
- p_hint == PROPERTY_HINT_PROPERTY_OF_INSTANCE ||
- p_hint == PROPERTY_HINT_PROPERTY_OF_SCRIPT) {
+ p_hint == PROPERTY_HINT_METHOD_OF_BASE_TYPE ||
+ p_hint == PROPERTY_HINT_METHOD_OF_INSTANCE ||
+ p_hint == PROPERTY_HINT_METHOD_OF_SCRIPT ||
+ p_hint == PROPERTY_HINT_PROPERTY_OF_VARIANT_TYPE ||
+ p_hint == PROPERTY_HINT_PROPERTY_OF_BASE_TYPE ||
+ p_hint == PROPERTY_HINT_PROPERTY_OF_INSTANCE ||
+ p_hint == PROPERTY_HINT_PROPERTY_OF_SCRIPT) {
EditorPropertyMember *editor = memnew(EditorPropertyMember);
EditorPropertyMember::Type type = EditorPropertyMember::MEMBER_METHOD_OF_BASE_TYPE;
diff --git a/editor/filesystem_dock.cpp b/editor/filesystem_dock.cpp
index cdf0f6e391..f2a3aa3b44 100644
--- a/editor/filesystem_dock.cpp
+++ b/editor/filesystem_dock.cpp
@@ -1371,7 +1371,7 @@ void FileSystemDock::_make_dir_confirm() {
EditorNode::get_singleton()->show_warning(TTR("No name provided."));
return;
} else if (dir_name.find("/") != -1 || dir_name.find("\\") != -1 || dir_name.find(":") != -1 || dir_name.find("*") != -1 ||
- dir_name.find("|") != -1 || dir_name.find(">") != -1 || dir_name.ends_with(".") || dir_name.ends_with(" ")) {
+ dir_name.find("|") != -1 || dir_name.find(">") != -1 || dir_name.ends_with(".") || dir_name.ends_with(" ")) {
EditorNode::get_singleton()->show_warning(TTR("Provided name contains invalid characters."));
return;
}
diff --git a/editor/import/collada.cpp b/editor/import/collada.cpp
index 4cd9066350..19b4943e6d 100644
--- a/editor/import/collada.cpp
+++ b/editor/import/collada.cpp
@@ -541,7 +541,10 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
COLLADA_PRINT("node name: " + parser.get_node_name());
- if (!parser.is_empty() && (parser.get_node_name() == "profile_COMMON" || parser.get_node_name() == "technique" || parser.get_node_name() == "extra")) {
+ if (!parser.is_empty() &&
+ (parser.get_node_name() == "profile_COMMON" ||
+ parser.get_node_name() == "technique" ||
+ parser.get_node_name() == "extra")) {
_parse_effect_material(parser, effect, id); // try again
} else if (parser.get_node_name() == "newparam") {
@@ -551,9 +554,9 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
COLLADA_PRINT("param: " + name + " value:" + String(value));
} else if (parser.get_node_name() == "constant" ||
- parser.get_node_name() == "lambert" ||
- parser.get_node_name() == "phong" ||
- parser.get_node_name() == "blinn") {
+ parser.get_node_name() == "lambert" ||
+ parser.get_node_name() == "phong" ||
+ parser.get_node_name() == "blinn") {
COLLADA_PRINT("shade model: " + parser.get_node_name());
while (parser.read() == OK) {
if (parser.get_node_type() == XMLParser::NODE_ELEMENT) {
@@ -627,10 +630,11 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
} else if (what == "shininess") {
effect.shininess = _parse_param(parser);
}
- } else if (parser.get_node_type() == XMLParser::NODE_ELEMENT_END && (parser.get_node_name() == "constant" ||
- parser.get_node_name() == "lambert" ||
- parser.get_node_name() == "phong" ||
- parser.get_node_name() == "blinn")) {
+ } else if (parser.get_node_type() == XMLParser::NODE_ELEMENT_END &&
+ (parser.get_node_name() == "constant" ||
+ parser.get_node_name() == "lambert" ||
+ parser.get_node_name() == "phong" ||
+ parser.get_node_name() == "blinn")) {
break;
}
}
@@ -681,10 +685,10 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
parser.skip_section();
}
} else if (parser.get_node_type() == XMLParser::NODE_ELEMENT_END &&
- (parser.get_node_name() == "effect" ||
- parser.get_node_name() == "profile_COMMON" ||
- parser.get_node_name() == "technique" ||
- parser.get_node_name() == "extra")) {
+ (parser.get_node_name() == "effect" ||
+ parser.get_node_name() == "profile_COMMON" ||
+ parser.get_node_name() == "technique" ||
+ parser.get_node_name() == "extra")) {
break;
}
}
diff --git a/editor/import/editor_import_collada.cpp b/editor/import/editor_import_collada.cpp
index ac8adedf2f..f9aa550e7d 100644
--- a/editor/import/editor_import_collada.cpp
+++ b/editor/import/editor_import_collada.cpp
@@ -1650,8 +1650,7 @@ void ColladaImport::create_animation(int p_clip, bool p_import_value_tracks) {
Vector3 s = xform.basis.get_scale();
bool singular_matrix = Math::is_zero_approx(s.x) || Math::is_zero_approx(s.y) || Math::is_zero_approx(s.z);
- Quaternion q = singular_matrix ? Quaternion() :
- xform.basis.get_rotation_quaternion();
+ Quaternion q = singular_matrix ? Quaternion() : xform.basis.get_rotation_quaternion();
Vector3 l = xform.origin;
if (position_idx >= 0) {
diff --git a/editor/import/resource_importer_scene.cpp b/editor/import/resource_importer_scene.cpp
index 9cb69357bd..7d3b945b04 100644
--- a/editor/import/resource_importer_scene.cpp
+++ b/editor/import/resource_importer_scene.cpp
@@ -1300,27 +1300,28 @@ bool ResourceImporterScene::get_internal_option_visibility(InternalImportCategor
if (p_option == "primitive/position" || p_option == "primitive/rotation") {
const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
return generate_physics &&
- physics_shape >= SHAPE_TYPE_BOX;
+ physics_shape >= SHAPE_TYPE_BOX;
}
if (p_option == "primitive/size") {
const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
return generate_physics &&
- physics_shape == SHAPE_TYPE_BOX;
+ physics_shape == SHAPE_TYPE_BOX;
}
if (p_option == "primitive/radius") {
const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
- return generate_physics && (physics_shape == SHAPE_TYPE_SPHERE ||
- physics_shape == SHAPE_TYPE_CYLINDER ||
- physics_shape == SHAPE_TYPE_CAPSULE);
+ return generate_physics &&
+ (physics_shape == SHAPE_TYPE_SPHERE ||
+ physics_shape == SHAPE_TYPE_CYLINDER ||
+ physics_shape == SHAPE_TYPE_CAPSULE);
}
if (p_option == "primitive/height") {
const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
return generate_physics &&
- (physics_shape == SHAPE_TYPE_CYLINDER ||
- physics_shape == SHAPE_TYPE_CAPSULE);
+ (physics_shape == SHAPE_TYPE_CYLINDER ||
+ physics_shape == SHAPE_TYPE_CAPSULE);
}
} break;
case INTERNAL_IMPORT_CATEGORY_MESH: {
diff --git a/editor/import/resource_importer_wav.cpp b/editor/import/resource_importer_wav.cpp
index 2db1db9e51..89383d3dde 100644
--- a/editor/import/resource_importer_wav.cpp
+++ b/editor/import/resource_importer_wav.cpp
@@ -252,13 +252,13 @@ Error ResourceImporterWAV::import(const String &p_source_file, const String &p_s
//loop point info!
/**
- * Consider exploring next document:
- * http://www-mmsp.ece.mcgill.ca/Documents/AudioFormats/WAVE/Docs/RIFFNEW.pdf
- * Especially on page:
- * 16 - 17
- * Timestamp:
- * 22:38 06.07.2017 GMT
- **/
+ * Consider exploring next document:
+ * http://www-mmsp.ece.mcgill.ca/Documents/AudioFormats/WAVE/Docs/RIFFNEW.pdf
+ * Especially on page:
+ * 16 - 17
+ * Timestamp:
+ * 22:38 06.07.2017 GMT
+ **/
for (int i = 0; i < 10; i++) {
file->get_32(); // i wish to know why should i do this... no doc!
diff --git a/editor/plugins/canvas_item_editor_plugin.cpp b/editor/plugins/canvas_item_editor_plugin.cpp
index 5544d9261e..0e1bdf0155 100644
--- a/editor/plugins/canvas_item_editor_plugin.cpp
+++ b/editor/plugins/canvas_item_editor_plugin.cpp
@@ -2983,18 +2983,16 @@ void CanvasItemEditor::_draw_ruler_tool() {
const Vector2 end_to_begin = (end - begin);
- real_t arc_1_start_angle =
- end_to_begin.x < 0 ?
- (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 - vertical_angle_rad : Math_PI / 2.0) :
- (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 : Math_PI / 2.0 - vertical_angle_rad);
+ real_t arc_1_start_angle = end_to_begin.x < 0
+ ? (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 - vertical_angle_rad : Math_PI / 2.0)
+ : (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 : Math_PI / 2.0 - vertical_angle_rad);
real_t arc_1_end_angle = arc_1_start_angle + vertical_angle_rad;
// Constrain arc to triangle height & max size
real_t arc_1_radius = MIN(MIN(arc_radius_max_length_percent * ruler_length, ABS(end_to_begin.y)), arc_max_radius);
- real_t arc_2_start_angle =
- end_to_begin.x < 0 ?
- (end_to_begin.y < 0 ? 0.0 : -horizontal_angle_rad) :
- (end_to_begin.y < 0 ? Math_PI - horizontal_angle_rad : Math_PI);
+ real_t arc_2_start_angle = end_to_begin.x < 0
+ ? (end_to_begin.y < 0 ? 0.0 : -horizontal_angle_rad)
+ : (end_to_begin.y < 0 ? Math_PI - horizontal_angle_rad : Math_PI);
real_t arc_2_end_angle = arc_2_start_angle + horizontal_angle_rad;
// Constrain arc to triangle width & max size
real_t arc_2_radius = MIN(MIN(arc_radius_max_length_percent * ruler_length, ABS(end_to_begin.x)), arc_max_radius);
diff --git a/editor/plugins/curve_editor_plugin.cpp b/editor/plugins/curve_editor_plugin.cpp
index 4a22dc5b62..43eb6a7ce9 100644
--- a/editor/plugins/curve_editor_plugin.cpp
+++ b/editor/plugins/curve_editor_plugin.cpp
@@ -354,9 +354,9 @@ void CurveEditor::open_context_menu(Vector2 pos) {
_context_menu->add_check_item(TTR("Linear"), CONTEXT_LINEAR);
- bool is_linear = _selected_tangent == TANGENT_LEFT ?
- _curve_ref->get_point_left_mode(_selected_point) == Curve::TANGENT_LINEAR :
- _curve_ref->get_point_right_mode(_selected_point) == Curve::TANGENT_LINEAR;
+ bool is_linear = _selected_tangent == TANGENT_LEFT
+ ? _curve_ref->get_point_left_mode(_selected_point) == Curve::TANGENT_LINEAR
+ : _curve_ref->get_point_right_mode(_selected_point) == Curve::TANGENT_LINEAR;
_context_menu->set_item_checked(_context_menu->get_item_index(CONTEXT_LINEAR), is_linear);
diff --git a/editor/plugins/node_3d_editor_gizmos.cpp b/editor/plugins/node_3d_editor_gizmos.cpp
index b28f3e134c..cbbdfd412d 100644
--- a/editor/plugins/node_3d_editor_gizmos.cpp
+++ b/editor/plugins/node_3d_editor_gizmos.cpp
@@ -3641,15 +3641,15 @@ void LightmapGIGizmoPlugin::redraw(EditorNode3DGizmo *p_gizmo) {
const float c4 = 0.886227;
const float c5 = 0.247708;
Vector3 light = (c1 * sh_col[8] * (n.x * n.x - n.y * n.y) +
- c3 * sh_col[6] * n.z * n.z +
- c4 * sh_col[0] -
- c5 * sh_col[6] +
- 2.0 * c1 * sh_col[4] * n.x * n.y +
- 2.0 * c1 * sh_col[7] * n.x * n.z +
- 2.0 * c1 * sh_col[5] * n.y * n.z +
- 2.0 * c2 * sh_col[3] * n.x +
- 2.0 * c2 * sh_col[1] * n.y +
- 2.0 * c2 * sh_col[2] * n.z);
+ c3 * sh_col[6] * n.z * n.z +
+ c4 * sh_col[0] -
+ c5 * sh_col[6] +
+ 2.0 * c1 * sh_col[4] * n.x * n.y +
+ 2.0 * c1 * sh_col[7] * n.x * n.z +
+ 2.0 * c1 * sh_col[5] * n.y * n.z +
+ 2.0 * c2 * sh_col[3] * n.x +
+ 2.0 * c2 * sh_col[1] * n.y +
+ 2.0 * c2 * sh_col[2] * n.z);
colors.push_back(Color(light.x, light.y, light.z, 1));
}
diff --git a/editor/plugins/node_3d_editor_plugin.cpp b/editor/plugins/node_3d_editor_plugin.cpp
index 632207befc..fb41a8f497 100644
--- a/editor/plugins/node_3d_editor_plugin.cpp
+++ b/editor/plugins/node_3d_editor_plugin.cpp
@@ -1855,7 +1855,7 @@ void Node3DEditorViewport::_sinput(const Ref<InputEvent> &p_event) {
motion_snapped.snap(Vector3(snap, snap, snap));
// This might not be necessary anymore after issue #288 is solved (in 4.0?).
set_message(TTR("Scaling: ") + "(" + String::num(motion_snapped.x, snap_step_decimals) + ", " +
- String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
+ String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
List<Node *> &selection = editor_selection->get_selected_node_list();
for (Node *E : selection) {
@@ -1954,7 +1954,7 @@ void Node3DEditorViewport::_sinput(const Ref<InputEvent> &p_event) {
Vector3 motion_snapped = motion;
motion_snapped.snap(Vector3(snap, snap, snap));
set_message(TTR("Translating: ") + "(" + String::num(motion_snapped.x, snap_step_decimals) + ", " +
- String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
+ String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
List<Node *> &selection = editor_selection->get_selected_node_list();
for (Node *E : selection) {
diff --git a/editor/plugins/path_3d_editor_plugin.cpp b/editor/plugins/path_3d_editor_plugin.cpp
index e2902feba1..f9a5f429d2 100644
--- a/editor/plugins/path_3d_editor_plugin.cpp
+++ b/editor/plugins/path_3d_editor_plugin.cpp
@@ -614,15 +614,6 @@ Path3DEditorPlugin::Path3DEditorPlugin(EditorNode *p_node) {
menu->connect("id_pressed", callable_mp(this, &Path3DEditorPlugin::_handle_option_pressed));
curve_edit->set_pressed(true);
- /*
- collision_polygon_editor = memnew( PathEditor(p_node) );
- editor->get_main_control()->add_child(collision_polygon_editor);
- collision_polygon_editor->set_margin(MARGIN_LEFT,200);
- collision_polygon_editor->set_margin(MARGIN_RIGHT,230);
- collision_polygon_editor->set_margin(MARGIN_TOP,0);
- collision_polygon_editor->set_margin(MARGIN_BOTTOM,10);
- collision_polygon_editor->hide();
- */
}
Path3DEditorPlugin::~Path3DEditorPlugin() {
diff --git a/editor/plugins/script_editor_plugin.cpp b/editor/plugins/script_editor_plugin.cpp
index 677a5f1f2c..3f98560a2f 100644
--- a/editor/plugins/script_editor_plugin.cpp
+++ b/editor/plugins/script_editor_plugin.cpp
@@ -315,10 +315,7 @@ void ScriptEditorQuickOpen::_text_changed(const String &p_newtext) {
void ScriptEditorQuickOpen::_sbox_input(const Ref<InputEvent> &p_ie) {
Ref<InputEventKey> k = p_ie;
- if (k.is_valid() && (k->get_keycode() == KEY_UP ||
- k->get_keycode() == KEY_DOWN ||
- k->get_keycode() == KEY_PAGEUP ||
- k->get_keycode() == KEY_PAGEDOWN)) {
+ if (k.is_valid() && (k->get_keycode() == KEY_UP || k->get_keycode() == KEY_DOWN || k->get_keycode() == KEY_PAGEUP || k->get_keycode() == KEY_PAGEDOWN)) {
search_options->gui_input(k);
search_box->accept_event();
}
diff --git a/editor/plugins/script_text_editor.cpp b/editor/plugins/script_text_editor.cpp
index 2c02389db2..219498b5e7 100644
--- a/editor/plugins/script_text_editor.cpp
+++ b/editor/plugins/script_text_editor.cpp
@@ -1396,11 +1396,12 @@ Variant ScriptTextEditor::get_drag_data_fw(const Point2 &p_point, Control *p_fro
bool ScriptTextEditor::can_drop_data_fw(const Point2 &p_point, const Variant &p_data, Control *p_from) const {
Dictionary d = p_data;
- if (d.has("type") && (String(d["type"]) == "resource" ||
- String(d["type"]) == "files" ||
- String(d["type"]) == "nodes" ||
- String(d["type"]) == "obj_property" ||
- String(d["type"]) == "files_and_dirs")) {
+ if (d.has("type") &&
+ (String(d["type"]) == "resource" ||
+ String(d["type"]) == "files" ||
+ String(d["type"]) == "nodes" ||
+ String(d["type"]) == "obj_property" ||
+ String(d["type"]) == "files_and_dirs")) {
return true;
}
diff --git a/editor/plugins/visual_shader_editor_plugin.cpp b/editor/plugins/visual_shader_editor_plugin.cpp
index 09ca1f7608..d0f3da8d81 100644
--- a/editor/plugins/visual_shader_editor_plugin.cpp
+++ b/editor/plugins/visual_shader_editor_plugin.cpp
@@ -3207,10 +3207,7 @@ void VisualShaderEditor::_show_members_dialog(bool at_mouse_pos, VisualShaderNod
void VisualShaderEditor::_sbox_input(const Ref<InputEvent> &p_ie) {
Ref<InputEventKey> ie = p_ie;
- if (ie.is_valid() && (ie->get_keycode() == KEY_UP ||
- ie->get_keycode() == KEY_DOWN ||
- ie->get_keycode() == KEY_ENTER ||
- ie->get_keycode() == KEY_KP_ENTER)) {
+ if (ie.is_valid() && (ie->get_keycode() == KEY_UP || ie->get_keycode() == KEY_DOWN || ie->get_keycode() == KEY_ENTER || ie->get_keycode() == KEY_KP_ENTER)) {
members->gui_input(ie);
node_filter->accept_event();
}
diff --git a/editor/property_editor.cpp b/editor/property_editor.cpp
index 6ea9b9dfae..db560af657 100644
--- a/editor/property_editor.cpp
+++ b/editor/property_editor.cpp
@@ -407,11 +407,11 @@ bool CustomPropertyEditor::edit(Object *p_owner, const String &p_name, Variant::
return false;
} else if (hint == PROPERTY_HINT_LAYERS_2D_PHYSICS ||
- hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
- hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
- hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
- hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
- hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
+ hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
+ hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
+ hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
+ hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
+ hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
String basename;
switch (hint) {
case PROPERTY_HINT_LAYERS_2D_RENDER:
diff --git a/editor/rename_dialog.cpp b/editor/rename_dialog.cpp
index a5e1b0eab8..2792c193d9 100644
--- a/editor/rename_dialog.cpp
+++ b/editor/rename_dialog.cpp
@@ -626,7 +626,7 @@ void RenameDialog::reset() {
bool RenameDialog::_is_main_field(LineEdit *line_edit) {
return line_edit &&
- (line_edit == lne_search || line_edit == lne_replace || line_edit == lne_prefix || line_edit == lne_suffix);
+ (line_edit == lne_search || line_edit == lne_replace || line_edit == lne_prefix || line_edit == lne_suffix);
}
void RenameDialog::_insert_text(String text) {
diff --git a/main/main.cpp b/main/main.cpp
index d4a6216e35..edd67971ea 100644
--- a/main/main.cpp
+++ b/main/main.cpp
@@ -923,7 +923,7 @@ Error Main::setup(const char *execpath, int argc, char *argv[], bool p_second_ph
// Needs full refactoring to fix properly.
main_args.push_back(I->get());
} else if (I->get() == "--export" || I->get() == "--export-debug" ||
- I->get() == "--export-pack") { // Export project
+ I->get() == "--export-pack") { // Export project
// Actually handling is done in start().
editor = true;
cmdline_tool = true;
@@ -1308,10 +1308,12 @@ Error Main::setup(const char *execpath, int argc, char *argv[], bool p_second_ph
OS::get_singleton()->_allow_hidpi = GLOBAL_DEF("display/window/dpi/allow_hidpi", false);
}
- /* todo restore
- OS::get_singleton()->_allow_layered = GLOBAL_DEF("display/window/per_pixel_transparency/allowed", false);
- video_mode.layered = GLOBAL_DEF("display/window/per_pixel_transparency/enabled", false);
-*/
+ // FIXME: Restore support.
+#if 0
+ //OS::get_singleton()->_allow_layered = GLOBAL_DEF("display/window/per_pixel_transparency/allowed", false);
+ video_mode.layered = GLOBAL_DEF("display/window/per_pixel_transparency/enabled", false);
+#endif
+
if (editor || project_manager) {
// The editor and project manager always detect and use hiDPI if needed
OS::get_singleton()->_allow_hidpi = true;
diff --git a/modules/bmp/image_loader_bmp.cpp b/modules/bmp/image_loader_bmp.cpp
index bd8342e1aa..3d47055247 100644
--- a/modules/bmp/image_loader_bmp.cpp
+++ b/modules/bmp/image_loader_bmp.cpp
@@ -248,8 +248,7 @@ Error ImageLoaderBMP::load_image(Ref<Image> p_image, FileAccess *f,
}
// Don't rely on sizeof(bmp_file_header) as structure padding
// adds 2 bytes offset leading to misaligned color table reading
- uint32_t ct_offset = BITMAP_FILE_HEADER_SIZE +
- bmp_header.bmp_info_header.bmp_header_size;
+ uint32_t ct_offset = BITMAP_FILE_HEADER_SIZE + bmp_header.bmp_info_header.bmp_header_size;
f->seek(ct_offset);
uint32_t color_table_size = 0;
@@ -271,8 +270,7 @@ Error ImageLoaderBMP::load_image(Ref<Image> p_image, FileAccess *f,
f->seek(bmp_header.bmp_file_header.bmp_file_offset);
- uint32_t bmp_buffer_size = (bmp_header.bmp_file_header.bmp_file_size -
- bmp_header.bmp_file_header.bmp_file_offset);
+ uint32_t bmp_buffer_size = (bmp_header.bmp_file_header.bmp_file_size - bmp_header.bmp_file_header.bmp_file_offset);
Vector<uint8_t> bmp_buffer;
err = bmp_buffer.resize(bmp_buffer_size);
diff --git a/modules/csg/csg.cpp b/modules/csg/csg.cpp
index 5ffe644495..a7742ef415 100644
--- a/modules/csg/csg.cpp
+++ b/modules/csg/csg.cpp
@@ -156,8 +156,8 @@ inline bool is_point_in_triangle(const Vector3 &p_point, const Vector3 p_vertice
inline static bool is_triangle_degenerate(const Vector2 p_vertices[3], real_t p_vertex_snap2) {
real_t det = p_vertices[0].x * p_vertices[1].y - p_vertices[0].x * p_vertices[2].y +
- p_vertices[0].y * p_vertices[2].x - p_vertices[0].y * p_vertices[1].x +
- p_vertices[1].x * p_vertices[2].y - p_vertices[1].y * p_vertices[2].x;
+ p_vertices[0].y * p_vertices[2].x - p_vertices[0].y * p_vertices[1].x +
+ p_vertices[1].x * p_vertices[2].y - p_vertices[1].y * p_vertices[2].x;
return det < p_vertex_snap2;
}
diff --git a/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp b/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp
index 1eee10b251..d6abcbb00a 100644
--- a/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp
+++ b/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp
@@ -82,46 +82,6 @@ OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
#include <stdint.h>
namespace FBXDocParser {
-//enum Flag
-//{
-// e_unknown_0 = 1 << 0,
-// e_unknown_1 = 1 << 1,
-// e_unknown_2 = 1 << 2,
-// e_unknown_3 = 1 << 3,
-// e_unknown_4 = 1 << 4,
-// e_unknown_5 = 1 << 5,
-// e_unknown_6 = 1 << 6,
-// e_unknown_7 = 1 << 7,
-// e_unknown_8 = 1 << 8,
-// e_unknown_9 = 1 << 9,
-// e_unknown_10 = 1 << 10,
-// e_unknown_11 = 1 << 11,
-// e_unknown_12 = 1 << 12,
-// e_unknown_13 = 1 << 13,
-// e_unknown_14 = 1 << 14,
-// e_unknown_15 = 1 << 15,
-// e_unknown_16 = 1 << 16,
-// e_unknown_17 = 1 << 17,
-// e_unknown_18 = 1 << 18,
-// e_unknown_19 = 1 << 19,
-// e_unknown_20 = 1 << 20,
-// e_unknown_21 = 1 << 21,
-// e_unknown_22 = 1 << 22,
-// e_unknown_23 = 1 << 23,
-// e_flag_field_size_64_bit = 1 << 24, // Not sure what is
-// e_unknown_25 = 1 << 25,
-// e_unknown_26 = 1 << 26,
-// e_unknown_27 = 1 << 27,
-// e_unknown_28 = 1 << 28,
-// e_unknown_29 = 1 << 29,
-// e_unknown_30 = 1 << 30,
-// e_unknown_31 = 1 << 31
-//};
-//
-//bool check_flag(uint32_t flags, Flag to_check)
-//{
-// return (flags & to_check) != 0;
-//}
// ------------------------------------------------------------------------------------------------
Token::Token(const char *sbegin, const char *send, TokenType type, size_t offset) :
sbegin(sbegin),
@@ -458,12 +418,6 @@ void TokenizeBinary(TokenList &output_tokens, const char *input, size_t length,
//TokenizeError("file is too short",0);
}
- //uint32_t offset = 0x15;
- /* const char* cursor = input + 0x15;
- const uint32_t flags = ReadWord(input, cursor, input + length);
- const uint8_t padding_0 = ReadByte(input, cursor, input + length); // unused
- const uint8_t padding_1 = ReadByte(input, cursor, input + length); // unused*/
-
if (strncmp(input, "Kaydara FBX Binary", 18)) {
TokenizeError("magic bytes not found", 0);
}
diff --git a/modules/fbx/fbx_parser/FBXCommon.h b/modules/fbx/fbx_parser/FBXCommon.h
index 641d6d351e..611bf22d3b 100644
--- a/modules/fbx/fbx_parser/FBXCommon.h
+++ b/modules/fbx/fbx_parser/FBXCommon.h
@@ -70,8 +70,8 @@ OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
*/
/** @file FBXCommon.h
-* Some useful constants and enums for dealing with FBX files.
-*/
+ * Some useful constants and enums for dealing with FBX files.
+ */
#ifndef FBX_COMMON_H
#define FBX_COMMON_H
diff --git a/modules/fbx/fbx_parser/FBXDocument.h b/modules/fbx/fbx_parser/FBXDocument.h
index 885ff8fca4..539d633331 100644
--- a/modules/fbx/fbx_parser/FBXDocument.h
+++ b/modules/fbx/fbx_parser/FBXDocument.h
@@ -706,13 +706,13 @@ public:
virtual ~AnimationCurve();
/** get list of keyframe positions (time).
- * Invariant: |GetKeys()| > 0 */
+ * Invariant: |GetKeys()| > 0 */
const KeyTimeList &GetKeys() const {
return keys;
}
/** get list of keyframe values.
- * Invariant: |GetKeys()| == |GetValues()| && |GetKeys()| > 0*/
+ * Invariant: |GetKeys()| == |GetValues()| && |GetKeys()| > 0*/
const KeyValueList &GetValues() const {
return values;
}
@@ -750,8 +750,8 @@ typedef std::weak_ptr<AnimationCurveNode> AnimationCurveNodeWeakPtr;
class AnimationCurveNode : public Object {
public:
/* the optional white list specifies a list of property names for which the caller
- wants animations for. If the curve node does not match one of these, std::range_error
- will be thrown. */
+ wants animations for. If the curve node does not match one of these, std::range_error
+ will be thrown. */
AnimationCurveNode(uint64_t id, const ElementPtr element, const std::string &name, const Document &doc,
const char *const *target_prop_whitelist = nullptr, size_t whitelist_size = 0);
@@ -760,8 +760,8 @@ public:
const AnimationMap &Curves() const;
/** Object the curve is assigned to, this can be nullptr if the
- * target object has no DOM representation or could not
- * be read for other reasons.*/
+ * target object has no DOM representation or could not
+ * be read for other reasons.*/
Object *Target() const {
return target;
}
@@ -799,8 +799,8 @@ public:
virtual ~AnimationLayer();
/* the optional white list specifies a list of property names for which the caller
- wants animations for. Curves not matching this list will not be added to the
- animation layer. */
+ wants animations for. Curves not matching this list will not be added to the
+ animation layer. */
const AnimationCurveNodeList Nodes(const char *const *target_prop_whitelist = nullptr, size_t whitelist_size = 0) const;
private:
@@ -891,15 +891,15 @@ public:
virtual ~Cluster();
/** get the list of deformer weights associated with this cluster.
- * Use #GetIndices() to get the associated vertices. Both arrays
- * have the same size (and may also be empty). */
+ * Use #GetIndices() to get the associated vertices. Both arrays
+ * have the same size (and may also be empty). */
const std::vector<float> &GetWeights() const {
return weights;
}
/** get indices into the vertex data of the geometry associated
- * with this cluster. Use #GetWeights() to get the associated weights.
- * Both arrays have the same size (and may also be empty). */
+ * with this cluster. Use #GetWeights() to get the associated weights.
+ * Both arrays have the same size (and may also be empty). */
const std::vector<unsigned int> &GetIndices() const {
return indices;
}
@@ -998,7 +998,7 @@ public:
LazyObject *LazyDestinationObject() const;
/** return the name of the property the connection is attached to.
- * this is an empty string for object to object (OO) connections. */
+ * this is an empty string for object to object (OO) connections. */
const std::string &PropertyName() const {
return prop;
}
diff --git a/modules/fbx/fbx_parser/FBXDocumentUtil.h b/modules/fbx/fbx_parser/FBXDocumentUtil.h
index ba86191c4a..0489ce10ce 100644
--- a/modules/fbx/fbx_parser/FBXDocumentUtil.h
+++ b/modules/fbx/fbx_parser/FBXDocumentUtil.h
@@ -107,12 +107,12 @@ const T *ProcessSimpleConnection(const Connection &con,
const char **propNameOut = nullptr) {
if (is_object_property_conn && !con.PropertyName().length()) {
DOMWarning("expected incoming " + std::string(name) +
- " link to be an object-object connection, ignoring",
+ " link to be an object-object connection, ignoring",
element);
return nullptr;
} else if (!is_object_property_conn && con.PropertyName().length()) {
DOMWarning("expected incoming " + std::string(name) +
- " link to be an object-property connection, ignoring",
+ " link to be an object-property connection, ignoring",
element);
return nullptr;
}
diff --git a/modules/fbx/fbx_parser/FBXImportSettings.h b/modules/fbx/fbx_parser/FBXImportSettings.h
index b016db174b..bc22386957 100644
--- a/modules/fbx/fbx_parser/FBXImportSettings.h
+++ b/modules/fbx/fbx_parser/FBXImportSettings.h
@@ -81,29 +81,29 @@ namespace FBXDocParser {
/** FBX import settings, parts of which are publicly accessible via their corresponding AI_CONFIG constants */
struct ImportSettings {
/** enable strict mode:
- * - only accept fbx 2012, 2013 files
- * - on the slightest error, give up.
- *
- * Basically, strict mode means that the fbx file will actually
- * be validated.*/
+ * - only accept fbx 2012, 2013 files
+ * - on the slightest error, give up.
+ *
+ * Basically, strict mode means that the fbx file will actually
+ * be validated.*/
bool strictMode = true;
/** specifies whether all geometry layers are read and scanned for
- * usable data channels. The FBX spec indicates that many readers
- * will only read the first channel and that this is in some way
- * the recommended way- in reality, however, it happens a lot that
- * vertex data is spread among multiple layers.*/
+ * usable data channels. The FBX spec indicates that many readers
+ * will only read the first channel and that this is in some way
+ * the recommended way- in reality, however, it happens a lot that
+ * vertex data is spread among multiple layers.*/
bool readAllLayers = true;
/** specifies whether all materials are read, or only those that
- * are referenced by at least one mesh. Reading all materials
- * may make FBX reading a lot slower since all objects
- * need to be processed.
- * This bit is ignored unless readMaterials=true.*/
+ * are referenced by at least one mesh. Reading all materials
+ * may make FBX reading a lot slower since all objects
+ * need to be processed.
+ * This bit is ignored unless readMaterials=true.*/
bool readAllMaterials = true;
/** import materials (true) or skip them and assign a default
- * material.*/
+ * material.*/
bool readMaterials = true;
/** import embedded textures?*/
@@ -116,35 +116,35 @@ struct ImportSettings {
bool readLights = true;
/** import animations (i.e. animation curves, the node
- * skeleton is always imported).*/
+ * skeleton is always imported).*/
bool readAnimations = true;
/** read bones (vertex weights and deform info).*/
bool readWeights = true;
/** preserve transformation pivots and offsets. Since these can
- * not directly be represented in assimp, additional dummy
- * nodes will be generated. Note that settings this to false
- * can make animation import a lot slower.
- *
- * The naming scheme for the generated nodes is:
- * <OriginalName>_$AssimpFbx$_<TransformName>
- *
- * where <TransformName> is one of
- * RotationPivot
- * RotationOffset
- * PreRotation
- * PostRotation
- * ScalingPivot
- * ScalingOffset
- * Translation
- * Scaling
- * Rotation
- **/
+ * not directly be represented in assimp, additional dummy
+ * nodes will be generated. Note that settings this to false
+ * can make animation import a lot slower.
+ *
+ * The naming scheme for the generated nodes is:
+ * <OriginalName>_$AssimpFbx$_<TransformName>
+ *
+ * where <TransformName> is one of
+ * RotationPivot
+ * RotationOffset
+ * PreRotation
+ * PostRotation
+ * ScalingPivot
+ * ScalingOffset
+ * Translation
+ * Scaling
+ * Rotation
+ **/
bool preservePivots = true;
/** do not import animation curves that specify a constant
- * values matching the corresponding node transformation.*/
+ * values matching the corresponding node transformation.*/
bool optimizeEmptyAnimationCurves = true;
/** use legacy naming for embedded textures eg: (*0, *1, *2).*/
diff --git a/modules/fbx/fbx_parser/FBXMeshGeometry.h b/modules/fbx/fbx_parser/FBXMeshGeometry.h
index c9b25f008d..26fc1914d1 100644
--- a/modules/fbx/fbx_parser/FBXMeshGeometry.h
+++ b/modules/fbx/fbx_parser/FBXMeshGeometry.h
@@ -226,7 +226,7 @@ public:
const std::vector<Vector3> &GetVertices() const;
/** Get a list of all vertex normals or an empty array if
- * no normals are specified. */
+ * no normals are specified. */
const std::vector<Vector3> &GetNormals() const;
/** Return list of vertex indices. */
@@ -238,8 +238,8 @@ private:
std::vector<unsigned int> m_indices;
};
/**
-* DOM class for FBX geometry of type "Line"
-*/
+ * DOM class for FBX geometry of type "Line"
+ */
class LineGeometry : public Geometry {
public:
/** The class constructor */
diff --git a/modules/fbx/fbx_parser/FBXParser.cpp b/modules/fbx/fbx_parser/FBXParser.cpp
index d9ef025a16..dbc9a0e46d 100644
--- a/modules/fbx/fbx_parser/FBXParser.cpp
+++ b/modules/fbx/fbx_parser/FBXParser.cpp
@@ -660,13 +660,6 @@ void ParseVectorDataArray(std::vector<Vector3> &out, const ElementPtr el) {
static_cast<real_t>(d[1]),
static_cast<real_t>(d[2])));
}
- // for debugging
- /*for ( size_t i = 0; i < out.size(); i++ ) {
- aiVector3D vec3( out[ i ] );
- std::stringstream stream;
- stream << " vec3.x = " << vec3.x << " vec3.y = " << vec3.y << " vec3.z = " << vec3.z << std::endl;
- DefaultLogger::get()->info( stream.str() );
- }*/
} else if (type == 'f') {
const float *f = reinterpret_cast<const float *>(&buff[0]);
for (unsigned int i = 0; i < count3; ++i, f += 3) {
diff --git a/modules/fbx/fbx_parser/FBXParser.h b/modules/fbx/fbx_parser/FBXParser.h
index 93836c2205..27db18bf8a 100644
--- a/modules/fbx/fbx_parser/FBXParser.h
+++ b/modules/fbx/fbx_parser/FBXParser.h
@@ -187,7 +187,7 @@ private:
class Parser {
public:
/** Parse given a token list. Does not take ownership of the tokens -
- * the objects must persist during the entire parser lifetime */
+ * the objects must persist during the entire parser lifetime */
Parser(const TokenList &tokens, bool is_binary);
~Parser();
diff --git a/modules/fbx/fbx_parser/FBXProperties.cpp b/modules/fbx/fbx_parser/FBXProperties.cpp
index 37717e9109..b8c0f685ac 100644
--- a/modules/fbx/fbx_parser/FBXProperties.cpp
+++ b/modules/fbx/fbx_parser/FBXProperties.cpp
@@ -114,12 +114,12 @@ PropertyPtr ReadTypedProperty(const ElementPtr element) {
} else if (!strcmp(cs, "KTime")) {
return new TypedProperty<int64_t>(ParseTokenAsInt64(tok[4]));
} else if (!strcmp(cs, "Vector3D") ||
- !strcmp(cs, "ColorRGB") ||
- !strcmp(cs, "Vector") ||
- !strcmp(cs, "Color") ||
- !strcmp(cs, "Lcl Translation") ||
- !strcmp(cs, "Lcl Rotation") ||
- !strcmp(cs, "Lcl Scaling")) {
+ !strcmp(cs, "ColorRGB") ||
+ !strcmp(cs, "Vector") ||
+ !strcmp(cs, "Color") ||
+ !strcmp(cs, "Lcl Translation") ||
+ !strcmp(cs, "Lcl Rotation") ||
+ !strcmp(cs, "Lcl Scaling")) {
return new TypedProperty<Vector3>(Vector3(
ParseTokenAsFloat(tok[4]),
ParseTokenAsFloat(tok[5]),
diff --git a/modules/fbx/fbx_parser/FBXUtil.cpp b/modules/fbx/fbx_parser/FBXUtil.cpp
index 1f14a69099..df46bd85c7 100644
--- a/modules/fbx/fbx_parser/FBXUtil.cpp
+++ b/modules/fbx/fbx_parser/FBXUtil.cpp
@@ -169,10 +169,10 @@ char EncodeBase64(char byte) {
}
/** Encodes a block of 4 bytes to base64 encoding
-* @param bytes Bytes to encode.
-* @param out_string String to write encoded values to.
-* @param string_pos Position in out_string.
-*/
+ * @param bytes Bytes to encode.
+ * @param out_string String to write encoded values to.
+ * @param string_pos Position in out_string.
+ */
void EncodeByteBlock(const char *bytes, std::string &out_string, size_t string_pos) {
char b0 = (bytes[0] & 0xFC) >> 2;
char b1 = (bytes[0] & 0x03) << 4 | ((bytes[1] & 0xF0) >> 4);
diff --git a/modules/fbx/fbx_parser/FBXUtil.h b/modules/fbx/fbx_parser/FBXUtil.h
index efc131831b..dab2a4201e 100644
--- a/modules/fbx/fbx_parser/FBXUtil.h
+++ b/modules/fbx/fbx_parser/FBXUtil.h
@@ -87,34 +87,34 @@ namespace Util {
const char *TokenTypeString(TokenType t);
/** Decode a single Base64-encoded character.
-*
-* @param ch Character to decode (from base64 to binary).
-* @return decoded byte value*/
+ *
+ * @param ch Character to decode (from base64 to binary).
+ * @return decoded byte value*/
uint8_t DecodeBase64(char ch);
/** Compute decoded size of a Base64-encoded string
-*
-* @param in Characters to decode.
-* @param inLength Number of characters to decode.
-* @return size of the decoded data (number of bytes)*/
+ *
+ * @param in Characters to decode.
+ * @param inLength Number of characters to decode.
+ * @return size of the decoded data (number of bytes)*/
size_t ComputeDecodedSizeBase64(const char *in, size_t inLength);
/** Decode a Base64-encoded string
-*
-* @param in Characters to decode.
-* @param inLength Number of characters to decode.
-* @param out Pointer where we will store the decoded data.
-* @param maxOutLength Size of output buffer.
-* @return size of the decoded data (number of bytes)*/
+ *
+ * @param in Characters to decode.
+ * @param inLength Number of characters to decode.
+ * @param out Pointer where we will store the decoded data.
+ * @param maxOutLength Size of output buffer.
+ * @return size of the decoded data (number of bytes)*/
size_t DecodeBase64(const char *in, size_t inLength, uint8_t *out, size_t maxOutLength);
char EncodeBase64(char byte);
/** Encode bytes in base64-encoding
-*
-* @param data Binary data to encode.
-* @param inLength Number of bytes to encode.
-* @return base64-encoded string*/
+ *
+ * @param data Binary data to encode.
+ * @param inLength Number of bytes to encode.
+ * @return base64-encoded string*/
std::string EncodeBase64(const char *data, size_t length);
} // namespace Util
} // namespace FBXDocParser
diff --git a/modules/fbx/tools/import_utils.h b/modules/fbx/tools/import_utils.h
index fbe7dbd82f..88c71fb87e 100644
--- a/modules/fbx/tools/import_utils.h
+++ b/modules/fbx/tools/import_utils.h
@@ -43,7 +43,7 @@
/**
* Import Utils
* Conversion tools / glue code to convert from FBX to Godot
-*/
+ */
class ImportUtils {
public:
/// Convert a vector from degrees to radians.
@@ -201,7 +201,7 @@ public:
};
/** Get fbx fps for time mode meta data
- */
+ */
static float get_fbx_fps(int32_t time_mode) {
switch (time_mode) {
case AssetImportFbx::TIME_MODE_DEFAULT:
@@ -258,13 +258,13 @@ public:
}
/**
- * Find hardcoded textures from assimp which could be in many different directories
- */
+ * Find hardcoded textures from assimp which could be in many different directories
+ */
/**
- * set_texture_mapping_mode
- * Helper to check the mapping mode of the texture (repeat, clamp and mirror)
- */
+ * set_texture_mapping_mode
+ * Helper to check the mapping mode of the texture (repeat, clamp and mirror)
+ */
// static void set_texture_mapping_mode(aiTextureMapMode *map_mode, Ref<ImageTexture> texture) {
// ERR_FAIL_COND(texture.is_null());
// ERR_FAIL_COND(map_mode == nullptr);
@@ -282,9 +282,9 @@ public:
// }
/**
- * Load or load from cache image :)
- * We need to upgrade this in the later version :) should not be hard
- */
+ * Load or load from cache image :)
+ * We need to upgrade this in the later version :) should not be hard
+ */
//static Ref<Image> load_image(ImportState &state, const aiScene *p_scene, String p_path){
// Map<String, Ref<Image> >::Element *match = state.path_to_image_cache.find(p_path);
diff --git a/modules/gdnative/pluginscript/pluginscript_script.cpp b/modules/gdnative/pluginscript/pluginscript_script.cpp
index 2b4ceda49d..04a293ddbd 100644
--- a/modules/gdnative/pluginscript/pluginscript_script.cpp
+++ b/modules/gdnative/pluginscript/pluginscript_script.cpp
@@ -361,13 +361,6 @@ Error PluginScript::reload(bool p_keep_state) {
_properties_default_values[pi.name] = v["default_value"];
}
-#ifdef TOOLS_ENABLED
-/*for (Set<PlaceHolderScriptInstance*>::Element *E=placeholders.front();E;E=E->next()) {
-
- _update_placeholder(E->get());
- }*/
-#endif
-
FREE_SCRIPT_MANIFEST(manifest);
return OK;
#undef FREE_SCRIPT_MANIFEST
diff --git a/modules/gdscript/gdscript.cpp b/modules/gdscript/gdscript.cpp
index 42865242d3..2e55506fd4 100644
--- a/modules/gdscript/gdscript.cpp
+++ b/modules/gdscript/gdscript.cpp
@@ -2040,15 +2040,15 @@ void GDScriptLanguage::get_reserved_words(List<String> *p_words) const {
bool GDScriptLanguage::is_control_flow_keyword(String p_keyword) const {
return p_keyword == "break" ||
- p_keyword == "continue" ||
- p_keyword == "elif" ||
- p_keyword == "else" ||
- p_keyword == "if" ||
- p_keyword == "for" ||
- p_keyword == "match" ||
- p_keyword == "pass" ||
- p_keyword == "return" ||
- p_keyword == "while";
+ p_keyword == "continue" ||
+ p_keyword == "elif" ||
+ p_keyword == "else" ||
+ p_keyword == "if" ||
+ p_keyword == "for" ||
+ p_keyword == "match" ||
+ p_keyword == "pass" ||
+ p_keyword == "return" ||
+ p_keyword == "while";
}
bool GDScriptLanguage::handles_global_class_type(const String &p_type) const {
diff --git a/modules/gdscript/gdscript_parser.cpp b/modules/gdscript/gdscript_parser.cpp
index 8cb25e2c03..b96139ac51 100644
--- a/modules/gdscript/gdscript_parser.cpp
+++ b/modules/gdscript/gdscript_parser.cpp
@@ -3068,9 +3068,9 @@ void GDScriptParser::get_class_doc_comment(int p_line, String &p_brief, String &
} else {
/* Syntax:
- @tutorial ( The Title Here ) : https://the.url/
- ^ open ^ close ^ colon ^ url
- */
+ * @tutorial ( The Title Here ) : https://the.url/
+ * ^ open ^ close ^ colon ^ url
+ */
int open_bracket_pos = begin_scan, close_bracket_pos = 0;
while (open_bracket_pos < striped_line.length() && (striped_line[open_bracket_pos] == ' ' || striped_line[open_bracket_pos] == '\t')) {
open_bracket_pos++;
diff --git a/modules/gdscript/gdscript_vm.cpp b/modules/gdscript/gdscript_vm.cpp
index 40f03979c6..a1cc2246d6 100644
--- a/modules/gdscript/gdscript_vm.cpp
+++ b/modules/gdscript/gdscript_vm.cpp
@@ -1110,7 +1110,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
} else {
#ifdef DEBUG_ENABLED
err_text = "Trying to assign value of type '" + Variant::get_type_name(src->get_type()) +
- "' to a variable of type '" + Variant::get_type_name(var_type) + "'.";
+ "' to a variable of type '" + Variant::get_type_name(var_type) + "'.";
OPCODE_BREAK;
}
} else {
@@ -1132,7 +1132,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
if (src->get_type() != Variant::ARRAY) {
#ifdef DEBUG_ENABLED
err_text = "Trying to assign value of type '" + Variant::get_type_name(src->get_type()) +
- "' to a variable of type '" + +"'.";
+ "' to a variable of type '" + +"'.";
#endif
OPCODE_BREAK;
}
@@ -1158,14 +1158,14 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
GD_ERR_BREAK(!nc);
if (src->get_type() != Variant::OBJECT && src->get_type() != Variant::NIL) {
err_text = "Trying to assign value of type '" + Variant::get_type_name(src->get_type()) +
- "' to a variable of type '" + nc->get_name() + "'.";
+ "' to a variable of type '" + nc->get_name() + "'.";
OPCODE_BREAK;
}
Object *src_obj = src->operator Object *();
if (src_obj && !ClassDB::is_parent_class(src_obj->get_class_name(), nc->get_name())) {
err_text = "Trying to assign value of type '" + src_obj->get_class_name() +
- "' to a variable of type '" + nc->get_name() + "'.";
+ "' to a variable of type '" + nc->get_name() + "'.";
OPCODE_BREAK;
}
#endif // DEBUG_ENABLED
@@ -1195,7 +1195,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
ScriptInstance *scr_inst = src->operator Object *()->get_script_instance();
if (!scr_inst) {
err_text = "Trying to assign value of type '" + src->operator Object *()->get_class_name() +
- "' to a variable of type '" + base_type->get_path().get_file() + "'.";
+ "' to a variable of type '" + base_type->get_path().get_file() + "'.";
OPCODE_BREAK;
}
@@ -1212,7 +1212,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
if (!valid) {
err_text = "Trying to assign value of type '" + src->operator Object *()->get_script_instance()->get_script()->get_path().get_file() +
- "' to a variable of type '" + base_type->get_path().get_file() + "'.";
+ "' to a variable of type '" + base_type->get_path().get_file() + "'.";
OPCODE_BREAK;
}
}
diff --git a/modules/gdscript/language_server/lsp.hpp b/modules/gdscript/language_server/lsp.hpp
index 3710a84a28..b12d1f5f3b 100644
--- a/modules/gdscript/language_server/lsp.hpp
+++ b/modules/gdscript/language_server/lsp.hpp
@@ -358,21 +358,21 @@ struct Command {
namespace TextDocumentSyncKind {
/**
- * Documents should not be synced at all.
- */
+ * Documents should not be synced at all.
+ */
static const int None = 0;
/**
- * Documents are synced by always sending the full content
- * of the document.
- */
+ * Documents are synced by always sending the full content
+ * of the document.
+ */
static const int Full = 1;
/**
- * Documents are synced by sending the full content on open.
- * After that only incremental updates to the document are
- * send.
- */
+ * Documents are synced by sending the full content on open.
+ * After that only incremental updates to the document are
+ * send.
+ */
static const int Incremental = 2;
}; // namespace TextDocumentSyncKind
@@ -667,20 +667,20 @@ struct TextDocumentContentChangeEvent {
// Use namespace instead of enumeration to follow the LSP specifications
namespace DiagnosticSeverity {
/**
- * Reports an error.
- */
+ * Reports an error.
+ */
static const int Error = 1;
/**
- * Reports a warning.
- */
+ * Reports a warning.
+ */
static const int Warning = 2;
/**
- * Reports an information.
- */
+ * Reports an information.
+ */
static const int Information = 3;
/**
- * Reports a hint.
- */
+ * Reports a hint.
+ */
static const int Hint = 4;
}; // namespace DiagnosticSeverity
@@ -871,18 +871,18 @@ static const int TypeParameter = 25;
*/
namespace InsertTextFormat {
/**
- * The primary text to be inserted is treated as a plain string.
- */
+ * The primary text to be inserted is treated as a plain string.
+ */
static const int PlainText = 1;
/**
- * The primary text to be inserted is treated as a snippet.
- *
- * A snippet can define tab stops and placeholders with `$1`, `$2`
- * and `${3:foo}`. `$0` defines the final tab stop, it defaults to
- * the end of the snippet. Placeholders with equal identifiers are linked,
- * that is typing in one will update others too.
- */
+ * The primary text to be inserted is treated as a snippet.
+ *
+ * A snippet can define tab stops and placeholders with `$1`, `$2`
+ * and `${3:foo}`. `$0` defines the final tab stop, it defaults to
+ * the end of the snippet. Placeholders with equal identifiers are linked,
+ * that is typing in one will update others too.
+ */
static const int Snippet = 2;
}; // namespace InsertTextFormat
@@ -1359,16 +1359,16 @@ struct NativeSymbolInspectParams {
*/
namespace FoldingRangeKind {
/**
- * Folding range for a comment
- */
+ * Folding range for a comment
+ */
static const String Comment = "comment";
/**
- * Folding range for a imports or includes
- */
+ * Folding range for a imports or includes
+ */
static const String Imports = "imports";
/**
- * Folding range for a region (e.g. `#region`)
- */
+ * Folding range for a region (e.g. `#region`)
+ */
static const String Region = "region";
} // namespace FoldingRangeKind
@@ -1419,20 +1419,20 @@ struct FoldingRange {
*/
namespace CompletionTriggerKind {
/**
- * Completion was triggered by typing an identifier (24x7 code
- * complete), manual invocation (e.g Ctrl+Space) or via API.
- */
+ * Completion was triggered by typing an identifier (24x7 code
+ * complete), manual invocation (e.g Ctrl+Space) or via API.
+ */
static const int Invoked = 1;
/**
- * Completion was triggered by a trigger character specified by
- * the `triggerCharacters` properties of the `CompletionRegistrationOptions`.
- */
+ * Completion was triggered by a trigger character specified by
+ * the `triggerCharacters` properties of the `CompletionRegistrationOptions`.
+ */
static const int TriggerCharacter = 2;
/**
- * Completion was re-triggered as the current completion list is incomplete.
- */
+ * Completion was re-triggered as the current completion list is incomplete.
+ */
static const int TriggerForIncompleteCompletions = 3;
} // namespace CompletionTriggerKind
@@ -1441,8 +1441,8 @@ static const int TriggerForIncompleteCompletions = 3;
*/
struct CompletionContext {
/**
- * How the completion was triggered.
- */
+ * How the completion was triggered.
+ */
int triggerKind = CompletionTriggerKind::TriggerCharacter;
/**
@@ -1906,7 +1906,7 @@ struct GodotNativeClassInfo {
struct GodotCapabilities {
/**
* Native class list
- */
+ */
List<GodotNativeClassInfo> native_classes;
Dictionary to_json() {
diff --git a/modules/gltf/gltf_document.cpp b/modules/gltf/gltf_document.cpp
index 3a8cab7e7e..333fc4637d 100644
--- a/modules/gltf/gltf_document.cpp
+++ b/modules/gltf/gltf_document.cpp
@@ -2498,8 +2498,7 @@ Error GLTFDocument::_parse_meshes(Ref<GLTFState> state) {
ERR_FAIL_COND_V(!d.has("primitives"), ERR_PARSE_ERROR);
Array primitives = d["primitives"];
- const Dictionary &extras = d.has("extras") ? (Dictionary)d["extras"] :
- Dictionary();
+ const Dictionary &extras = d.has("extras") ? (Dictionary)d["extras"] : Dictionary();
Ref<ImporterMesh> import_mesh;
import_mesh.instantiate();
String mesh_name = "mesh";
@@ -5447,7 +5446,7 @@ void GLTFDocument::_convert_multi_mesh_instance_to_gltf(
transform = p_multi_mesh_instance->get_transform() * transform;
} else if (multi_mesh->get_transform_format() == MultiMesh::TRANSFORM_3D) {
transform = p_multi_mesh_instance->get_transform() *
- multi_mesh->get_instance_transform(instance_i);
+ multi_mesh->get_instance_transform(instance_i);
}
Ref<GLTFNode> new_gltf_node;
new_gltf_node.instantiate();
diff --git a/modules/lightmapper_rd/lightmapper_rd.h b/modules/lightmapper_rd/lightmapper_rd.h
index e1657b2069..51ab60fc29 100644
--- a/modules/lightmapper_rd/lightmapper_rd.h
+++ b/modules/lightmapper_rd/lightmapper_rd.h
@@ -73,13 +73,13 @@ class LightmapperRD : public Lightmapper {
bool operator==(const Vertex &p_vtx) const {
return (position[0] == p_vtx.position[0]) &&
- (position[1] == p_vtx.position[1]) &&
- (position[2] == p_vtx.position[2]) &&
- (uv[0] == p_vtx.uv[0]) &&
- (uv[1] == p_vtx.uv[1]) &&
- (normal_xy[0] == p_vtx.normal_xy[0]) &&
- (normal_xy[1] == p_vtx.normal_xy[1]) &&
- (normal_z == p_vtx.normal_z);
+ (position[1] == p_vtx.position[1]) &&
+ (position[2] == p_vtx.position[2]) &&
+ (uv[0] == p_vtx.uv[0]) &&
+ (uv[1] == p_vtx.uv[1]) &&
+ (normal_xy[0] == p_vtx.normal_xy[0]) &&
+ (normal_xy[1] == p_vtx.normal_xy[1]) &&
+ (normal_z == p_vtx.normal_z);
}
};
diff --git a/modules/mono/csharp_script.cpp b/modules/mono/csharp_script.cpp
index 531f600c3f..b85b65e6d9 100644
--- a/modules/mono/csharp_script.cpp
+++ b/modules/mono/csharp_script.cpp
@@ -313,22 +313,22 @@ void CSharpLanguage::get_reserved_words(List<String> *p_words) const {
bool CSharpLanguage::is_control_flow_keyword(String p_keyword) const {
return p_keyword == "break" ||
- p_keyword == "case" ||
- p_keyword == "catch" ||
- p_keyword == "continue" ||
- p_keyword == "default" ||
- p_keyword == "do" ||
- p_keyword == "else" ||
- p_keyword == "finally" ||
- p_keyword == "for" ||
- p_keyword == "foreach" ||
- p_keyword == "goto" ||
- p_keyword == "if" ||
- p_keyword == "return" ||
- p_keyword == "switch" ||
- p_keyword == "throw" ||
- p_keyword == "try" ||
- p_keyword == "while";
+ p_keyword == "case" ||
+ p_keyword == "catch" ||
+ p_keyword == "continue" ||
+ p_keyword == "default" ||
+ p_keyword == "do" ||
+ p_keyword == "else" ||
+ p_keyword == "finally" ||
+ p_keyword == "for" ||
+ p_keyword == "foreach" ||
+ p_keyword == "goto" ||
+ p_keyword == "if" ||
+ p_keyword == "return" ||
+ p_keyword == "switch" ||
+ p_keyword == "throw" ||
+ p_keyword == "try" ||
+ p_keyword == "while";
}
void CSharpLanguage::get_comment_delimiters(List<String> *p_delimiters) const {
@@ -3265,8 +3265,7 @@ ScriptInstance *CSharpScript::instance_create(Object *p_this) {
"Script inherits from native type '" + String(native_name) +
"', so it can't be instantiated in object of type: '" + p_this->get_class() + "'");
}
- ERR_FAIL_V_MSG(nullptr, "Script inherits from native type '" + String(native_name) +
- "', so it can't be instantiated in object of type: '" + p_this->get_class() + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Script inherits from native type '" + String(native_name) + "', so it can't be instantiated in object of type: '" + p_this->get_class() + "'.");
}
}
@@ -3529,10 +3528,10 @@ Error CSharpScript::load_source_code(const String &p_path) {
Error ferr = read_all_file_utf8(p_path, source);
ERR_FAIL_COND_V_MSG(ferr != OK, ferr,
- ferr == ERR_INVALID_DATA ?
- "Script '" + p_path + "' contains invalid unicode (UTF-8), so it was not loaded."
- " Please ensure that scripts are saved in valid UTF-8 unicode." :
- "Failed to read file: '" + p_path + "'.");
+ ferr == ERR_INVALID_DATA
+ ? "Script '" + p_path + "' contains invalid unicode (UTF-8), so it was not loaded."
+ " Please ensure that scripts are saved in valid UTF-8 unicode."
+ : "Failed to read file: '" + p_path + "'.");
#ifdef TOOLS_ENABLED
source_changed_cache = true;
diff --git a/modules/mono/editor/bindings_generator.cpp b/modules/mono/editor/bindings_generator.cpp
index e03c5fd248..148a6796d2 100644
--- a/modules/mono/editor/bindings_generator.cpp
+++ b/modules/mono/editor/bindings_generator.cpp
@@ -365,8 +365,7 @@ String BindingsGenerator::bbcode_to_xml(const String &p_bbcode, const TypeInterf
xml_output.append(link_target);
xml_output.append("</c>");
} else if (link_tag == "enum") {
- StringName search_cname = !target_itype ? target_cname :
- StringName(target_itype->name + "." + (String)target_cname);
+ StringName search_cname = !target_itype ? target_cname : StringName(target_itype->name + "." + (String)target_cname);
const Map<StringName, TypeInterface>::Element *enum_match = enum_types.find(search_cname);
@@ -1524,7 +1523,7 @@ Error BindingsGenerator::_generate_cs_property(const BindingsGenerator::TypeInte
if (getter->return_type.cname != setter_first_arg.type.cname) {
// Special case for Node::set_name
bool whitelisted = getter->return_type.cname == name_cache.type_StringName &&
- setter_first_arg.type.cname == name_cache.type_String;
+ setter_first_arg.type.cname == name_cache.type_String;
ERR_FAIL_COND_V_MSG(!whitelisted, ERR_BUG,
"Return type from getter doesn't match first argument of setter for property: '" +
@@ -2481,29 +2480,29 @@ bool BindingsGenerator::_arg_default_value_is_assignable_to_type(const Variant &
switch (p_val.get_type()) {
case Variant::NIL:
return p_arg_type.is_object_type ||
- name_cache.is_nullable_type(p_arg_type.name);
+ name_cache.is_nullable_type(p_arg_type.name);
case Variant::BOOL:
return p_arg_type.name == name_cache.type_bool;
case Variant::INT:
return p_arg_type.name == name_cache.type_sbyte ||
- p_arg_type.name == name_cache.type_short ||
- p_arg_type.name == name_cache.type_int ||
- p_arg_type.name == name_cache.type_byte ||
- p_arg_type.name == name_cache.type_ushort ||
- p_arg_type.name == name_cache.type_uint ||
- p_arg_type.name == name_cache.type_long ||
- p_arg_type.name == name_cache.type_ulong ||
- p_arg_type.name == name_cache.type_float ||
- p_arg_type.name == name_cache.type_double ||
- p_arg_type.is_enum;
+ p_arg_type.name == name_cache.type_short ||
+ p_arg_type.name == name_cache.type_int ||
+ p_arg_type.name == name_cache.type_byte ||
+ p_arg_type.name == name_cache.type_ushort ||
+ p_arg_type.name == name_cache.type_uint ||
+ p_arg_type.name == name_cache.type_long ||
+ p_arg_type.name == name_cache.type_ulong ||
+ p_arg_type.name == name_cache.type_float ||
+ p_arg_type.name == name_cache.type_double ||
+ p_arg_type.is_enum;
case Variant::FLOAT:
return p_arg_type.name == name_cache.type_float ||
- p_arg_type.name == name_cache.type_double;
+ p_arg_type.name == name_cache.type_double;
case Variant::STRING:
case Variant::STRING_NAME:
return p_arg_type.name == name_cache.type_String ||
- p_arg_type.name == name_cache.type_StringName ||
- p_arg_type.name == name_cache.type_NodePath;
+ p_arg_type.name == name_cache.type_StringName ||
+ p_arg_type.name == name_cache.type_NodePath;
case Variant::NODE_PATH:
return p_arg_type.name == name_cache.type_NodePath;
case Variant::TRANSFORM2D:
@@ -2535,13 +2534,13 @@ bool BindingsGenerator::_arg_default_value_is_assignable_to_type(const Variant &
return p_arg_type.is_object_type;
case Variant::VECTOR2I:
return p_arg_type.name == name_cache.type_Vector2 ||
- p_arg_type.name == Variant::get_type_name(p_val.get_type());
+ p_arg_type.name == Variant::get_type_name(p_val.get_type());
case Variant::RECT2I:
return p_arg_type.name == name_cache.type_Rect2 ||
- p_arg_type.name == Variant::get_type_name(p_val.get_type());
+ p_arg_type.name == Variant::get_type_name(p_val.get_type());
case Variant::VECTOR3I:
return p_arg_type.name == name_cache.type_Vector3 ||
- p_arg_type.name == Variant::get_type_name(p_val.get_type());
+ p_arg_type.name == Variant::get_type_name(p_val.get_type());
default:
CRASH_NOW_MSG("Unexpected Variant type: " + itos(p_val.get_type()));
break;
@@ -2714,7 +2713,7 @@ bool BindingsGenerator::_populate_object_type_interfaces() {
if (itype.cname != name_cache.type_Object || imethod.name != "free") {
WARN_PRINT("Notification: New unexpected virtual non-overridable method found."
" We only expected Object.free, but found '" +
- itype.name + "." + imethod.name + "'.");
+ itype.name + "." + imethod.name + "'.");
}
} else if (return_info.type == Variant::INT && return_info.usage & PROPERTY_USAGE_CLASS_IS_ENUM) {
imethod.return_type.cname = return_info.class_name;
@@ -2723,7 +2722,7 @@ bool BindingsGenerator::_populate_object_type_interfaces() {
imethod.return_type.cname = return_info.class_name;
bool bad_reference_hint = !imethod.is_virtual && return_info.hint != PROPERTY_HINT_RESOURCE_TYPE &&
- ClassDB::is_parent_class(return_info.class_name, name_cache.type_RefCounted);
+ ClassDB::is_parent_class(return_info.class_name, name_cache.type_RefCounted);
ERR_FAIL_COND_V_MSG(bad_reference_hint, false,
String() + "Return type is reference but hint is not '" _STR(PROPERTY_HINT_RESOURCE_TYPE) "'." +
" Are you returning a reference type by pointer? Method: '" + itype.name + "." + imethod.name + "'.");
diff --git a/modules/mono/mono_gd/gd_mono.cpp b/modules/mono/mono_gd/gd_mono.cpp
index 1b1349a3a3..f3e83b26b9 100644
--- a/modules/mono/mono_gd/gd_mono.cpp
+++ b/modules/mono/mono_gd/gd_mono.cpp
@@ -151,7 +151,7 @@ void gd_mono_debug_init() {
if (da_args.length() == 0) {
da_args = String("--debugger-agent=transport=dt_socket,address=127.0.0.1:" + itos(da_port) +
- ",embedding=1,server=y,suspend=" + (da_suspend ? "y,timeout=" + itos(da_timeout) : "n"))
+ ",embedding=1,server=y,suspend=" + (da_suspend ? "y,timeout=" + itos(da_timeout) : "n"))
.utf8();
}
#else
@@ -592,9 +592,9 @@ bool GDMono::load_assembly_from(const String &p_name, const String &p_path, GDMo
ApiAssemblyInfo::Version ApiAssemblyInfo::Version::get_from_loaded_assembly(GDMonoAssembly *p_api_assembly, ApiAssemblyInfo::Type p_api_type) {
ApiAssemblyInfo::Version api_assembly_version;
- const char *nativecalls_name = p_api_type == ApiAssemblyInfo::API_CORE ?
- BINDINGS_CLASS_NATIVECALLS :
- BINDINGS_CLASS_NATIVECALLS_EDITOR;
+ const char *nativecalls_name = p_api_type == ApiAssemblyInfo::API_CORE
+ ? BINDINGS_CLASS_NATIVECALLS
+ : BINDINGS_CLASS_NATIVECALLS_EDITOR;
GDMonoClass *nativecalls_klass = p_api_assembly->get_class(BINDINGS_NAMESPACE, nativecalls_name);
@@ -702,11 +702,11 @@ static bool try_get_cached_api_hash_for(const String &p_api_assemblies_dir, bool
}
r_out_of_sync = GodotSharpBindings::get_bindings_version() != (uint32_t)cfg->get_value("core", "bindings_version") ||
- GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("core", "cs_glue_version") ||
- GodotSharpBindings::get_bindings_version() != (uint32_t)cfg->get_value("editor", "bindings_version") ||
- GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("editor", "cs_glue_version") ||
- GodotSharpBindings::get_core_api_hash() != (uint64_t)cfg->get_value("core", "api_hash") ||
- GodotSharpBindings::get_editor_api_hash() != (uint64_t)cfg->get_value("editor", "api_hash");
+ GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("core", "cs_glue_version") ||
+ GodotSharpBindings::get_bindings_version() != (uint32_t)cfg->get_value("editor", "bindings_version") ||
+ GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("editor", "cs_glue_version") ||
+ GodotSharpBindings::get_core_api_hash() != (uint64_t)cfg->get_value("core", "api_hash") ||
+ GodotSharpBindings::get_editor_api_hash() != (uint64_t)cfg->get_value("editor", "api_hash");
return true;
}
@@ -754,14 +754,10 @@ bool GDMono::_temp_domain_load_are_assemblies_out_of_sync(const String &p_config
}
String GDMono::update_api_assemblies_from_prebuilt(const String &p_config, const bool *p_core_api_out_of_sync, const bool *p_editor_api_out_of_sync) {
-#define FAIL_REASON(m_out_of_sync, m_prebuilt_exists) \
- ( \
- (m_out_of_sync ? \
- String("The assembly is invalidated ") : \
- String("The assembly was not found ")) + \
- (m_prebuilt_exists ? \
- String("and the prebuilt assemblies are missing.") : \
- String("and we failed to copy the prebuilt assemblies.")))
+#define FAIL_REASON(m_out_of_sync, m_prebuilt_exists) \
+ ( \
+ (m_out_of_sync ? String("The assembly is invalidated ") : String("The assembly was not found ")) + \
+ (m_prebuilt_exists ? String("and the prebuilt assemblies are missing.") : String("and we failed to copy the prebuilt assemblies.")))
String dst_assemblies_dir = GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config);
@@ -819,14 +815,14 @@ bool GDMono::_load_core_api_assembly(LoadedApiAssembly &r_loaded_api_assembly, c
// For the editor and the editor player we want to load it from a specific path to make sure we can keep it up to date
// If running the project manager, load it from the prebuilt API directory
- String assembly_dir = !Main::is_project_manager() ?
- GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
- GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
+ String assembly_dir = !Main::is_project_manager()
+ ? GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config)
+ : GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
String assembly_path = assembly_dir.plus_file(CORE_API_ASSEMBLY_NAME ".dll");
bool success = FileAccess::exists(assembly_path) &&
- load_assembly_from(CORE_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
+ load_assembly_from(CORE_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
#else
bool success = load_assembly(CORE_API_ASSEMBLY_NAME, &r_loaded_api_assembly.assembly, p_refonly);
#endif
@@ -834,8 +830,8 @@ bool GDMono::_load_core_api_assembly(LoadedApiAssembly &r_loaded_api_assembly, c
if (success) {
ApiAssemblyInfo::Version api_assembly_ver = ApiAssemblyInfo::Version::get_from_loaded_assembly(r_loaded_api_assembly.assembly, ApiAssemblyInfo::API_CORE);
r_loaded_api_assembly.out_of_sync = GodotSharpBindings::get_core_api_hash() != api_assembly_ver.godot_api_hash ||
- GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
- GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
+ GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
+ GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
} else {
r_loaded_api_assembly.out_of_sync = false;
}
@@ -852,20 +848,20 @@ bool GDMono::_load_editor_api_assembly(LoadedApiAssembly &r_loaded_api_assembly,
// For the editor and the editor player we want to load it from a specific path to make sure we can keep it up to date
// If running the project manager, load it from the prebuilt API directory
- String assembly_dir = !Main::is_project_manager() ?
- GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
- GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
+ String assembly_dir = !Main::is_project_manager()
+ ? GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config)
+ : GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
String assembly_path = assembly_dir.plus_file(EDITOR_API_ASSEMBLY_NAME ".dll");
bool success = FileAccess::exists(assembly_path) &&
- load_assembly_from(EDITOR_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
+ load_assembly_from(EDITOR_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
if (success) {
ApiAssemblyInfo::Version api_assembly_ver = ApiAssemblyInfo::Version::get_from_loaded_assembly(r_loaded_api_assembly.assembly, ApiAssemblyInfo::API_EDITOR);
r_loaded_api_assembly.out_of_sync = GodotSharpBindings::get_editor_api_hash() != api_assembly_ver.godot_api_hash ||
- GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
- GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
+ GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
+ GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
} else {
r_loaded_api_assembly.out_of_sync = false;
}
@@ -985,7 +981,7 @@ bool GDMono::_load_tools_assemblies() {
}
bool success = load_assembly(TOOLS_ASM_NAME, &tools_assembly) &&
- load_assembly(TOOLS_PROJECT_EDITOR_ASM_NAME, &tools_project_editor_assembly);
+ load_assembly(TOOLS_PROJECT_EDITOR_ASM_NAME, &tools_project_editor_assembly);
return success;
}
@@ -1363,8 +1359,8 @@ int32_t GodotSharp::get_scripts_domain_id() {
bool GodotSharp::is_scripts_domain_loaded() {
return GDMono::get_singleton() != nullptr &&
- GDMono::get_singleton()->is_runtime_initialized() &&
- GDMono::get_singleton()->get_scripts_domain() != nullptr;
+ GDMono::get_singleton()->is_runtime_initialized() &&
+ GDMono::get_singleton()->get_scripts_domain() != nullptr;
}
bool GodotSharp::_is_domain_finalizing_for_unload(int32_t p_domain_id) {
diff --git a/modules/mono/mono_gd/gd_mono.h b/modules/mono/mono_gd/gd_mono.h
index 4170e5053f..a18fa6c6b4 100644
--- a/modules/mono/mono_gd/gd_mono.h
+++ b/modules/mono/mono_gd/gd_mono.h
@@ -54,8 +54,8 @@ struct Version {
bool operator==(const Version &p_other) const {
return godot_api_hash == p_other.godot_api_hash &&
- bindings_version == p_other.bindings_version &&
- cs_glue_version == p_other.cs_glue_version;
+ bindings_version == p_other.bindings_version &&
+ cs_glue_version == p_other.cs_glue_version;
}
Version() {}
diff --git a/modules/mono/mono_gd/gd_mono_class.cpp b/modules/mono/mono_gd/gd_mono_class.cpp
index 27b4ac7fa7..4f4480fa49 100644
--- a/modules/mono/mono_gd/gd_mono_class.cpp
+++ b/modules/mono/mono_gd/gd_mono_class.cpp
@@ -187,7 +187,7 @@ void GDMonoClass::fetch_methods_with_godot_api_checks(GDMonoClass *p_native_base
#ifdef DEBUG_ENABLED
String fullname = method->get_ret_type_full_name() + " " + name + "(" + method->get_signature_desc(true) + ")";
WARN_PRINT("Method '" + fullname + "' is hidden by Godot API method. Should be '" +
- method->get_full_name_no_class() + "'. In class '" + namespace_name + "." + class_name + "'.");
+ method->get_full_name_no_class() + "'. In class '" + namespace_name + "." + class_name + "'.");
#endif
continue;
}
@@ -205,7 +205,7 @@ void GDMonoClass::fetch_methods_with_godot_api_checks(GDMonoClass *p_native_base
// found
String fullname = m->get_ret_type_full_name() + " " + name + "(" + m->get_signature_desc(true) + ")";
WARN_PRINT("Method '" + fullname + "' should be '" + m->get_full_name_no_class() +
- "'. In class '" + namespace_name + "." + class_name + "'.");
+ "'. In class '" + namespace_name + "." + class_name + "'.");
break;
}
diff --git a/modules/mono/mono_gd/gd_mono_marshal.cpp b/modules/mono/mono_gd/gd_mono_marshal.cpp
index 1904634132..6b395303dd 100644
--- a/modules/mono/mono_gd/gd_mono_marshal.cpp
+++ b/modules/mono/mono_gd/gd_mono_marshal.cpp
@@ -398,8 +398,7 @@ MonoArray *variant_to_mono_array(const Variant &p_var, GDMonoClass *p_type_class
return Array_to_mono_array(p_var.operator ::Array(), array_type->eklass);
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to array of unsupported element type:" +
- GDMonoClass::get_full_name(array_type->eklass) + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to array of unsupported element type:" + GDMonoClass::get_full_name(array_type->eklass) + "'.");
}
MonoObject *variant_to_mono_object_of_class(const Variant &p_var, GDMonoClass *p_type_class) {
@@ -432,8 +431,7 @@ MonoObject *variant_to_mono_object_of_class(const Variant &p_var, GDMonoClass *p
return GDMonoUtils::create_managed_from(p_var.operator Array(), CACHED_CLASS(Array));
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type: '" +
- p_type_class->get_full_name() + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type: '" + p_type_class->get_full_name() + "'.");
}
MonoObject *variant_to_mono_object_of_genericinst(const Variant &p_var, GDMonoClass *p_type_class) {
@@ -488,8 +486,7 @@ MonoObject *variant_to_mono_object_of_genericinst(const Variant &p_var, GDMonoCl
return GDMonoUtils::unmanaged_get_managed(p_var.operator Object *());
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported generic type: '" +
- p_type_class->get_full_name() + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported generic type: '" + p_type_class->get_full_name() + "'.");
}
MonoObject *variant_to_mono_object(const Variant &p_var) {
@@ -824,14 +821,12 @@ void *variant_to_managed_unboxed(const Variant &p_var, const ManagedType &p_type
RETURN_TYPE_VAL(uint64_t, val);
}
default: {
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" +
- GDMonoClass::get_full_name(mono_class_from_mono_type(enum_basetype)) + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" + GDMonoClass::get_full_name(mono_class_from_mono_type(enum_basetype)) + "'.");
}
}
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" +
- p_type.type_class->get_full_name() + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" + p_type.type_class->get_full_name() + "'.");
} break;
#undef RETURN_TYPE_VAL
case MONO_TYPE_STRING:
@@ -847,8 +842,7 @@ void *variant_to_managed_unboxed(const Variant &p_var, const ManagedType &p_type
return variant_to_mono_object(p_var);
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " +
- itos(p_type.type_encoding) + ".");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " + itos(p_type.type_encoding) + ".");
}
MonoObject *variant_to_mono_object(const Variant &p_var, const ManagedType &p_type) {
@@ -981,14 +975,12 @@ MonoObject *variant_to_mono_object(const Variant &p_var, const ManagedType &p_ty
return BOX_ENUM(enum_baseclass, val);
}
default: {
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" +
- GDMonoClass::get_full_name(enum_baseclass) + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" + GDMonoClass::get_full_name(enum_baseclass) + "'.");
}
}
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" +
- p_type.type_class->get_full_name() + "'.");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" + p_type.type_class->get_full_name() + "'.");
} break;
case MONO_TYPE_STRING:
return (MonoObject *)variant_to_mono_string(p_var);
@@ -1003,8 +995,7 @@ MonoObject *variant_to_mono_object(const Variant &p_var, const ManagedType &p_ty
return variant_to_mono_object(p_var);
}
- ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " +
- itos(p_type.type_encoding) + ".");
+ ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " + itos(p_type.type_encoding) + ".");
}
Variant mono_object_to_variant_impl(MonoObject *p_obj, const ManagedType &p_type, bool p_fail_with_err = true) {
@@ -1271,8 +1262,7 @@ Variant mono_object_to_variant_impl(MonoObject *p_obj, const ManagedType &p_type
}
if (p_fail_with_err) {
- ERR_FAIL_V_MSG(Variant(), "Attempted to convert an unmarshallable managed type to Variant. Name: '" +
- p_type.type_class->get_name() + "' Encoding: " + itos(p_type.type_encoding) + ".");
+ ERR_FAIL_V_MSG(Variant(), "Attempted to convert an unmarshallable managed type to Variant. Name: '" + p_type.type_class->get_name() + "' Encoding: " + itos(p_type.type_encoding) + ".");
} else {
return Variant();
}
@@ -1332,7 +1322,7 @@ String mono_object_to_variant_string(MonoObject *p_obj, MonoException **r_exc) {
MonoObject *Dictionary_to_system_generic_dict(const Dictionary &p_dict, GDMonoClass *p_class, MonoReflectionType *p_key_reftype, MonoReflectionType *p_value_reftype) {
String ctor_desc = ":.ctor(System.Collections.Generic.IDictionary`2<" + GDMonoUtils::get_type_desc(p_key_reftype) +
- ", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
+ ", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
GDMonoMethod *ctor = p_class->get_method_with_desc(ctor_desc, true);
CRASH_COND(ctor == nullptr);
@@ -1354,7 +1344,7 @@ MonoObject *Dictionary_to_system_generic_dict(const Dictionary &p_dict, GDMonoCl
Dictionary system_generic_dict_to_Dictionary(MonoObject *p_obj, [[maybe_unused]] GDMonoClass *p_class, MonoReflectionType *p_key_reftype, MonoReflectionType *p_value_reftype) {
GDMonoClass *godot_dict_class = GDMonoUtils::Marshal::make_generic_dictionary_type(p_key_reftype, p_value_reftype);
String ctor_desc = ":.ctor(System.Collections.Generic.IDictionary`2<" + GDMonoUtils::get_type_desc(p_key_reftype) +
- ", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
+ ", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
GDMonoMethod *godot_dict_ctor = godot_dict_class->get_method_with_desc(ctor_desc, true);
CRASH_COND(godot_dict_ctor == nullptr);
@@ -1746,12 +1736,12 @@ Callable managed_to_callable(const M_Callable &p_managed_callable) {
CallableCustom *managed_callable = memnew(ManagedCallable(p_managed_callable.delegate));
return Callable(managed_callable);
} else {
- Object *target = p_managed_callable.target ?
- unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_callable.target)) :
- nullptr;
- StringName *method_ptr = p_managed_callable.method_string_name ?
- unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_callable.method_string_name)) :
- nullptr;
+ Object *target = p_managed_callable.target
+ ? unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_callable.target))
+ : nullptr;
+ StringName *method_ptr = p_managed_callable.method_string_name
+ ? unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_callable.method_string_name))
+ : nullptr;
StringName method = method_ptr ? *method_ptr : StringName();
return Callable(target, method);
}
@@ -1794,12 +1784,12 @@ M_Callable callable_to_managed(const Callable &p_callable) {
}
Signal managed_to_signal_info(const M_SignalInfo &p_managed_signal) {
- Object *owner = p_managed_signal.owner ?
- unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_signal.owner)) :
- nullptr;
- StringName *name_ptr = p_managed_signal.name_string_name ?
- unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_signal.name_string_name)) :
- nullptr;
+ Object *owner = p_managed_signal.owner
+ ? unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_signal.owner))
+ : nullptr;
+ StringName *name_ptr = p_managed_signal.name_string_name
+ ? unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_signal.name_string_name))
+ : nullptr;
StringName name = name_ptr ? *name_ptr : StringName();
return Signal(owner, name);
}
diff --git a/modules/mono/mono_gd/gd_mono_marshal.h b/modules/mono/mono_gd/gd_mono_marshal.h
index 88afc7ebc5..2f4b619b61 100644
--- a/modules/mono/mono_gd/gd_mono_marshal.h
+++ b/modules/mono/mono_gd/gd_mono_marshal.h
@@ -234,58 +234,58 @@ enum {
#endif
MATCHES_Vector2 = (MATCHES_real_t && (sizeof(Vector2) == (sizeof(real_t) * 2)) &&
- offsetof(Vector2, x) == (sizeof(real_t) * 0) &&
- offsetof(Vector2, y) == (sizeof(real_t) * 1)),
+ offsetof(Vector2, x) == (sizeof(real_t) * 0) &&
+ offsetof(Vector2, y) == (sizeof(real_t) * 1)),
MATCHES_Vector2i = (MATCHES_int && (sizeof(Vector2i) == (sizeof(int32_t) * 2)) &&
- offsetof(Vector2i, x) == (sizeof(int32_t) * 0) &&
- offsetof(Vector2i, y) == (sizeof(int32_t) * 1)),
+ offsetof(Vector2i, x) == (sizeof(int32_t) * 0) &&
+ offsetof(Vector2i, y) == (sizeof(int32_t) * 1)),
MATCHES_Rect2 = (MATCHES_Vector2 && (sizeof(Rect2) == (sizeof(Vector2) * 2)) &&
- offsetof(Rect2, position) == (sizeof(Vector2) * 0) &&
- offsetof(Rect2, size) == (sizeof(Vector2) * 1)),
+ offsetof(Rect2, position) == (sizeof(Vector2) * 0) &&
+ offsetof(Rect2, size) == (sizeof(Vector2) * 1)),
MATCHES_Rect2i = (MATCHES_Vector2i && (sizeof(Rect2i) == (sizeof(Vector2i) * 2)) &&
- offsetof(Rect2i, position) == (sizeof(Vector2i) * 0) &&
- offsetof(Rect2i, size) == (sizeof(Vector2i) * 1)),
+ offsetof(Rect2i, position) == (sizeof(Vector2i) * 0) &&
+ offsetof(Rect2i, size) == (sizeof(Vector2i) * 1)),
MATCHES_Transform2D = (MATCHES_Vector2 && (sizeof(Transform2D) == (sizeof(Vector2) * 3))), // No field offset required, it stores an array
MATCHES_Vector3 = (MATCHES_real_t && (sizeof(Vector3) == (sizeof(real_t) * 3)) &&
- offsetof(Vector3, x) == (sizeof(real_t) * 0) &&
- offsetof(Vector3, y) == (sizeof(real_t) * 1) &&
- offsetof(Vector3, z) == (sizeof(real_t) * 2)),
+ offsetof(Vector3, x) == (sizeof(real_t) * 0) &&
+ offsetof(Vector3, y) == (sizeof(real_t) * 1) &&
+ offsetof(Vector3, z) == (sizeof(real_t) * 2)),
MATCHES_Vector3i = (MATCHES_int && (sizeof(Vector3i) == (sizeof(int32_t) * 3)) &&
- offsetof(Vector3i, x) == (sizeof(int32_t) * 0) &&
- offsetof(Vector3i, y) == (sizeof(int32_t) * 1) &&
- offsetof(Vector3i, z) == (sizeof(int32_t) * 2)),
+ offsetof(Vector3i, x) == (sizeof(int32_t) * 0) &&
+ offsetof(Vector3i, y) == (sizeof(int32_t) * 1) &&
+ offsetof(Vector3i, z) == (sizeof(int32_t) * 2)),
MATCHES_Basis = (MATCHES_Vector3 && (sizeof(Basis) == (sizeof(Vector3) * 3))), // No field offset required, it stores an array
MATCHES_Quaternion = (MATCHES_real_t && (sizeof(Quaternion) == (sizeof(real_t) * 4)) &&
- offsetof(Quaternion, x) == (sizeof(real_t) * 0) &&
- offsetof(Quaternion, y) == (sizeof(real_t) * 1) &&
- offsetof(Quaternion, z) == (sizeof(real_t) * 2) &&
- offsetof(Quaternion, w) == (sizeof(real_t) * 3)),
+ offsetof(Quaternion, x) == (sizeof(real_t) * 0) &&
+ offsetof(Quaternion, y) == (sizeof(real_t) * 1) &&
+ offsetof(Quaternion, z) == (sizeof(real_t) * 2) &&
+ offsetof(Quaternion, w) == (sizeof(real_t) * 3)),
MATCHES_Transform3D = (MATCHES_Basis && MATCHES_Vector3 && (sizeof(Transform3D) == (sizeof(Basis) + sizeof(Vector3))) &&
- offsetof(Transform3D, basis) == 0 &&
- offsetof(Transform3D, origin) == sizeof(Basis)),
+ offsetof(Transform3D, basis) == 0 &&
+ offsetof(Transform3D, origin) == sizeof(Basis)),
MATCHES_AABB = (MATCHES_Vector3 && (sizeof(AABB) == (sizeof(Vector3) * 2)) &&
- offsetof(AABB, position) == (sizeof(Vector3) * 0) &&
- offsetof(AABB, size) == (sizeof(Vector3) * 1)),
+ offsetof(AABB, position) == (sizeof(Vector3) * 0) &&
+ offsetof(AABB, size) == (sizeof(Vector3) * 1)),
MATCHES_Color = (MATCHES_float && (sizeof(Color) == (sizeof(float) * 4)) &&
- offsetof(Color, r) == (sizeof(float) * 0) &&
- offsetof(Color, g) == (sizeof(float) * 1) &&
- offsetof(Color, b) == (sizeof(float) * 2) &&
- offsetof(Color, a) == (sizeof(float) * 3)),
+ offsetof(Color, r) == (sizeof(float) * 0) &&
+ offsetof(Color, g) == (sizeof(float) * 1) &&
+ offsetof(Color, b) == (sizeof(float) * 2) &&
+ offsetof(Color, a) == (sizeof(float) * 3)),
MATCHES_Plane = (MATCHES_Vector3 && MATCHES_real_t && (sizeof(Plane) == (sizeof(Vector3) + sizeof(real_t))) &&
- offsetof(Plane, normal) == 0 &&
- offsetof(Plane, d) == sizeof(Vector3))
+ offsetof(Plane, normal) == 0 &&
+ offsetof(Plane, d) == sizeof(Vector3))
};
// In the future we may force this if we want to ref return these structs
diff --git a/modules/mono/mono_gd/gd_mono_wasm_m2n.h b/modules/mono/mono_gd/gd_mono_wasm_m2n.h
index 366662ff81..c49a62a632 100644
--- a/modules/mono/mono_gd/gd_mono_wasm_m2n.h
+++ b/modules/mono/mono_gd/gd_mono_wasm_m2n.h
@@ -158,7 +158,7 @@ T m2n_arg_cast(Mono_InterpMethodArguments *p_margs, size_t p_idx) {
return (T)(size_t)p_margs->iargs[p_idx];
} else if constexpr (cookie == 'L') {
static_assert(std::is_same_v<T, int64_t> || std::is_same_v<T, uint64_t> ||
- (sizeof(void *) == 8 && std::is_pointer_v<T>),
+ (sizeof(void *) == 8 && std::is_pointer_v<T>),
"Invalid type for cookie 'L'.");
union {
diff --git a/modules/mono/utils/string_utils.cpp b/modules/mono/utils/string_utils.cpp
index 2fb5e446da..6fdb5079ce 100644
--- a/modules/mono/utils/string_utils.cpp
+++ b/modules/mono/utils/string_utils.cpp
@@ -139,24 +139,24 @@ bool is_csharp_keyword(const String &p_name) {
// Reserved keywords
return p_name == "abstract" || p_name == "as" || p_name == "base" || p_name == "bool" ||
- p_name == "break" || p_name == "byte" || p_name == "case" || p_name == "catch" ||
- p_name == "char" || p_name == "checked" || p_name == "class" || p_name == "const" ||
- p_name == "continue" || p_name == "decimal" || p_name == "default" || p_name == "delegate" ||
- p_name == "do" || p_name == "double" || p_name == "else" || p_name == "enum" ||
- p_name == "event" || p_name == "explicit" || p_name == "extern" || p_name == "false" ||
- p_name == "finally" || p_name == "fixed" || p_name == "float" || p_name == "for" ||
- p_name == "forech" || p_name == "goto" || p_name == "if" || p_name == "implicit" ||
- p_name == "in" || p_name == "int" || p_name == "interface" || p_name == "internal" ||
- p_name == "is" || p_name == "lock" || p_name == "long" || p_name == "namespace" ||
- p_name == "new" || p_name == "null" || p_name == "object" || p_name == "operator" ||
- p_name == "out" || p_name == "override" || p_name == "params" || p_name == "private" ||
- p_name == "protected" || p_name == "public" || p_name == "readonly" || p_name == "ref" ||
- p_name == "return" || p_name == "sbyte" || p_name == "sealed" || p_name == "short" ||
- p_name == "sizeof" || p_name == "stackalloc" || p_name == "static" || p_name == "string" ||
- p_name == "struct" || p_name == "switch" || p_name == "this" || p_name == "throw" ||
- p_name == "true" || p_name == "try" || p_name == "typeof" || p_name == "uint" || p_name == "ulong" ||
- p_name == "unchecked" || p_name == "unsafe" || p_name == "ushort" || p_name == "using" ||
- p_name == "virtual" || p_name == "volatile" || p_name == "void" || p_name == "while";
+ p_name == "break" || p_name == "byte" || p_name == "case" || p_name == "catch" ||
+ p_name == "char" || p_name == "checked" || p_name == "class" || p_name == "const" ||
+ p_name == "continue" || p_name == "decimal" || p_name == "default" || p_name == "delegate" ||
+ p_name == "do" || p_name == "double" || p_name == "else" || p_name == "enum" ||
+ p_name == "event" || p_name == "explicit" || p_name == "extern" || p_name == "false" ||
+ p_name == "finally" || p_name == "fixed" || p_name == "float" || p_name == "for" ||
+ p_name == "forech" || p_name == "goto" || p_name == "if" || p_name == "implicit" ||
+ p_name == "in" || p_name == "int" || p_name == "interface" || p_name == "internal" ||
+ p_name == "is" || p_name == "lock" || p_name == "long" || p_name == "namespace" ||
+ p_name == "new" || p_name == "null" || p_name == "object" || p_name == "operator" ||
+ p_name == "out" || p_name == "override" || p_name == "params" || p_name == "private" ||
+ p_name == "protected" || p_name == "public" || p_name == "readonly" || p_name == "ref" ||
+ p_name == "return" || p_name == "sbyte" || p_name == "sealed" || p_name == "short" ||
+ p_name == "sizeof" || p_name == "stackalloc" || p_name == "static" || p_name == "string" ||
+ p_name == "struct" || p_name == "switch" || p_name == "this" || p_name == "throw" ||
+ p_name == "true" || p_name == "try" || p_name == "typeof" || p_name == "uint" || p_name == "ulong" ||
+ p_name == "unchecked" || p_name == "unsafe" || p_name == "ushort" || p_name == "using" ||
+ p_name == "virtual" || p_name == "volatile" || p_name == "void" || p_name == "while";
}
String escape_csharp_keyword(const String &p_name) {
diff --git a/modules/pvr/texture_loader_pvr.cpp b/modules/pvr/texture_loader_pvr.cpp
index cb12976090..ffa900ef99 100644
--- a/modules/pvr/texture_loader_pvr.cpp
+++ b/modules/pvr/texture_loader_pvr.cpp
@@ -390,15 +390,15 @@ static void get_modulation_value(int x, int y, const int p_2bit, const int p_mod
rep_vals0[p_modulation[y + 1][x]] +
rep_vals0[p_modulation[y][x - 1]] +
rep_vals0[p_modulation[y][x + 1]] + 2) /
- 4;
+ 4;
} else if (p_modulation_modes[y][x] == 2) {
mod_val = (rep_vals0[p_modulation[y][x - 1]] +
rep_vals0[p_modulation[y][x + 1]] + 1) /
- 2;
+ 2;
} else {
mod_val = (rep_vals0[p_modulation[y - 1][x]] +
rep_vals0[p_modulation[y + 1][x]] + 1) /
- 2;
+ 2;
}
} else {
mod_val = rep_vals1[p_modulation[y][x]];
diff --git a/modules/upnp/upnp.cpp b/modules/upnp/upnp.cpp
index efe618012a..0e51822b01 100644
--- a/modules/upnp/upnp.cpp
+++ b/modules/upnp/upnp.cpp
@@ -37,10 +37,10 @@
bool UPNP::is_common_device(const String &dev) const {
return dev.is_empty() ||
- dev.find("InternetGatewayDevice") >= 0 ||
- dev.find("WANIPConnection") >= 0 ||
- dev.find("WANPPPConnection") >= 0 ||
- dev.find("rootdevice") >= 0;
+ dev.find("InternetGatewayDevice") >= 0 ||
+ dev.find("WANIPConnection") >= 0 ||
+ dev.find("WANPPPConnection") >= 0 ||
+ dev.find("rootdevice") >= 0;
}
int UPNP::discover(int timeout, int ttl, const String &device_filter) {
diff --git a/modules/visual_script/visual_script.cpp b/modules/visual_script/visual_script.cpp
index 8f4e807295..01fc7cfca0 100644
--- a/modules/visual_script/visual_script.cpp
+++ b/modules/visual_script/visual_script.cpp
@@ -2370,7 +2370,6 @@ void VisualScriptLanguage::debug_get_stack_level_locals(int p_level, List<String
const StringName *f = _call_stack[l].function;
ERR_FAIL_COND(!_call_stack[l].instance->functions.has(*f));
- //VisualScriptInstance::Function *func = &_call_stack[l].instance->functions[*f];
VisualScriptNodeInstance *node = _call_stack[l].instance->instances[*_call_stack[l].current_id];
ERR_FAIL_COND(!node);
@@ -2416,21 +2415,6 @@ void VisualScriptLanguage::debug_get_stack_level_locals(int p_level, List<String
p_locals->push_back("working_mem/mem_" + itos(i));
p_values->push_back((*_call_stack[l].work_mem)[i]);
}
-
- /*
- ERR_FAIL_INDEX(p_level,_debug_call_stack_pos);
-
-
- VisualFunction *f = _call_stack[l].function;
-
- List<Pair<StringName,int> > locals;
-
- f->debug_get_stack_member_state(*_call_stack[l].line,&locals);
- for( List<Pair<StringName,int> >::Element *E = locals.front();E;E=E->next() ) {
- p_locals->push_back(E->get().first);
- p_values->push_back(_call_stack[l].stack[E->get().second]);
- }
-*/
}
void VisualScriptLanguage::debug_get_stack_level_members(int p_level, List<String> *p_members, List<Variant> *p_values, int p_max_subitems, int p_max_depth) {
diff --git a/modules/visual_script/visual_script_editor.cpp b/modules/visual_script/visual_script_editor.cpp
index d73b8d3ca0..b23374bfb1 100644
--- a/modules/visual_script/visual_script_editor.cpp
+++ b/modules/visual_script/visual_script_editor.cpp
@@ -3417,7 +3417,7 @@ void VisualScriptEditor::connect_seq(Ref<VisualScriptNode> vnode_old, Ref<Visual
undo_redo->add_do_method(script.ptr(), "sequence_connect", port_action_node, pass_port, new_id);
undo_redo->add_undo_method(script.ptr(), "sequence_disconnect", port_action_node, pass_port, new_id);
} else if (vnode_old->get_output_value_port_info(port_action_output).name == String("return") &&
- !script->get_output_sequence_ports_connected(port_action_node).has(return_port)) {
+ !script->get_output_sequence_ports_connected(port_action_node).has(return_port)) {
undo_redo->add_do_method(script.ptr(), "sequence_connect", port_action_node, return_port, new_id);
undo_redo->add_undo_method(script.ptr(), "sequence_disconnect", port_action_node, return_port, new_id);
} else {
diff --git a/platform/android/android_keys_utils.h b/platform/android/android_keys_utils.h
index 6d25a366a4..de6f48d33a 100644
--- a/platform/android/android_keys_utils.h
+++ b/platform/android/android_keys_utils.h
@@ -133,28 +133,28 @@ static _WinTranslatePair _ak_to_keycode[] = {
};
/*
TODO: map these android key:
- AKEYCODE_SOFT_LEFT = 1,
- AKEYCODE_SOFT_RIGHT = 2,
- AKEYCODE_CALL = 5,
- AKEYCODE_ENDCALL = 6,
- AKEYCODE_STAR = 17,
- AKEYCODE_POUND = 18,
- AKEYCODE_POWER = 26,
- AKEYCODE_CAMERA = 27,
- AKEYCODE_CLEAR = 28,
- AKEYCODE_SYM = 63,
- AKEYCODE_ENVELOPE = 65,
- AKEYCODE_GRAVE = 68,
- AKEYCODE_SEMICOLON = 74,
- AKEYCODE_APOSTROPHE = 75,
- AKEYCODE_AT = 77,
- AKEYCODE_NUM = 78,
- AKEYCODE_HEADSETHOOK = 79,
- AKEYCODE_FOCUS = 80, // *Camera* focus
- AKEYCODE_NOTIFICATION = 83,
- AKEYCODE_SEARCH = 84,
- AKEYCODE_PICTSYMBOLS = 94,
- AKEYCODE_SWITCH_CHARSET = 95,
+ AKEYCODE_SOFT_LEFT = 1,
+ AKEYCODE_SOFT_RIGHT = 2,
+ AKEYCODE_CALL = 5,
+ AKEYCODE_ENDCALL = 6,
+ AKEYCODE_STAR = 17,
+ AKEYCODE_POUND = 18,
+ AKEYCODE_POWER = 26,
+ AKEYCODE_CAMERA = 27,
+ AKEYCODE_CLEAR = 28,
+ AKEYCODE_SYM = 63,
+ AKEYCODE_ENVELOPE = 65,
+ AKEYCODE_GRAVE = 68,
+ AKEYCODE_SEMICOLON = 74,
+ AKEYCODE_APOSTROPHE = 75,
+ AKEYCODE_AT = 77,
+ AKEYCODE_NUM = 78,
+ AKEYCODE_HEADSETHOOK = 79,
+ AKEYCODE_FOCUS = 80, // *Camera* focus
+ AKEYCODE_NOTIFICATION = 83,
+ AKEYCODE_SEARCH = 84,
+ AKEYCODE_PICTSYMBOLS = 94,
+ AKEYCODE_SWITCH_CHARSET = 95,
*/
unsigned int android_get_keysym(unsigned int p_code);
diff --git a/platform/android/export/export_plugin.cpp b/platform/android/export/export_plugin.cpp
index 6ef17faf06..aa1aa4d264 100644
--- a/platform/android/export/export_plugin.cpp
+++ b/platform/android/export/export_plugin.cpp
@@ -498,11 +498,11 @@ bool EditorExportPlatformAndroid::is_package_name_valid(const String &p_package,
bool EditorExportPlatformAndroid::_should_compress_asset(const String &p_path, const Vector<uint8_t> &p_data) {
/*
- * By not compressing files with little or not benefit in doing so,
- * a performance gain is expected attime. Moreover, if the APK is
- * zip-aligned, assets stored as they are can be efficiently read by
- * Android by memory-mapping them.
- */
+ * By not compressing files with little or not benefit in doing so,
+ * a performance gain is expected attime. Moreover, if the APK is
+ * zip-aligned, assets stored as they are can be efficiently read by
+ * Android by memory-mapping them.
+ */
// -- Unconditional uncompress to mimic AAPT plus some other
@@ -851,16 +851,11 @@ void EditorExportPlatformAndroid::_fix_manifest(const Ref<EditorExportPreset> &p
int iofs = ofs + 8;
string_count = decode_uint32(&p_manifest[iofs]);
- //styles_count = decode_uint32(&p_manifest[iofs + 4]);
+ // iofs + 4 is `styles_count`.
string_flags = decode_uint32(&p_manifest[iofs + 8]);
string_data_offset = decode_uint32(&p_manifest[iofs + 12]);
- //styles_offset = decode_uint32(&p_manifest[iofs + 16]);
- /*
- printf("string count: %i\n",string_count);
- printf("flags: %i\n",string_flags);
- printf("sdata ofs: %i\n",string_data_offset);
- printf("styles ofs: %i\n",styles_offset);
- */
+ // iofs + 16 is `styles_offset`.
+
uint32_t st_offset = iofs + 20;
string_table.resize(string_count);
uint32_t string_end = 0;
diff --git a/platform/android/export/godot_plugin_config.cpp b/platform/android/export/godot_plugin_config.cpp
index ba7b8ce6c7..205cba3350 100644
--- a/platform/android/export/godot_plugin_config.cpp
+++ b/platform/android/export/godot_plugin_config.cpp
@@ -78,14 +78,13 @@ Vector<PluginConfigAndroid> PluginConfigAndroid::get_prebuilt_plugins(String plu
bool PluginConfigAndroid::is_plugin_config_valid(PluginConfigAndroid plugin_config) {
bool valid_name = !plugin_config.name.is_empty();
bool valid_binary_type = plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_LOCAL ||
- plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE;
+ plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE;
bool valid_binary = false;
if (valid_binary_type) {
valid_binary = !plugin_config.binary.is_empty() &&
- (plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE ||
-
- FileAccess::exists(plugin_config.binary));
+ (plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE ||
+ FileAccess::exists(plugin_config.binary));
}
bool valid_local_dependencies = true;
diff --git a/platform/android/export/gradle_export_util.cpp b/platform/android/export/gradle_export_util.cpp
index 311614234a..b0d623827e 100644
--- a/platform/android/export/gradle_export_util.cpp
+++ b/platform/android/export/gradle_export_util.cpp
@@ -191,7 +191,7 @@ String bool_to_string(bool v) {
String _get_gles_tag() {
bool min_gles3 = ProjectSettings::get_singleton()->get("rendering/driver/driver_name") == "GLES3" &&
- !ProjectSettings::get_singleton()->get("rendering/driver/fallback_to_gles2");
+ !ProjectSettings::get_singleton()->get("rendering/driver/fallback_to_gles2");
return min_gles3 ? " <uses-feature android:glEsVersion=\"0x00030000\" android:required=\"true\" />\n" : "";
}
diff --git a/platform/android/java/lib/src/org/godotengine/godot/Godot.java b/platform/android/java/lib/src/org/godotengine/godot/Godot.java
index 70bc73b9ad..5de092ee7e 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/Godot.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/Godot.java
@@ -578,8 +578,7 @@ public class Godot extends Fragment implements SensorEventListener, IDownloaderC
if (!pack_valid) {
Intent notifierIntent = new Intent(activity, activity.getClass());
- notifierIntent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK |
- Intent.FLAG_ACTIVITY_CLEAR_TOP);
+ notifierIntent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK | Intent.FLAG_ACTIVITY_CLEAR_TOP);
PendingIntent pendingIntent = PendingIntent.getActivity(activity, 0,
notifierIntent, PendingIntent.FLAG_UPDATE_CURRENT);
diff --git a/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java b/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java
index d33faab641..09337ef989 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java
@@ -50,9 +50,9 @@ public class GodotDownloaderService extends DownloaderService {
};
/**
- * This public key comes from your Android Market publisher account, and it
- * used by the LVL to validate responses from Market on your behalf.
- */
+ * This public key comes from your Android Market publisher account, and it
+ * used by the LVL to validate responses from Market on your behalf.
+ */
@Override
public String getPublicKey() {
SharedPreferences prefs = getApplicationContext().getSharedPreferences("app_data_keys", Context.MODE_PRIVATE);
@@ -63,20 +63,20 @@ public class GodotDownloaderService extends DownloaderService {
}
/**
- * This is used by the preference obfuscater to make sure that your
- * obfuscated preferences are different than the ones used by other
- * applications.
- */
+ * This is used by the preference obfuscater to make sure that your
+ * obfuscated preferences are different than the ones used by other
+ * applications.
+ */
@Override
public byte[] getSALT() {
return SALT;
}
/**
- * Fill this in with the class name for your alarm receiver. We do this
- * because receivers must be unique across all of Android (it's a good idea
- * to make sure that your receiver is in your unique package)
- */
+ * Fill this in with the class name for your alarm receiver. We do this
+ * because receivers must be unique across all of Android (it's a good idea
+ * to make sure that your receiver is in your unique package)
+ */
@Override
public String getAlarmReceiverClassName() {
Log.d("GODOT", "getAlarmReceiverClassName()");
diff --git a/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java b/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
index a9d45c943b..32aad8dc4f 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
@@ -210,16 +210,16 @@ public class GodotGLRenderView extends GLSurfaceView implements GodotRenderView
*/
if (GLUtils.use_32) {
- setEGLConfigChooser(translucent ?
- new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
- new RegularConfigChooser(8, 8, 8, 8, 16, stencil)) :
- new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
- new RegularConfigChooser(5, 6, 5, 0, 16, stencil)));
+ setEGLConfigChooser(translucent
+ ? new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
+ new RegularConfigChooser(8, 8, 8, 8, 16, stencil))
+ : new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
+ new RegularConfigChooser(5, 6, 5, 0, 16, stencil)));
} else {
- setEGLConfigChooser(translucent ?
- new RegularConfigChooser(8, 8, 8, 8, 16, stencil) :
- new RegularConfigChooser(5, 6, 5, 0, 16, stencil));
+ setEGLConfigChooser(translucent
+ ? new RegularConfigChooser(8, 8, 8, 8, 16, stencil)
+ : new RegularConfigChooser(5, 6, 5, 0, 16, stencil));
}
break;
}
diff --git a/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java b/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java
index d1e8ae5ca9..a98ecad594 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java
@@ -191,9 +191,9 @@ public class GodotEditText extends EditText {
private boolean needHandlingInGodot(int keyCode, KeyEvent keyEvent) {
boolean isArrowKey = keyCode == KeyEvent.KEYCODE_DPAD_UP || keyCode == KeyEvent.KEYCODE_DPAD_DOWN ||
- keyCode == KeyEvent.KEYCODE_DPAD_LEFT || keyCode == KeyEvent.KEYCODE_DPAD_RIGHT;
+ keyCode == KeyEvent.KEYCODE_DPAD_LEFT || keyCode == KeyEvent.KEYCODE_DPAD_RIGHT;
boolean isModifiedKey = keyEvent.isAltPressed() || keyEvent.isCtrlPressed() || keyEvent.isSymPressed() ||
- keyEvent.isFunctionPressed() || keyEvent.isMetaPressed();
+ keyEvent.isFunctionPressed() || keyEvent.isMetaPressed();
return isArrowKey || keyCode == KeyEvent.KEYCODE_TAB || KeyEvent.isModifierKey(keyCode) ||
isModifiedKey;
}
diff --git a/platform/iphone/export/export_plugin.cpp b/platform/iphone/export/export_plugin.cpp
index 60fcbb68d3..54fb597c62 100644
--- a/platform/iphone/export/export_plugin.cpp
+++ b/platform/iphone/export/export_plugin.cpp
@@ -841,7 +841,7 @@ void EditorExportPlatformIOS::_add_assets_to_project(const Ref<EditorExportPrese
String pbx_embeded_frameworks;
const String file_info_format = String("$build_id = {isa = PBXBuildFile; fileRef = $ref_id; };\n") +
- "$ref_id = {isa = PBXFileReference; lastKnownFileType = $file_type; name = \"$name\"; path = \"$file_path\"; sourceTree = \"<group>\"; };\n";
+ "$ref_id = {isa = PBXFileReference; lastKnownFileType = $file_type; name = \"$name\"; path = \"$file_path\"; sourceTree = \"<group>\"; };\n";
for (int i = 0; i < p_additional_assets.size(); ++i) {
String additional_asset_info_format = file_info_format;
@@ -1261,8 +1261,8 @@ Error EditorExportPlatformIOS::_export_ios_plugins(const Ref<EditorExportPreset>
String deinitialization_method = plugin.deinitialization_method + "();\n";
plugin_definition_cpp_code += definition_comment +
- "extern void " + initialization_method +
- "extern void " + deinitialization_method + "\n";
+ "extern void " + initialization_method +
+ "extern void " + deinitialization_method + "\n";
plugin_initialization_cpp_code += "\t" + initialization_method;
plugin_deinitialization_cpp_code += "\t" + deinitialization_method;
diff --git a/platform/javascript/export/export_plugin.cpp b/platform/javascript/export/export_plugin.cpp
index c7bd172751..1084a0adf7 100644
--- a/platform/javascript/export/export_plugin.cpp
+++ b/platform/javascript/export/export_plugin.cpp
@@ -140,7 +140,7 @@ void EditorExportPlatformJavaScript::_fix_html(Vector<uint8_t> &p_html, const Re
if (p_preset->get("progressive_web_app/enabled")) {
head_include += "<link rel='manifest' href='" + p_name + ".manifest.json'>\n";
head_include += "<script type='application/javascript'>window.addEventListener('load', () => {if ('serviceWorker' in navigator) {navigator.serviceWorker.register('" +
- p_name + ".service.worker.js');}});</script>\n";
+ p_name + ".service.worker.js');}});</script>\n";
}
// Replaces HTML string
diff --git a/platform/linuxbsd/display_server_x11.cpp b/platform/linuxbsd/display_server_x11.cpp
index 5fe28935b9..a4dabab33b 100644
--- a/platform/linuxbsd/display_server_x11.cpp
+++ b/platform/linuxbsd/display_server_x11.cpp
@@ -616,7 +616,7 @@ String DisplayServerX11::clipboard_get_primary() const {
Bool DisplayServerX11::_predicate_clipboard_save_targets(Display *display, XEvent *event, XPointer arg) {
if (event->xany.window == *(Window *)arg) {
return (event->type == SelectionRequest) ||
- (event->type == SelectionNotify);
+ (event->type == SelectionNotify);
} else {
return False;
}
@@ -2485,11 +2485,11 @@ Atom DisplayServerX11::_process_selection_request_target(Atom p_target, Window p
0);
return p_property;
} else if (p_target == XInternAtom(x11_display, "UTF8_STRING", 0) ||
- p_target == XInternAtom(x11_display, "COMPOUND_TEXT", 0) ||
- p_target == XInternAtom(x11_display, "TEXT", 0) ||
- p_target == XA_STRING ||
- p_target == XInternAtom(x11_display, "text/plain;charset=utf-8", 0) ||
- p_target == XInternAtom(x11_display, "text/plain", 0)) {
+ p_target == XInternAtom(x11_display, "COMPOUND_TEXT", 0) ||
+ p_target == XInternAtom(x11_display, "TEXT", 0) ||
+ p_target == XA_STRING ||
+ p_target == XInternAtom(x11_display, "text/plain;charset=utf-8", 0) ||
+ p_target == XInternAtom(x11_display, "text/plain", 0)) {
// Directly using internal clipboard because we know our window
// is the owner during a selection request.
CharString clip;
@@ -2867,7 +2867,7 @@ void DisplayServerX11::process_events() {
if (pen_pressure_range != Vector2()) {
xi.pressure_supported = true;
xi.pressure = (*values - pen_pressure_range[0]) /
- (pen_pressure_range[1] - pen_pressure_range[0]);
+ (pen_pressure_range[1] - pen_pressure_range[0]);
}
}
@@ -2926,10 +2926,7 @@ void DisplayServerX11::process_events() {
xi.last_relative_time = raw_event->time;
} break;
#ifdef TOUCH_ENABLED
- case XI_TouchBegin: // Fall-through
- // Disabled hand-in-hand with the grabbing
- //XIAllowTouchEvents(x11_display, event_data->deviceid, event_data->detail, x11_window, XIAcceptTouch);
-
+ case XI_TouchBegin:
case XI_TouchEnd: {
bool is_begin = event_data->evtype == XI_TouchBegin;
@@ -3756,18 +3753,18 @@ DisplayServerX11::WindowID DisplayServerX11::_create_window(WindowMode p_mode, V
XSetWindowAttributes new_attr;
new_attr.event_mask = KeyPressMask | KeyReleaseMask | ButtonPressMask |
- ButtonReleaseMask | EnterWindowMask |
- LeaveWindowMask | PointerMotionMask |
- Button1MotionMask |
- Button2MotionMask | Button3MotionMask |
- Button4MotionMask | Button5MotionMask |
- ButtonMotionMask | KeymapStateMask |
- ExposureMask | VisibilityChangeMask |
- StructureNotifyMask |
- SubstructureNotifyMask | SubstructureRedirectMask |
- FocusChangeMask | PropertyChangeMask |
- ColormapChangeMask | OwnerGrabButtonMask |
- im_event_mask;
+ ButtonReleaseMask | EnterWindowMask |
+ LeaveWindowMask | PointerMotionMask |
+ Button1MotionMask |
+ Button2MotionMask | Button3MotionMask |
+ Button4MotionMask | Button5MotionMask |
+ ButtonMotionMask | KeymapStateMask |
+ ExposureMask | VisibilityChangeMask |
+ StructureNotifyMask |
+ SubstructureNotifyMask | SubstructureRedirectMask |
+ FocusChangeMask | PropertyChangeMask |
+ ColormapChangeMask | OwnerGrabButtonMask |
+ im_event_mask;
XChangeWindowAttributes(x11_display, wd.x11_window, CWEventMask, &new_attr);
@@ -4137,7 +4134,6 @@ DisplayServerX11::DisplayServerX11(const String &p_rendering_driver, WindowMode
}
show_window(main_window);
-//create RenderingDevice if used
#if defined(VULKAN_ENABLED)
if (rendering_driver == "vulkan") {
//temporary
@@ -4148,13 +4144,6 @@ DisplayServerX11::DisplayServerX11(const String &p_rendering_driver, WindowMode
}
#endif
- /*
- rendering_server = memnew(RenderingServerDefault);
- if (get_render_thread_mode() != RENDER_THREAD_UNSAFE) {
- rendering_server = memnew(RenderingServerWrapMT(rendering_server, get_render_thread_mode() == RENDER_SEPARATE_THREAD));
- }
- */
-
{
//set all event master mask
XIEventMask all_master_event_mask;
@@ -4167,15 +4156,6 @@ DisplayServerX11::DisplayServerX11(const String &p_rendering_driver, WindowMode
XISelectEvents(x11_display, DefaultRootWindow(x11_display), &all_master_event_mask, 1);
}
- // Disabled by now since grabbing also blocks mouse events
- // (they are received as extended events instead of standard events)
- /*XIClearMask(xi.touch_event_mask.mask, XI_TouchOwnership);
-
- // Grab touch devices to avoid OS gesture interference
- for (int i = 0; i < xi.touch_devices.size(); ++i) {
- XIGrabDevice(x11_display, xi.touch_devices[i], x11_window, CurrentTime, None, XIGrabModeAsync, XIGrabModeAsync, False, &xi.touch_event_mask);
- }*/
-
cursor_size = XcursorGetDefaultSize(x11_display);
cursor_theme = XcursorGetTheme(x11_display);
diff --git a/platform/osx/export/export_plugin.cpp b/platform/osx/export/export_plugin.cpp
index 60a878d644..1e80dcd97b 100644
--- a/platform/osx/export/export_plugin.cpp
+++ b/platform/osx/export/export_plugin.cpp
@@ -325,11 +325,11 @@ void EditorExportPlatformOSX::_fix_plist(const Ref<EditorExportPreset> &p_preset
}
/**
- If we're running the OSX version of the Godot editor we'll:
- - export our application bundle to a temporary folder
- - attempt to code sign it
- - and then wrap it up in a DMG
-**/
+ * If we're running the OSX version of the Godot editor we'll:
+ * - export our application bundle to a temporary folder
+ * - attempt to code sign it
+ * - and then wrap it up in a DMG
+ */
Error EditorExportPlatformOSX::_notarize(const Ref<EditorExportPreset> &p_preset, const String &p_path) {
#ifdef OSX_ENABLED
diff --git a/platform/osx/joypad_osx.cpp b/platform/osx/joypad_osx.cpp
index e67d2b0e91..46ed651384 100644
--- a/platform/osx/joypad_osx.cpp
+++ b/platform/osx/joypad_osx.cpp
@@ -336,10 +336,10 @@ bool JoypadOSX::configure_joypad(IOHIDDeviceRef p_device_ref, joypad *p_joy) {
}
// Xbox controller hat values start at 1 rather than 0.
p_joy->offset_hat = vendor == 0x45e &&
- (product_id == 0x0b05 ||
- product_id == 0x02e0 ||
- product_id == 0x02fd ||
- product_id == 0x0b13);
+ (product_id == 0x0b05 ||
+ product_id == 0x02e0 ||
+ product_id == 0x02fd ||
+ product_id == 0x0b13);
return true;
}
diff --git a/platform/uwp/app_uwp.cpp b/platform/uwp/app_uwp.cpp
index 50e33e6c49..9e6ad7a63e 100644
--- a/platform/uwp/app_uwp.cpp
+++ b/platform/uwp/app_uwp.cpp
@@ -121,8 +121,7 @@ void App::SetWindow(CoreWindow ^ p_window) {
window->PointerWheelChanged +=
ref new TypedEventHandler<CoreWindow ^, PointerEventArgs ^>(this, &App::OnPointerWheelChanged);
- mouseChangedNotifier = SignalNotifier::AttachToEvent(L"os_mouse_mode_changed", ref new SignalHandler(
- this, &App::OnMouseModeChanged));
+ mouseChangedNotifier = SignalNotifier::AttachToEvent(L"os_mouse_mode_changed", ref new SignalHandler(this, &App::OnMouseModeChanged));
mouseChangedNotifier->Enable();
diff --git a/platform/uwp/export/export_plugin.h b/platform/uwp/export/export_plugin.h
index f295789254..acdd85e888 100644
--- a/platform/uwp/export/export_plugin.h
+++ b/platform/uwp/export/export_plugin.h
@@ -367,15 +367,15 @@ class EditorExportPlatformUWP : public EditorExportPlatform {
static bool _should_compress_asset(const String &p_path, const Vector<uint8_t> &p_data) {
/* TODO: This was copied verbatim from Android export. It should be
- * refactored to the parent class and also be used for .zip export.
- */
+ * refactored to the parent class and also be used for .zip export.
+ */
/*
- * By not compressing files with little or not benefit in doing so,
- * a performance gain is expected at runtime. Moreover, if the APK is
- * zip-aligned, assets stored as they are can be efficiently read by
- * Android by memory-mapping them.
- */
+ * By not compressing files with little or not benefit in doing so,
+ * a performance gain is expected at runtime. Moreover, if the APK is
+ * zip-aligned, assets stored as they are can be efficiently read by
+ * Android by memory-mapping them.
+ */
// -- Unconditional uncompress to mimic AAPT plus some other
diff --git a/platform/windows/key_mapping_windows.cpp b/platform/windows/key_mapping_windows.cpp
index 8016d20470..b9cf8151fc 100644
--- a/platform/windows/key_mapping_windows.cpp
+++ b/platform/windows/key_mapping_windows.cpp
@@ -426,13 +426,13 @@ unsigned int KeyMappingWindows::get_scansym(unsigned int p_code, bool p_extended
bool KeyMappingWindows::is_extended_key(unsigned int p_code) {
return p_code == VK_INSERT ||
- p_code == VK_DELETE ||
- p_code == VK_HOME ||
- p_code == VK_END ||
- p_code == VK_PRIOR ||
- p_code == VK_NEXT ||
- p_code == VK_LEFT ||
- p_code == VK_UP ||
- p_code == VK_RIGHT ||
- p_code == VK_DOWN;
+ p_code == VK_DELETE ||
+ p_code == VK_HOME ||
+ p_code == VK_END ||
+ p_code == VK_PRIOR ||
+ p_code == VK_NEXT ||
+ p_code == VK_LEFT ||
+ p_code == VK_UP ||
+ p_code == VK_RIGHT ||
+ p_code == VK_DOWN;
}
diff --git a/scene/2d/line_builder.cpp b/scene/2d/line_builder.cpp
index a8a2639ccf..05d77f8224 100644
--- a/scene/2d/line_builder.cpp
+++ b/scene/2d/line_builder.cpp
@@ -128,9 +128,9 @@ void LineBuilder::build() {
_interpolate_color = gradient != nullptr;
bool retrieve_curve = curve != nullptr;
bool distance_required = _interpolate_color ||
- retrieve_curve ||
- texture_mode == Line2D::LINE_TEXTURE_TILE ||
- texture_mode == Line2D::LINE_TEXTURE_STRETCH;
+ retrieve_curve ||
+ texture_mode == Line2D::LINE_TEXTURE_TILE ||
+ texture_mode == Line2D::LINE_TEXTURE_STRETCH;
if (distance_required) {
total_distance = calculate_total_distance(points);
//Adjust totalDistance.
diff --git a/scene/2d/tile_map.cpp b/scene/2d/tile_map.cpp
index e54d1cd597..c11262e0c9 100644
--- a/scene/2d/tile_map.cpp
+++ b/scene/2d/tile_map.cpp
@@ -2974,38 +2974,38 @@ bool TileMap::is_existing_neighbor(TileSet::CellNeighbor p_cell_neighbor) const
TileSet::TileShape shape = tile_set->get_tile_shape();
if (shape == TileSet::TILE_SHAPE_SQUARE) {
return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER;
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER;
} else if (shape == TileSet::TILE_SHAPE_ISOMETRIC) {
return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_CORNER ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
} else {
if (tile_set->get_tile_offset_axis() == TileSet::TILE_OFFSET_AXIS_HORIZONTAL) {
return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
} else {
return p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
- p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
+ p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
}
}
}
@@ -3050,7 +3050,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
return p_coords + Vector2i(is_offset ? 0 : -1, 1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
return p_coords + Vector2i(-1, 0);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(is_offset ? 0 : -1, -1);
@@ -3074,7 +3074,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
return p_coords + Vector2i(1, is_offset ? 0 : -1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
return p_coords + Vector2i(0, -1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(-1, is_offset ? 0 : -1);
@@ -3101,7 +3101,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
return p_coords + Vector2i(is_offset ? -1 : 0, 1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
return p_coords + Vector2i(-1, 0);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(is_offset ? -1 : 0, -1);
@@ -3125,7 +3125,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
return p_coords + Vector2i(1, is_offset ? -1 : 0);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
return p_coords + Vector2i(0, -1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(-1, is_offset ? -1 : 0);
@@ -3152,7 +3152,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
return p_coords + Vector2i(-1, 1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
return p_coords + Vector2i(-1, 0);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(0, -1);
@@ -3175,7 +3175,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
return p_coords + Vector2i(1, -1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
return p_coords + Vector2i(0, -1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(-1, 0);
@@ -3200,7 +3200,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
return p_coords + Vector2i(-1, 1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
return p_coords + Vector2i(-2, 1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(-1, 0);
@@ -3223,7 +3223,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
return p_coords + Vector2i(1, -1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
return p_coords + Vector2i(1, -2);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(0, -1);
@@ -3252,7 +3252,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
return p_coords + Vector2i(-1, 0);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
return p_coords + Vector2i(-1, -1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(0, -1);
@@ -3275,7 +3275,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
return p_coords + Vector2i(0, -1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
return p_coords + Vector2i(-1, -1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(-1, 0);
@@ -3300,7 +3300,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
return p_coords + Vector2i(0, 1);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
return p_coords + Vector2i(-1, 1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(-1, 0);
@@ -3323,7 +3323,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
return p_coords + Vector2i(1, 0);
} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
- (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+ (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
return p_coords + Vector2i(1, -1);
} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
return p_coords + Vector2i(0, -1);
diff --git a/scene/3d/cpu_particles_3d.cpp b/scene/3d/cpu_particles_3d.cpp
index f1e800988d..5f13ed3c66 100644
--- a/scene/3d/cpu_particles_3d.cpp
+++ b/scene/3d/cpu_particles_3d.cpp
@@ -213,8 +213,7 @@ TypedArray<String> CPUParticles3D::get_configuration_warnings() const {
warnings.push_back(TTR("Nothing is visible because no mesh has been assigned."));
}
- if (!anim_material_found && (get_param_max(PARAM_ANIM_SPEED) != 0.0 || get_param_max(PARAM_ANIM_OFFSET) != 0.0 ||
- get_param_curve(PARAM_ANIM_SPEED).is_valid() || get_param_curve(PARAM_ANIM_OFFSET).is_valid())) {
+ if (!anim_material_found && (get_param_max(PARAM_ANIM_SPEED) != 0.0 || get_param_max(PARAM_ANIM_OFFSET) != 0.0 || get_param_curve(PARAM_ANIM_SPEED).is_valid() || get_param_curve(PARAM_ANIM_OFFSET).is_valid())) {
warnings.push_back(TTR("CPUParticles3D animation requires the usage of a StandardMaterial3D whose Billboard Mode is set to \"Particle Billboard\"."));
}
diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp
index 9127168c58..6ac9364b1a 100644
--- a/scene/3d/gpu_particles_collision_3d.cpp
+++ b/scene/3d/gpu_particles_collision_3d.cpp
@@ -288,15 +288,12 @@ void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, cons
Vector3 nor = ba.cross(ac);
inside_d = Math::sqrt(
- (SGN(ba.cross(nor).dot(pa)) +
- SGN(cb.cross(nor).dot(pb)) +
- SGN(ac.cross(nor).dot(pc)) <
- 2.0) ?
- MIN(MIN(
- Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa),
- Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)),
- Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) :
- nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
+ (SGN(ba.cross(nor).dot(pa)) + SGN(cb.cross(nor).dot(pb)) + SGN(ac.cross(nor).dot(pc)) < 2.0)
+ ? MIN(MIN(
+ Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa),
+ Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)),
+ Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc))
+ : nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
closest_distance = MIN(closest_distance, inside_d);
}
diff --git a/scene/3d/node_3d.cpp b/scene/3d/node_3d.cpp
index 8a39d4d30f..1265679b36 100644
--- a/scene/3d/node_3d.cpp
+++ b/scene/3d/node_3d.cpp
@@ -44,7 +44,7 @@
definition of invalidation: global is invalid
1) If a node sets a LOCAL, it produces an invalidation of everything above
- a) If above is invalid, don't keep invalidating upwards
+ . a) If above is invalid, don't keep invalidating upwards
2) If a node sets a GLOBAL, it is converted to LOCAL (and forces validation of everything pending below)
drawback: setting/reading globals is useful and used very often, and using affine inverses is slow
@@ -56,7 +56,7 @@
definition of invalidation: NONE dirty, LOCAL dirty, GLOBAL dirty
1) If a node sets a LOCAL, it must climb the tree and set it as GLOBAL dirty
- a) marking GLOBALs as dirty up all the tree must be done always
+ . a) marking GLOBALs as dirty up all the tree must be done always
2) If a node sets a GLOBAL, it marks local as dirty, and that's all?
//is clearing the dirty state correct in this case?
@@ -94,11 +94,6 @@ void Node3D::_propagate_transform_changed(Node3D *p_origin) {
return;
}
- /*
- if (data.dirty&DIRTY_GLOBAL)
- return; //already dirty
- */
-
data.children_lock++;
for (Node3D *&E : data.children) {
@@ -244,10 +239,9 @@ Quaternion Node3D::get_quaternion() const {
}
void Node3D::set_global_transform(const Transform3D &p_transform) {
- Transform3D xform =
- (data.parent && !data.top_level_active) ?
- data.parent->get_global_transform().affine_inverse() * p_transform :
- p_transform;
+ Transform3D xform = (data.parent && !data.top_level_active)
+ ? data.parent->get_global_transform().affine_inverse() * p_transform
+ : p_transform;
set_transform(xform);
}
diff --git a/scene/3d/vehicle_body_3d.cpp b/scene/3d/vehicle_body_3d.cpp
index 6761fdd944..61cba17cde 100644
--- a/scene/3d/vehicle_body_3d.cpp
+++ b/scene/3d/vehicle_body_3d.cpp
@@ -124,7 +124,7 @@ void VehicleWheel3D::_update(PhysicsDirectBodyState3D *s) {
Vector3 relpos = m_raycastInfo.m_contactPointWS - s->get_transform().origin;
chassis_velocity_at_contactPoint = s->get_linear_velocity() +
- (s->get_angular_velocity()).cross(relpos); // * mPos);
+ (s->get_angular_velocity()).cross(relpos); // * mPos);
real_t projVel = m_raycastInfo.m_contactNormalWS.dot(chassis_velocity_at_contactPoint);
if (project >= real_t(-0.1)) {
@@ -444,7 +444,7 @@ real_t VehicleBody3D::_ray_cast(int p_idx, PhysicsDirectBodyState3D *s) {
//chassis_velocity_at_contactPoint = getRigidBody()->getVelocityInLocalPoint(relpos);
chassis_velocity_at_contactPoint = s->get_linear_velocity() +
- (s->get_angular_velocity()).cross(wheel.m_raycastInfo.m_contactPointWS - s->get_transform().origin); // * mPos);
+ (s->get_angular_velocity()).cross(wheel.m_raycastInfo.m_contactPointWS - s->get_transform().origin); // * mPos);
real_t projVel = wheel.m_raycastInfo.m_contactNormalWS.dot(chassis_velocity_at_contactPoint);
@@ -771,7 +771,7 @@ void VehicleBody3D::_update_friction(PhysicsDirectBodyState3D *s) {
VehicleWheel3D &wheelInfo = *wheels[wheel];
Vector3 rel_pos = wheelInfo.m_raycastInfo.m_contactPointWS -
- s->get_transform().origin;
+ s->get_transform().origin;
if (m_forwardImpulse[wheel] != real_t(0.)) {
s->apply_impulse(m_forwardWS[wheel] * (m_forwardImpulse[wheel]), rel_pos);
diff --git a/scene/gui/control.cpp b/scene/gui/control.cpp
index 77a1efd021..582c8e5860 100644
--- a/scene/gui/control.cpp
+++ b/scene/gui/control.cpp
@@ -73,8 +73,8 @@ Dictionary Control::_edit_get_state() const {
void Control::_edit_set_state(const Dictionary &p_state) {
ERR_FAIL_COND((p_state.size() <= 0) ||
- !p_state.has("rotation") || !p_state.has("scale") ||
- !p_state.has("pivot") || !p_state.has("anchors") || !p_state.has("offsets"));
+ !p_state.has("rotation") || !p_state.has("scale") ||
+ !p_state.has("pivot") || !p_state.has("anchors") || !p_state.has("offsets"));
Dictionary state = p_state;
set_rotation(state["rotation"]);
diff --git a/scene/gui/file_dialog.cpp b/scene/gui/file_dialog.cpp
index bb77da9548..5f9f09fc50 100644
--- a/scene/gui/file_dialog.cpp
+++ b/scene/gui/file_dialog.cpp
@@ -348,7 +348,7 @@ bool FileDialog::_is_open_should_be_disabled() {
// Opening a file, but selected a folder? Forbidden.
return ((mode == FILE_MODE_OPEN_FILE || mode == FILE_MODE_OPEN_FILES) && d["dir"]) || // Flipped case, also forbidden.
- (mode == FILE_MODE_OPEN_DIR && !d["dir"]);
+ (mode == FILE_MODE_OPEN_DIR && !d["dir"]);
}
void FileDialog::_go_up() {
diff --git a/scene/gui/rich_text_label.h b/scene/gui/rich_text_label.h
index 6d772876ad..f3c4c11cc8 100644
--- a/scene/gui/rich_text_label.h
+++ b/scene/gui/rich_text_label.h
@@ -278,12 +278,12 @@ private:
uint64_t offset_random(int index) {
return (_current_rng >> (index % 64)) |
- (_current_rng << (64 - (index % 64)));
+ (_current_rng << (64 - (index % 64)));
}
uint64_t offset_previous_random(int index) {
return (_previous_rng >> (index % 64)) |
- (_previous_rng << (64 - (index % 64)));
+ (_previous_rng << (64 - (index % 64)));
}
};
diff --git a/scene/main/viewport.cpp b/scene/main/viewport.cpp
index 3280190250..5f8e66e337 100644
--- a/scene/main/viewport.cpp
+++ b/scene/main/viewport.cpp
@@ -1246,10 +1246,10 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu
Ref<InputEventMouseButton> mb = p_input;
bool cant_stop_me_now = (mb.is_valid() &&
- (mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN ||
- mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP ||
- mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT ||
- mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT));
+ (mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN ||
+ mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP ||
+ mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT ||
+ mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT));
Ref<InputEventPanGesture> pn = p_input;
cant_stop_me_now = pn.is_valid() || cant_stop_me_now;
diff --git a/scene/resources/animation.cpp b/scene/resources/animation.cpp
index f8e4845ae6..06ce993cc7 100644
--- a/scene/resources/animation.cpp
+++ b/scene/resources/animation.cpp
@@ -2319,10 +2319,11 @@ Variant Animation::_cubic_interpolate(const Variant &p_pre_a, const Variant &p_a
real_t t2 = t * t;
real_t t3 = t2 * t;
- return 0.5f * ((p1 * 2.0f) +
- (-p0 + p2) * t +
- (2.0f * p0 - 5.0f * p1 + 4 * p2 - p3) * t2 +
- (-p0 + 3.0f * p1 - 3.0f * p2 + p3) * t3);
+ return 0.5f *
+ ((p1 * 2.0f) +
+ (-p0 + p2) * t +
+ (2.0f * p0 - 5.0f * p1 + 4 * p2 - p3) * t2 +
+ (-p0 + 3.0f * p1 - 3.0f * p2 + p3) * t3);
} else if ((vformat & (vformat - 1))) {
return p_a; //can't interpolate, mix of types
diff --git a/servers/audio/audio_filter_sw.cpp b/servers/audio/audio_filter_sw.cpp
index bcfa4c4c37..b31014bd21 100644
--- a/servers/audio/audio_filter_sw.cpp
+++ b/servers/audio/audio_filter_sw.cpp
@@ -173,28 +173,20 @@ void AudioFilterSW::prepare_coefficients(Coeffs *p_coeffs) {
p_coeffs->a2 = ((tmpgain + 1.0) - (tmpgain - 1.0) * cos_v - beta * sin_v);
} break;
- };
+ }
p_coeffs->b0 /= a0;
p_coeffs->b1 /= a0;
p_coeffs->b2 /= a0;
p_coeffs->a1 /= 0.0 - a0;
p_coeffs->a2 /= 0.0 - a0;
-
- //undenormalise
- /* p_coeffs->b0=undenormalise(p_coeffs->b0);
- p_coeffs->b1=undenormalise(p_coeffs->b1);
- p_coeffs->b2=undenormalise(p_coeffs->b2);
- p_coeffs->a1=undenormalise(p_coeffs->a1);
- p_coeffs->a2=undenormalise(p_coeffs->a2);*/
}
-void AudioFilterSW::set_stages(int p_stages) { //adjust for multiple stages
-
+void AudioFilterSW::set_stages(int p_stages) {
stages = p_stages;
}
-/* Fouriertransform kernel to obtain response */
+/* Fourier transform kernel to obtain response */
float AudioFilterSW::get_response(float p_freq, Coeffs *p_coeffs) {
float freq = p_freq / sampling_rate * Math_TAU;
diff --git a/servers/physics_3d/godot_body_pair_3d.cpp b/servers/physics_3d/godot_body_pair_3d.cpp
index 457abfb71a..f7d9ed9ee9 100644
--- a/servers/physics_3d/godot_body_pair_3d.cpp
+++ b/servers/physics_3d/godot_body_pair_3d.cpp
@@ -495,8 +495,7 @@ void GodotBodyPair3D::solve(real_t p_step) {
Vector3 temp1 = inv_inertia_tensor_A.xform(c.rA.cross(tv));
Vector3 temp2 = inv_inertia_tensor_B.xform(c.rB.cross(tv));
- real_t t = -tvl /
- (inv_mass_A + inv_mass_B + tv.dot(temp1.cross(c.rA) + temp2.cross(c.rB)));
+ real_t t = -tvl / (inv_mass_A + inv_mass_B + tv.dot(temp1.cross(c.rA) + temp2.cross(c.rB)));
Vector3 jt = t * tv;
@@ -863,8 +862,7 @@ void GodotBodySoftBodyPair3D::solve(real_t p_step) {
Vector3 temp1 = body_inv_inertia_tensor.xform(c.rA.cross(tv));
- real_t t = -tvl /
- (body_inv_mass + node_inv_mass + tv.dot(temp1.cross(c.rA)));
+ real_t t = -tvl / (body_inv_mass + node_inv_mass + tv.dot(temp1.cross(c.rA)));
Vector3 jt = t * tv;
diff --git a/servers/physics_3d/godot_soft_body_3d.cpp b/servers/physics_3d/godot_soft_body_3d.cpp
index f214e3603a..4b3e8cc0d9 100644
--- a/servers/physics_3d/godot_soft_body_3d.cpp
+++ b/servers/physics_3d/godot_soft_body_3d.cpp
@@ -710,9 +710,11 @@ void GodotSoftBody3D::generate_bending_constraints(int p_distance) {
// A small structure to track lists of dependent link calculations.
class LinkDeps {
public:
- int value; // A link calculation that is dependent on this one
- // Positive values = "input A" while negative values = "input B"
- LinkDeps *next; // Next dependence in the list
+ // A link calculation that is dependent on this one.
+ // Positive values = "input A" while negative values = "input B".
+ int value;
+ // Next dependence in the list.
+ LinkDeps *next;
};
typedef LinkDeps *LinkDepsPtr;
diff --git a/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp b/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp
index 31a87fc595..864086c956 100644
--- a/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp
@@ -129,16 +129,18 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
plane_space(normal[0], normal[1], normal[2]);
for (int i = 0; i < 3; i++) {
- memnew_placement(&m_jac[i], GodotJacobianEntry3D(
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
- pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
- normal[i],
- A->get_inv_inertia(),
- A->get_inv_mass(),
- B->get_inv_inertia(),
- B->get_inv_mass()));
+ memnew_placement(
+ &m_jac[i],
+ GodotJacobianEntry3D(
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
+ pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
+ normal[i],
+ A->get_inv_inertia(),
+ A->get_inv_mass(),
+ B->get_inv_inertia(),
+ B->get_inv_mass()));
}
}
@@ -192,8 +194,7 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
real_t swingAxisSign = (b2Axis1.dot(b1Axis1) >= 0.0f) ? 1.0f : -1.0f;
m_swingAxis *= swingAxisSign;
- m_kSwing = real_t(1.) / (A->compute_angular_impulse_denominator(m_swingAxis) +
- B->compute_angular_impulse_denominator(m_swingAxis));
+ m_kSwing = real_t(1.) / (A->compute_angular_impulse_denominator(m_swingAxis) + B->compute_angular_impulse_denominator(m_swingAxis));
}
// Twist limits
@@ -212,8 +213,7 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
m_twistAxis.normalize();
m_twistAxis *= -1.0f;
- m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) +
- B->compute_angular_impulse_denominator(m_twistAxis));
+ m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) + B->compute_angular_impulse_denominator(m_twistAxis));
} else if (twist > m_twistSpan * lockedFreeFactor) {
m_twistCorrection = (twist - m_twistSpan);
@@ -222,8 +222,7 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
m_twistAxis = (b2Axis1 + b1Axis1) * 0.5f;
m_twistAxis.normalize();
- m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) +
- B->compute_angular_impulse_denominator(m_twistAxis));
+ m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) + B->compute_angular_impulse_denominator(m_twistAxis));
}
}
diff --git a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp
index b88e2d1190..915bb528e9 100644
--- a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp
@@ -279,25 +279,30 @@ void GodotGeneric6DOFJoint3D::calculateTransforms() {
void GodotGeneric6DOFJoint3D::buildLinearJacobian(
GodotJacobianEntry3D &jacLinear, const Vector3 &normalWorld,
const Vector3 &pivotAInW, const Vector3 &pivotBInW) {
- memnew_placement(&jacLinear, GodotJacobianEntry3D(
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
- pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
- normalWorld,
- A->get_inv_inertia(),
- A->get_inv_mass(),
- B->get_inv_inertia(),
- B->get_inv_mass()));
+ memnew_placement(
+ &jacLinear,
+ GodotJacobianEntry3D(
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
+ pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
+ normalWorld,
+ A->get_inv_inertia(),
+ A->get_inv_mass(),
+ B->get_inv_inertia(),
+ B->get_inv_mass()));
}
void GodotGeneric6DOFJoint3D::buildAngularJacobian(
GodotJacobianEntry3D &jacAngular, const Vector3 &jointAxisW) {
- memnew_placement(&jacAngular, GodotJacobianEntry3D(jointAxisW,
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- A->get_inv_inertia(),
- B->get_inv_inertia()));
+ memnew_placement(
+ &jacAngular,
+ GodotJacobianEntry3D(
+ jointAxisW,
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ A->get_inv_inertia(),
+ B->get_inv_inertia()));
}
bool GodotGeneric6DOFJoint3D::testAngularLimitMotor(int axis_index) {
diff --git a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h
index 729b3fa1f9..f37b5b981b 100644
--- a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h
+++ b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h
@@ -119,11 +119,11 @@ public:
//! Test limit
/*!
- - free means upper < lower,
- - locked means upper == lower
- - limited means upper > lower
- - limitIndex: first 3 are linear, next 3 are angular
- */
+ * - free means upper < lower,
+ * - locked means upper == lower
+ * - limited means upper > lower
+ * - limitIndex: first 3 are linear, next 3 are angular
+ */
inline bool isLimited(int limitIndex) {
return (m_upperLimit[limitIndex] >= m_lowerLimit[limitIndex]);
}
@@ -291,11 +291,11 @@ public:
//! Test limit
/*!
- - free means upper < lower,
- - locked means upper == lower
- - limited means upper > lower
- - limitIndex: first 3 are linear, next 3 are angular
- */
+ * - free means upper < lower,
+ * - locked means upper == lower
+ * - limited means upper > lower
+ * - limitIndex: first 3 are linear, next 3 are angular
+ */
bool isLimited(int limitIndex) {
if (limitIndex < 3) {
return m_linearLimits.isLimited(limitIndex);
diff --git a/servers/physics_3d/joints/godot_hinge_joint_3d.cpp b/servers/physics_3d/joints/godot_hinge_joint_3d.cpp
index 7b7ca1b3ac..cf77129a30 100644
--- a/servers/physics_3d/joints/godot_hinge_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_hinge_joint_3d.cpp
@@ -149,16 +149,18 @@ bool GodotHingeJoint3D::setup(real_t p_step) {
plane_space(normal[0], normal[1], normal[2]);
for (int i = 0; i < 3; i++) {
- memnew_placement(&m_jac[i], GodotJacobianEntry3D(
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
- pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
- normal[i],
- A->get_inv_inertia(),
- A->get_inv_mass(),
- B->get_inv_inertia(),
- B->get_inv_mass()));
+ memnew_placement(
+ &m_jac[i],
+ GodotJacobianEntry3D(
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
+ pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
+ normal[i],
+ A->get_inv_inertia(),
+ A->get_inv_mass(),
+ B->get_inv_inertia(),
+ B->get_inv_mass()));
}
}
@@ -175,23 +177,32 @@ bool GodotHingeJoint3D::setup(real_t p_step) {
Vector3 jointAxis1 = A->get_transform().basis.xform(jointAxis1local);
Vector3 hingeAxisWorld = A->get_transform().basis.xform(m_rbAFrame.basis.get_axis(2));
- memnew_placement(&m_jacAng[0], GodotJacobianEntry3D(jointAxis0,
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- A->get_inv_inertia(),
- B->get_inv_inertia()));
-
- memnew_placement(&m_jacAng[1], GodotJacobianEntry3D(jointAxis1,
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- A->get_inv_inertia(),
- B->get_inv_inertia()));
-
- memnew_placement(&m_jacAng[2], GodotJacobianEntry3D(hingeAxisWorld,
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- A->get_inv_inertia(),
- B->get_inv_inertia()));
+ memnew_placement(
+ &m_jacAng[0],
+ GodotJacobianEntry3D(
+ jointAxis0,
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ A->get_inv_inertia(),
+ B->get_inv_inertia()));
+
+ memnew_placement(
+ &m_jacAng[1],
+ GodotJacobianEntry3D(
+ jointAxis1,
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ A->get_inv_inertia(),
+ B->get_inv_inertia()));
+
+ memnew_placement(
+ &m_jacAng[2],
+ GodotJacobianEntry3D(
+ hingeAxisWorld,
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ A->get_inv_inertia(),
+ B->get_inv_inertia()));
// Compute limit information
real_t hingeAngle = get_hinge_angle();
@@ -220,8 +231,7 @@ bool GodotHingeJoint3D::setup(real_t p_step) {
//Compute K = J*W*J' for hinge axis
Vector3 axisA = A->get_transform().basis.xform(m_rbAFrame.basis.get_axis(2));
- m_kHinge = 1.0f / (A->compute_angular_impulse_denominator(axisA) +
- B->compute_angular_impulse_denominator(axisA));
+ m_kHinge = 1.0f / (A->compute_angular_impulse_denominator(axisA) + B->compute_angular_impulse_denominator(axisA));
return true;
}
@@ -284,7 +294,7 @@ void GodotHingeJoint3D::solve(real_t p_step) {
if (len > real_t(0.00001)) {
Vector3 normal = velrelOrthog.normalized();
real_t denom = A->compute_angular_impulse_denominator(normal) +
- B->compute_angular_impulse_denominator(normal);
+ B->compute_angular_impulse_denominator(normal);
// scale for mass and relaxation
velrelOrthog *= (real_t(1.) / denom) * m_relaxationFactor;
}
@@ -295,7 +305,7 @@ void GodotHingeJoint3D::solve(real_t p_step) {
if (len2 > real_t(0.00001)) {
Vector3 normal2 = angularError.normalized();
real_t denom2 = A->compute_angular_impulse_denominator(normal2) +
- B->compute_angular_impulse_denominator(normal2);
+ B->compute_angular_impulse_denominator(normal2);
angularError *= (real_t(1.) / denom2) * relaxation;
}
diff --git a/servers/physics_3d/joints/godot_pin_joint_3d.cpp b/servers/physics_3d/joints/godot_pin_joint_3d.cpp
index 10d52ad5e9..e9e81b61a7 100644
--- a/servers/physics_3d/joints/godot_pin_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_pin_joint_3d.cpp
@@ -63,16 +63,18 @@ bool GodotPinJoint3D::setup(real_t p_step) {
for (int i = 0; i < 3; i++) {
normal[i] = 1;
- memnew_placement(&m_jac[i], GodotJacobianEntry3D(
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- A->get_transform().xform(m_pivotInA) - A->get_transform().origin - A->get_center_of_mass(),
- B->get_transform().xform(m_pivotInB) - B->get_transform().origin - B->get_center_of_mass(),
- normal,
- A->get_inv_inertia(),
- A->get_inv_mass(),
- B->get_inv_inertia(),
- B->get_inv_mass()));
+ memnew_placement(
+ &m_jac[i],
+ GodotJacobianEntry3D(
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ A->get_transform().xform(m_pivotInA) - A->get_transform().origin - A->get_center_of_mass(),
+ B->get_transform().xform(m_pivotInB) - B->get_transform().origin - B->get_center_of_mass(),
+ normal,
+ A->get_inv_inertia(),
+ A->get_inv_mass(),
+ B->get_inv_inertia(),
+ B->get_inv_mass()));
normal[i] = 0;
}
diff --git a/servers/physics_3d/joints/godot_slider_joint_3d.cpp b/servers/physics_3d/joints/godot_slider_joint_3d.cpp
index 3be111ac92..1f463ad24c 100644
--- a/servers/physics_3d/joints/godot_slider_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_slider_joint_3d.cpp
@@ -112,16 +112,18 @@ bool GodotSliderJoint3D::setup(real_t p_step) {
//linear part
for (i = 0; i < 3; i++) {
normalWorld = m_calculatedTransformA.basis.get_axis(i);
- memnew_placement(&m_jacLin[i], GodotJacobianEntry3D(
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- m_relPosA - A->get_center_of_mass(),
- m_relPosB - B->get_center_of_mass(),
- normalWorld,
- A->get_inv_inertia(),
- A->get_inv_mass(),
- B->get_inv_inertia(),
- B->get_inv_mass()));
+ memnew_placement(
+ &m_jacLin[i],
+ GodotJacobianEntry3D(
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ m_relPosA - A->get_center_of_mass(),
+ m_relPosB - B->get_center_of_mass(),
+ normalWorld,
+ A->get_inv_inertia(),
+ A->get_inv_mass(),
+ B->get_inv_inertia(),
+ B->get_inv_mass()));
m_jacLinDiagABInv[i] = real_t(1.) / m_jacLin[i].getDiagonal();
m_depth[i] = m_delta.dot(normalWorld);
}
@@ -129,12 +131,14 @@ bool GodotSliderJoint3D::setup(real_t p_step) {
// angular part
for (i = 0; i < 3; i++) {
normalWorld = m_calculatedTransformA.basis.get_axis(i);
- memnew_placement(&m_jacAng[i], GodotJacobianEntry3D(
- normalWorld,
- A->get_principal_inertia_axes().transposed(),
- B->get_principal_inertia_axes().transposed(),
- A->get_inv_inertia(),
- B->get_inv_inertia()));
+ memnew_placement(
+ &m_jacAng[i],
+ GodotJacobianEntry3D(
+ normalWorld,
+ A->get_principal_inertia_axes().transposed(),
+ B->get_principal_inertia_axes().transposed(),
+ A->get_inv_inertia(),
+ B->get_inv_inertia()));
}
testAngLimits();
Vector3 axisA = m_calculatedTransformA.basis.get_axis(0);
diff --git a/servers/rendering/renderer_canvas_cull.cpp b/servers/rendering/renderer_canvas_cull.cpp
index 46683e8e68..7b70483571 100644
--- a/servers/rendering/renderer_canvas_cull.cpp
+++ b/servers/rendering/renderer_canvas_cull.cpp
@@ -137,8 +137,7 @@ void RendererCanvasCull::_attach_canvas_item_for_draw(RendererCanvasCull::Item *
// We have two choices now, if user has drawn something, we must assume users wants to draw the "mask", so compute the size based on this.
// If nothing has been drawn, we just take it over and draw it ourselves.
- if (ci->canvas_group->fit_empty && (ci->commands == nullptr ||
- (ci->commands->next == nullptr && ci->commands->type == RendererCanvasCull::Item::Command::TYPE_RECT && (static_cast<RendererCanvasCull::Item::CommandRect *>(ci->commands)->flags & RendererCanvasRender::CANVAS_RECT_IS_GROUP)))) {
+ if (ci->canvas_group->fit_empty && (ci->commands == nullptr || (ci->commands->next == nullptr && ci->commands->type == RendererCanvasCull::Item::Command::TYPE_RECT && (static_cast<RendererCanvasCull::Item::CommandRect *>(ci->commands)->flags & RendererCanvasRender::CANVAS_RECT_IS_GROUP)))) {
// No commands, or sole command is the one used to draw, so we (re)create the draw command.
ci->clear();
diff --git a/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp b/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
index c69c9eeadf..13a3e814f6 100644
--- a/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
+++ b/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
@@ -29,6 +29,7 @@
/*************************************************************************/
#include "renderer_canvas_render_rd.h"
+
#include "core/config/project_settings.h"
#include "core/math/geometry_2d.h"
#include "core/math/math_defs.h"
@@ -1585,9 +1586,6 @@ void RendererCanvasRenderRD::light_update_shadow(RID p_rid, int p_shadow_index,
push_constant.z_far = p_far;
push_constant.pad = 0;
- /*if (i == 0)
- *p_xform_cache = projection;*/
-
LightOccluderInstance *instance = p_occluders;
while (instance) {
diff --git a/servers/rendering/renderer_rd/shaders/canvas.glsl b/servers/rendering/renderer_rd/shaders/canvas.glsl
index 2911e8b731..65a621b203 100644
--- a/servers/rendering/renderer_rd/shaders/canvas.glsl
+++ b/servers/rendering/renderer_rd/shaders/canvas.glsl
@@ -91,7 +91,6 @@ void main() {
uint instancing = draw_data.flags & FLAGS_INSTANCING_MASK;
#ifdef USE_ATTRIBUTES
-
if (instancing > 1) {
// trails
@@ -128,37 +127,37 @@ void main() {
vertex = new_vertex;
color *= pcolor;
-
} else
#endif // USE_ATTRIBUTES
+ {
+ if (instancing == 1) {
+ uint stride = 2;
+ {
+ if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_COLORS)) {
+ stride += 1;
+ }
+ if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_CUSTOM_DATA)) {
+ stride += 1;
+ }
+ }
+
+ uint offset = stride * gl_InstanceIndex;
+
+ mat4 matrix = mat4(transforms.data[offset + 0], transforms.data[offset + 1], vec4(0.0, 0.0, 1.0, 0.0), vec4(0.0, 0.0, 0.0, 1.0));
+ offset += 2;
- if (instancing == 1) {
- uint stride = 2;
- {
if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_COLORS)) {
- stride += 1;
+ color *= transforms.data[offset];
+ offset += 1;
}
+
if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_CUSTOM_DATA)) {
- stride += 1;
+ instance_custom = transforms.data[offset];
}
- }
-
- uint offset = stride * gl_InstanceIndex;
- mat4 matrix = mat4(transforms.data[offset + 0], transforms.data[offset + 1], vec4(0.0, 0.0, 1.0, 0.0), vec4(0.0, 0.0, 0.0, 1.0));
- offset += 2;
-
- if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_COLORS)) {
- color *= transforms.data[offset];
- offset += 1;
- }
-
- if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_CUSTOM_DATA)) {
- instance_custom = transforms.data[offset];
+ matrix = transpose(matrix);
+ world_matrix = world_matrix * matrix;
}
-
- matrix = transpose(matrix);
- world_matrix = world_matrix * matrix;
}
#if !defined(USE_ATTRIBUTES) && !defined(USE_PRIMITIVE)
diff --git a/servers/rendering/renderer_rd/shaders/particles.glsl b/servers/rendering/renderer_rd/shaders/particles.glsl
index 9f8410fd8a..328becbc20 100644
--- a/servers/rendering/renderer_rd/shaders/particles.glsl
+++ b/servers/rendering/renderer_rd/shaders/particles.glsl
@@ -567,11 +567,11 @@ void main() {
depth = particle_size - s;
const float EPSILON = 0.001;
normal = mat3(FRAME.colliders[i].transform) *
- normalize(
- vec3(
- texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(EPSILON, 0.0, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(EPSILON, 0.0, 0.0)).r,
- texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, EPSILON, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, EPSILON, 0.0)).r,
- texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, 0.0, EPSILON)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, 0.0, EPSILON)).r));
+ normalize(
+ vec3(
+ texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(EPSILON, 0.0, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(EPSILON, 0.0, 0.0)).r,
+ texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, EPSILON, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, EPSILON, 0.0)).r,
+ texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, 0.0, EPSILON)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, 0.0, EPSILON)).r));
}
} break;
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl
index 99714b4504..97c913d489 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl
@@ -2,7 +2,7 @@
float hash_2d(vec2 p) {
return fract(1.0e4 * sin(17.0 * p.x + 0.1 * p.y) *
- (0.1 + abs(sin(13.0 * p.y + p.x))));
+ (0.1 + abs(sin(13.0 * p.y + p.x))));
}
float hash_3d(vec3 p) {
@@ -29,8 +29,7 @@ float compute_alpha_hash_threshold(vec3 pos, float hash_scale) {
vec3 cases = vec3(a_interp * a_interp / (2.0 * min_lerp * (1.0 - min_lerp)),
(a_interp - 0.5 * min_lerp) / (1.0 - min_lerp),
- 1.0 - ((1.0 - a_interp) * (1.0 - a_interp) /
- (2.0 * min_lerp * (1.0 - min_lerp))));
+ 1.0 - ((1.0 - a_interp) * (1.0 - a_interp) / (2.0 * min_lerp * (1.0 - min_lerp))));
float alpha_hash_threshold =
(lerp_factor < (1.0 - min_lerp)) ? ((lerp_factor < min_lerp) ? cases.x : cases.y) : cases.z;
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl
index 2aeb10c932..a83f87d23a 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl
@@ -971,15 +971,15 @@ void main() {
const float c4 = 0.886227;
const float c5 = 0.247708;
ambient_light += (c1 * lightmap_captures.data[index].sh[8].rgb * (wnormal.x * wnormal.x - wnormal.y * wnormal.y) +
- c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
- c4 * lightmap_captures.data[index].sh[0].rgb -
- c5 * lightmap_captures.data[index].sh[6].rgb +
- 2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
- 2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
- 2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
- 2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
- 2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
- 2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
+ c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
+ c4 * lightmap_captures.data[index].sh[0].rgb -
+ c5 * lightmap_captures.data[index].sh[6].rgb +
+ 2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
+ 2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
+ 2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
+ 2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
+ 2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
+ 2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
} else if (bool(instances.data[instance_index].flags & INSTANCE_FLAGS_USE_LIGHTMAP)) { // has actual lightmap
bool uses_sh = bool(instances.data[instance_index].flags & INSTANCE_FLAGS_USE_SH_LIGHTMAP);
@@ -1256,10 +1256,10 @@ void main() {
// LIGHTING
#if !defined(MODE_RENDER_DEPTH) && !defined(MODE_UNSHADED)
- { //directional light
+ { // Directional light.
+ // Do shadow and lighting in two passes to reduce register pressure.
#ifndef SHADOWS_DISABLED
- // Do shadow and lighting in two passes to reduce register pressure
uint shadow0 = 0;
uint shadow1 = 0;
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl
index 61559fe809..b26489ddf1 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl
@@ -182,11 +182,11 @@ void light_compute(vec3 N, vec3 L, vec3 V, float A, vec3 light_color, float atte
float d = scale * abs(transmittance_z);
float dd = -d * d;
vec3 profile = vec3(0.233, 0.455, 0.649) * exp(dd / 0.0064) +
- vec3(0.1, 0.336, 0.344) * exp(dd / 0.0484) +
- vec3(0.118, 0.198, 0.0) * exp(dd / 0.187) +
- vec3(0.113, 0.007, 0.007) * exp(dd / 0.567) +
- vec3(0.358, 0.004, 0.0) * exp(dd / 1.99) +
- vec3(0.078, 0.0, 0.0) * exp(dd / 7.41);
+ vec3(0.1, 0.336, 0.344) * exp(dd / 0.0484) +
+ vec3(0.118, 0.198, 0.0) * exp(dd / 0.187) +
+ vec3(0.113, 0.007, 0.007) * exp(dd / 0.567) +
+ vec3(0.358, 0.004, 0.0) * exp(dd / 1.99) +
+ vec3(0.078, 0.0, 0.0) * exp(dd / 7.41);
diffuse_light += profile * transmittance_color.a * light_color * clamp(transmittance_boost - NdotL, 0.0, 1.0) * (1.0 / M_PI);
#else
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl
index 2b59e85e4f..2f5cc58619 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl
@@ -930,15 +930,15 @@ void main() {
const float c4 = 0.886227;
const float c5 = 0.247708;
ambient_light += (c1 * lightmap_captures.data[index].sh[8].rgb * (wnormal.x * wnormal.x - wnormal.y * wnormal.y) +
- c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
- c4 * lightmap_captures.data[index].sh[0].rgb -
- c5 * lightmap_captures.data[index].sh[6].rgb +
- 2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
- 2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
- 2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
- 2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
- 2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
- 2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
+ c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
+ c4 * lightmap_captures.data[index].sh[0].rgb -
+ c5 * lightmap_captures.data[index].sh[6].rgb +
+ 2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
+ 2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
+ 2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
+ 2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
+ 2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
+ 2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
} else if (bool(draw_call.flags & INSTANCE_FLAGS_USE_LIGHTMAP)) { // has actual lightmap
bool uses_sh = bool(draw_call.flags & INSTANCE_FLAGS_USE_SH_LIGHTMAP);
diff --git a/servers/rendering/renderer_rd/shaders/tonemap.glsl b/servers/rendering/renderer_rd/shaders/tonemap.glsl
index 1ce3e04421..948c6e1e39 100644
--- a/servers/rendering/renderer_rd/shaders/tonemap.glsl
+++ b/servers/rendering/renderer_rd/shaders/tonemap.glsl
@@ -140,7 +140,7 @@ vec4 texture2D_bicubic(sampler2D tex, vec2 uv, int p_lod) {
vec2 p3 = (vec2(iuv.x + h1x, iuv.y + h1y) - vec2(0.5f)) * pixel_size;
return (g0(fuv.y) * (g0x * textureLod(tex, p0, lod) + g1x * textureLod(tex, p1, lod))) +
- (g1(fuv.y) * (g0x * textureLod(tex, p2, lod) + g1x * textureLod(tex, p3, lod)));
+ (g1(fuv.y) * (g0x * textureLod(tex, p2, lod) + g1x * textureLod(tex, p3, lod)));
}
#define GLOW_TEXTURE_SAMPLE(m_tex, m_uv, m_lod) texture2D_bicubic(m_tex, m_uv, m_lod)
@@ -341,14 +341,14 @@ vec3 do_fxaa(vec3 color, float exposure, vec2 uv_interp) {
dir.y = ((lumaNW + lumaSW) - (lumaNE + lumaSE));
float dirReduce = max((lumaNW + lumaNE + lumaSW + lumaSE) *
- (0.25 * FXAA_REDUCE_MUL),
+ (0.25 * FXAA_REDUCE_MUL),
FXAA_REDUCE_MIN);
float rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);
dir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),
max(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),
dir * rcpDirMin)) *
- params.pixel_size;
+ params.pixel_size;
#ifdef MULTIVIEW
vec3 rgbA = 0.5 * exposure * (textureLod(source_color, vec3(uv_interp + dir * (1.0 / 3.0 - 0.5), ViewIndex), 0.0).xyz + textureLod(source_color, vec3(uv_interp + dir * (2.0 / 3.0 - 0.5), ViewIndex), 0.0).xyz) * params.luminance_multiplier;
diff --git a/servers/rendering/shader_language.cpp b/servers/rendering/shader_language.cpp
index 53f2d96f52..4c4fbfb2ed 100644
--- a/servers/rendering/shader_language.cpp
+++ b/servers/rendering/shader_language.cpp
@@ -3296,16 +3296,16 @@ bool ShaderLanguage::is_float_type(DataType p_type) {
}
bool ShaderLanguage::is_sampler_type(DataType p_type) {
return p_type == TYPE_SAMPLER2D ||
- p_type == TYPE_ISAMPLER2D ||
- p_type == TYPE_USAMPLER2D ||
- p_type == TYPE_SAMPLER2DARRAY ||
- p_type == TYPE_ISAMPLER2DARRAY ||
- p_type == TYPE_USAMPLER2DARRAY ||
- p_type == TYPE_SAMPLER3D ||
- p_type == TYPE_ISAMPLER3D ||
- p_type == TYPE_USAMPLER3D ||
- p_type == TYPE_SAMPLERCUBE ||
- p_type == TYPE_SAMPLERCUBEARRAY;
+ p_type == TYPE_ISAMPLER2D ||
+ p_type == TYPE_USAMPLER2D ||
+ p_type == TYPE_SAMPLER2DARRAY ||
+ p_type == TYPE_ISAMPLER2DARRAY ||
+ p_type == TYPE_USAMPLER2DARRAY ||
+ p_type == TYPE_SAMPLER3D ||
+ p_type == TYPE_ISAMPLER3D ||
+ p_type == TYPE_USAMPLER3D ||
+ p_type == TYPE_SAMPLERCUBE ||
+ p_type == TYPE_SAMPLERCUBEARRAY;
}
Variant ShaderLanguage::constant_value_to_variant(const Vector<ShaderLanguage::ConstantNode::Value> &p_value, DataType p_type, int p_array_size, ShaderLanguage::ShaderNode::Uniform::Hint p_hint) {
@@ -3873,16 +3873,16 @@ void ShaderLanguage::get_keyword_list(List<String> *r_keywords) {
bool ShaderLanguage::is_control_flow_keyword(String p_keyword) {
return p_keyword == "break" ||
- p_keyword == "case" ||
- p_keyword == "continue" ||
- p_keyword == "default" ||
- p_keyword == "do" ||
- p_keyword == "else" ||
- p_keyword == "for" ||
- p_keyword == "if" ||
- p_keyword == "return" ||
- p_keyword == "switch" ||
- p_keyword == "while";
+ p_keyword == "case" ||
+ p_keyword == "continue" ||
+ p_keyword == "default" ||
+ p_keyword == "do" ||
+ p_keyword == "else" ||
+ p_keyword == "for" ||
+ p_keyword == "if" ||
+ p_keyword == "return" ||
+ p_keyword == "switch" ||
+ p_keyword == "while";
}
void ShaderLanguage::get_builtin_funcs(List<String> *r_keywords) {
diff --git a/tests/test_class_db.h b/tests/test_class_db.h
index 20397bb144..4b058a4c67 100644
--- a/tests/test_class_db.h
+++ b/tests/test_class_db.h
@@ -224,20 +224,20 @@ bool arg_default_value_is_assignable_to_type(const Context &p_context, const Var
switch (p_val.get_type()) {
case Variant::NIL:
return p_context.find_exposed_class(p_arg_type) ||
- p_context.names_cache.is_nullable_type(p_arg_type.name);
+ p_context.names_cache.is_nullable_type(p_arg_type.name);
case Variant::BOOL:
return p_arg_type.name == p_context.names_cache.bool_type;
case Variant::INT:
return p_arg_type.name == p_context.names_cache.int_type ||
- p_arg_type.name == p_context.names_cache.float_type ||
- p_arg_type.is_enum;
+ p_arg_type.name == p_context.names_cache.float_type ||
+ p_arg_type.is_enum;
case Variant::FLOAT:
return p_arg_type.name == p_context.names_cache.float_type;
case Variant::STRING:
case Variant::STRING_NAME:
return p_arg_type.name == p_context.names_cache.string_type ||
- p_arg_type.name == p_context.names_cache.string_name_type ||
- p_arg_type.name == p_context.names_cache.node_path_type;
+ p_arg_type.name == p_context.names_cache.string_name_type ||
+ p_arg_type.name == p_context.names_cache.node_path_type;
case Variant::NODE_PATH:
return p_arg_type.name == p_context.names_cache.node_path_type;
case Variant::TRANSFORM3D:
@@ -269,13 +269,13 @@ bool arg_default_value_is_assignable_to_type(const Context &p_context, const Var
return p_context.find_exposed_class(p_arg_type);
case Variant::VECTOR2I:
return p_arg_type.name == p_context.names_cache.vector2_type ||
- p_arg_type.name == Variant::get_type_name(p_val.get_type());
+ p_arg_type.name == Variant::get_type_name(p_val.get_type());
case Variant::RECT2I:
return p_arg_type.name == p_context.names_cache.rect2_type ||
- p_arg_type.name == Variant::get_type_name(p_val.get_type());
+ p_arg_type.name == Variant::get_type_name(p_val.get_type());
case Variant::VECTOR3I:
return p_arg_type.name == p_context.names_cache.vector3_type ||
- p_arg_type.name == Variant::get_type_name(p_val.get_type());
+ p_arg_type.name == Variant::get_type_name(p_val.get_type());
default:
if (r_err_msg) {
*r_err_msg = "Unexpected Variant type: " + itos(p_val.get_type());
@@ -327,7 +327,7 @@ void validate_property(const Context &p_context, const ExposedClass &p_class, co
if (getter->return_type.name != setter_first_arg.type.name) {
// Special case for Node::set_name
bool whitelisted = getter->return_type.name == p_context.names_cache.string_name_type &&
- setter_first_arg.type.name == p_context.names_cache.string_type;
+ setter_first_arg.type.name == p_context.names_cache.string_type;
TEST_FAIL_COND(!whitelisted,
"Return type from getter doesn't match first argument of setter, for property: '", p_class.name, ".", String(p_prop.name), "'.");
@@ -609,7 +609,7 @@ void add_exposed_classes(Context &r_context) {
method.return_type.name = return_info.class_name;
bool bad_reference_hint = !method.is_virtual && return_info.hint != PROPERTY_HINT_RESOURCE_TYPE &&
- ClassDB::is_parent_class(return_info.class_name, r_context.names_cache.ref_counted_class);
+ ClassDB::is_parent_class(return_info.class_name, r_context.names_cache.ref_counted_class);
TEST_COND(bad_reference_hint, "Return type is reference but hint is not '" _STR(PROPERTY_HINT_RESOURCE_TYPE) "'.", " Are you returning a reference type by pointer? Method: '",
exposed_class.name, ".", method.name, "'.");
} else if (return_info.hint == PROPERTY_HINT_RESOURCE_TYPE) {